some thesis fixes

Reviewed-on: #33

.github/workflows/tagged-release.yml

@@ -3,7 +3,7 @@ name: "tagged-release"
 on:
   push:
     tags:
-      - "v*"
+      - "*"
 
 jobs:
   tagged-release:
@@ -11,27 +11,28 @@ jobs:
     runs-on: "ubuntu-latest"
 
     steps:
+      - name: Clone repository
+        uses: actions/checkout@v3
       - name: Setup Java
         uses: actions/setup-java@v3
         with:
           distribution: 'adopt'
-          java-version: '11'
+          java-version: '17'
       - name: Setup Gradle
         uses: gradle/gradle-build-action@v2
-      - name: Clone repository
-        uses: GuillaumeFalourd/clone-github-repo-action@main
         with:
-          branch: 'master'
-          owner: 'TopchetoEU'
-          repository: 'java-jscript'
+          cache-disabled: true
+          gradle-version: "8.10"
       - name: Build
-        run: |
-          cd java-jscript; gradle build
-
-      - uses: "marvinpinto/action-automatic-releases@latest"
+        run: gradle build
+      - name: Publish
+        run: gradle publish
+        env:
+          ACCESS_TOKEN: "${{secrets.PACKAGE_TOKEN}}"
+          REPO_URL: "${{github.server_url}}/api/packages/${{github.repository_owner}}/maven"
+      - name: Create release
+        uses: "https://gitea.com/actions/gitea-release-action@main"
         with:
-          repo_token: "${{ secrets.GITHUB_TOKEN }}"
-          prerelease: false
           files: |
-            java-jscript/LICENSE
-            java-jscript/build/libs/*.jar
+            LICENSE
+            build/libs/*.jar

.gitignore

@@ -1,24 +1,53 @@
-*
+/*
 
-!/src
-!/src/**/*
+/buildSrc/*
+!/buildSrc
+!/buildSrc
+!/buildSrc/src
+!/buildSrc/build.gradle.kts
 
+/common/*
+!/common
+!/common/src
+!/common/build.gradle.kts
+
+/runtime/*
+!/runtime
+!/runtime/src
+!/runtime/build.gradle.kts
+
+/compilation/*
+!/compilation
+!/compilation/src
+!/compilation/build.gradle.kts
+
+/repl/*
+!/repl
+!/repl/src
+!/repl/build.gradle.kts
+
+/lib/*
+!/lib
+!/lib/src
+!/lib/build.gradle.kts
+!/lib/package.json
+!/lib/tsconfig.json
+!/lib/rollup.config.js
+
+# !/src
 !/doc
-!/doc/**/*
-
 !/tests
-!/tests/**/*
-
 !/.github
-!/.github/**/*
 
 !/.gitignore
 !/.gitattributes
 !/LICENSE
 !/README.md
-!/settings.gradle
-!/build.gradle
+
+!/settings.gradle.kts
+!/build.gradle.kts
 !/gradle.properties
-!/gradle
-!/gradle/wrapper
-!/gradle/wrapper/gradle-wrapper.properties
+
+!/package.json
+!/rollup.config.js
+!/tsconfig.json

README.md

@@ -1,29 +1,77 @@
-# JScript
-
-**NOTE: This had nothing to do with Microsoft's dialect of EcmaScript**
+# J2S (Java-JavaScript or Java to JavaScript)
 
 **WARNING: Currently, this code is undocumented. Proceed with caution and a psychiatrist.**
 
-JScript is an engine, capable of running EcmaScript 5, written entirely in Java. This engine has been developed with the goal of being easy to integrate with your preexisting codebase, **THE GOAL OF THIS ENGINE IS NOT PERFORMANCE**. My crude experiments show that this engine is 50x-100x slower than V8, which, although bad, is acceptable for most simple scripting purposes. Note that although the codebase has a Main class, this isn't meant to be a standalone program, but instead a library for running JavaScript code.
+J2S is an engine, capable of running EcmaScript 5, written entirely in Java. This engine has been developed with the goal of being easy to integrate with your preexisting codebase, **THE GOAL OF THIS ENGINE IS NOT PERFORMANCE**. My crude experiments show that this engine is 50x-100x slower than V8, which, although bad, is acceptable for most simple scripting purposes. A small REPL (`me.topchetoeu.j2s.repl.SimpleRepl`) library with an included simple debugger (`me.topchetoeu.j2s.repl.debug.SimpleDebugger`). These are more or less reference implementations. In the future, most of the primordials logic of `SimpleRepl` will be moved in the "lib" project, but for now, it will stay there.
 
-## Example
+## How to use?
 
-The following is going to execute a simple javascript statement:
+Since this is mostly targeted for integration into other applications, here, examples for invoking JS code from Java will be shown. In the future, a more comprehensive wiki will be made.
+
+### Setting up an event loop
+
+First of all, you will want to create an event loop. While not required, 99% of the times you will want to have one.
 
 ```java
 var engine = new Engine();
-// Initialize a standard environment, with implementations of most basic standard libraries (Object, Array, Symbol, etc.)
-var env = Internals.apply(new Environment());
-
-// Queue code to load internal libraries and start engine
-var awaitable = engine.pushMsg(false, env, new Filename("tmp", "eval"), "10 + Math.sqrt(5 / 3)", null);
-// Run the engine on the same thread, until the event loop runs empty
-engine.run(true);
-
-// Get our result
-System.out.println(awaitable.await());
+var thread = engine.start();
 ```
 
-## NOTE:
+Hooray! Now you have an event loop. The thread that was automatically created is a daemon thread, so it will harakiri when the rest of the application ends. If you don't want to use the built-in thread, you can instead run it with `engine.run(untilEmpty)`. If you pass true (which you most likely need), the event loop will be run blocking-ly until it is empty. Otherwise, it will be run forever.
 
-To setup the typescript bundle in your sources, run `node build.js init-ts`. This will download the latest version of typescript, minify it, and add it to your src folder. If you are going to work with the `node build.js debug|release` command, this is not a necessary step.
+### Creating the execution environment
+
+This is one of the other crucial parts of J2S's architecture - the environment. It contains the global scope, a reference to the event loop, the global scope, the debugger, source mappings and a lot more. To run JS code, you must create an environment:
+
+```java
+var env = Environment.empty();
+env.add(EventLoop.KEY, engine); // Gives 
+env.add(DebugContext.KEY, new DebugContext()); // For source mappings
+```
+
+As you can see, the environment is nothing more than a simple map of objects that may be of interest to the JS code. Although you can do much more with the environment, we will leave it at that.
+
+### Registering the compiler
+
+Since the compiler is a part of the runtime, you need to register it in the environment. You can use the following boilerplate, although a nicer API will be exposed later on:
+
+```java
+env.add(Compiler.KEY, (_env, filename, raw, mapper) -> {
+	try {
+		// Invokes the compiler. Will return a CompilerResult, which, along other things,
+		// gives us all the compiled function bodies (aka function scaffoldings, that can be used to construct a function value)
+		var res = JavaScript.compile(env, filename, raw, true);
+		var body = res.body();
+
+		// We'll register the source and function source mappings for debugging
+		DebugContext.get(env).onSource(filename, raw);
+		for (var el : res.all()) {
+			DebugContext.get(env).onFunctionLoad(el.body(), el.map(mapper));
+		}
+
+		// Finally, we will construct the function
+		// Few things to note: we need to pass the environment, the name of the function (the filename),
+		// and the last thing: the captures. Since we are compiling the main function, we don't have
+		// any captures, so we pass an empty array
+		return new CodeFunction(env, filename.toString(), body, new Value[0][]);
+	}
+	catch (SyntaxException e) {
+		// Convert the exception to an engine exception
+		var res = EngineException.ofSyntax(e.msg);
+		// Add the location of the error to its stack trace
+		res.add(env, e.loc.filename() + "", e.loc);
+		throw res;
+	}
+});
+```
+
+### Evaluating a piece of code on the event loop
+
+This is what you really want to do: run code! You can do that in the following way:
+
+```java
+var result = engine.pushMsg(false, env, Filename.parse("my-app://test.js"), "return 10 + 5 / 3;", Value.UNDEFINED).get();
+System.out.println(result.toReadable(env));
+```
+
+If all goes well, we will get "11.666..." as a result.

build.gradle

@@ -1,32 +0,0 @@
-plugins {
-    id "application"
-}
-
-java {
-    sourceCompatibility = JavaVersion.VERSION_11
-    targetCompatibility = JavaVersion.VERSION_11
-    toolchain.languageVersion = JavaLanguageVersion.of(11)
-    withSourcesJar()
-}
-
-jar {
-    manifest.attributes["Main-class"] = project.main_class
-}
-
-sourceSets {
-    main.java.srcDirs = [ "src/java" ]
-    main.resources.srcDirs = [ "src/assets" ]
-}
-
-processResources {
-    filesMatching "metadata.json", {
-        expand(
-            version: project.project_version,
-            name: project.project_name
-        )
-    }
-}
-
-base.archivesName = project.project_name
-version = project.project_version
-group = project.project_group

build.gradle.kts

@@ -0,0 +1,23 @@
+plugins {
+	id("base");
+}
+
+version = properties["project_version"].toString();
+group = properties["project_group"].toString();
+description = "ES5-compliant JavaScript interpreter";
+
+tasks.wrapper {
+	gradleVersion = "8.10";
+}
+
+tasks.build {
+	for (proj in subprojects) {
+		dependsOn(proj.tasks.named("build"));
+		doLast {
+			copy {
+				from(proj.buildDir.resolve("libs"));
+				into("$buildDir/libs");
+			}
+		}
+	}
+}

buildSrc/build.gradle.kts

@@ -0,0 +1,7 @@
+repositories {
+	mavenCentral();
+}
+
+plugins {
+	`kotlin-dsl`
+}

buildSrc/src/main/kotlin/common-java.gradle.kts

@@ -0,0 +1,15 @@
+plugins {
+	id("common");
+}
+
+java {
+	sourceCompatibility = JavaVersion.VERSION_17;
+	targetCompatibility = JavaVersion.VERSION_17;
+
+	toolchain {
+		languageVersion = JavaLanguageVersion.of(17);
+	}
+
+	withJavadocJar();
+	withSourcesJar();
+}

buildSrc/src/main/kotlin/common.gradle.kts

@@ -0,0 +1,47 @@
+plugins {
+	id("java");
+	id("maven-publish");
+}
+
+version = rootProject.version;
+group = rootProject.group;
+base.archivesName = "${properties["project_name"]}-${project.name}";
+
+tasks.named<JavaCompile>("compileJava") {
+	options.release.set(8);
+}
+
+repositories {
+	mavenCentral();
+}
+
+dependencies {
+	annotationProcessor("com.github.bsideup.jabel:jabel-javac-plugin:0.4.2");
+	compileOnly("com.github.bsideup.jabel:jabel-javac-plugin:0.4.2");
+	testImplementation("org.junit.jupiter:junit-jupiter:5.9.2");
+	testRuntimeOnly("org.junit.platform:junit-platform-launcher");
+}
+
+
+publishing {
+	repositories {
+		maven {
+			name = "Gitea";
+			url = uri(System.getenv("REPO_URL") ?: "");
+
+			credentials(HttpHeaderCredentials::class) {
+				name = "Authorization";
+				value = "token ${System.getenv("ACCESS_TOKEN")}";
+			}
+
+			authentication {
+				create<HttpHeaderAuthentication>("header");
+			}
+		}
+	}
+	publications {
+		create<MavenPublication>("maven") {
+			from(components["java"]);
+		}
+	}
+}

common/build.gradle.kts

@@ -0,0 +1,18 @@
+plugins {
+	id("common-java");
+}
+
+description = "A collection of utils and structures for the rest of the project";
+
+tasks.processResources {
+	filesMatching("metadata", {
+		expand(
+			"version" to properties["project_version"],
+			"name" to properties["project_name"],
+		);
+	});
+}
+
+tasks.test {
+	useJUnitPlatform();
+}

common/src/main/java/me/topchetoeu/j2s/common/Environment.java

@@ -0,0 +1,100 @@
+package me.topchetoeu.j2s.common;
+
+import java.util.HashMap;
+import java.util.HashSet;
+import java.util.Map;
+import java.util.Set;
+import java.util.function.Supplier;
+
+public class Environment {
+	public final Environment parent;
+	private final Map<Key<Object>, Object> map = new HashMap<>();
+	private final Set<Key<Object>> hidden = new HashSet<>();
+
+	@SuppressWarnings("unchecked")
+	public <T> T get(Key<T> key) {
+		if (map.containsKey(key)) return (T)map.get(key);
+		else if (!hidden.contains(key) && parent != null) return parent.get(key);
+		else return null;
+	}
+	public boolean has(Key<?> key) {
+		if (map.containsKey(key)) return true;
+		else if (!hidden.contains(key) && parent != null) return parent.has(key);
+		else return false;
+	}
+
+	public boolean hasNotNull(Key<?> key) {
+		return get(key) != null;
+	}
+
+	public <T> T get(Key<T> key, T defaultVal) {
+		if (has(key)) return get(key);
+		else return defaultVal;
+	}
+	public <T> T getWith(Key<T> key, Supplier<T> defaultVal) {
+		if (has(key)) return get(key);
+		else return defaultVal.get();
+	}
+
+	@SuppressWarnings("unchecked")
+	public <T> Environment add(Key<T> key, T val) {
+		map.put((Key<Object>)key, val);
+		hidden.remove(key);
+		return this;
+	}
+	public Environment add(Key<Void> key) {
+		return add(key, null);
+	}
+	@SuppressWarnings("all")
+	public Environment addAll(Map<Key<?>, ?> map, boolean iterableAsMulti) {
+		map.putAll((Map)map);
+		hidden.removeAll(map.keySet());
+		return this;
+	}
+	public Environment addAll(Map<Key<?>, ?> map) {
+		return addAll(map, true);
+	}
+
+	@SuppressWarnings("unchecked")
+	public Environment remove(Key<?> key) {
+		map.remove(key);
+		hidden.add((Key<Object>)key);
+		return this;
+	}
+
+	public <T> T init(Key<T> key, T val) {
+		if (!has(key)) {
+			this.add(key, val);
+			return val;
+		}
+		else return get(key);
+	}
+	public <T> T initFrom(Key<T> key, Supplier<T> val) {
+		if (!has(key)) {
+			var res = val.get();
+			this.add(key, res);
+			return res;
+		}
+		else return get(key);
+	}
+
+	public Environment child() {
+		return new Environment(this);
+	}
+
+	public Environment(Environment parent) {
+		this.parent = parent;
+	}
+	public Environment() {
+		this.parent = null;
+	}
+
+	public static Environment wrap(Environment env) {
+		if (env == null) return empty();
+		else return env;
+	}
+
+	public static Environment empty() {
+		return new Environment();
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/Filename.java

@@ -0,0 +1,53 @@
+package me.topchetoeu.j2s.common;
+
+import java.io.File;
+
+public class Filename {
+	public final String protocol;
+	public final String path;
+
+	@Override public String toString() {
+		return protocol + "://" + path;
+	}
+	@Override public int hashCode() {
+		final int prime = 31;
+		int result = 1;
+		result = prime * result + protocol.hashCode();
+		result = prime * result + path.hashCode();
+		return result;
+	}
+	@Override public boolean equals(Object obj) {
+		if (this == obj) return true;
+		if (obj == null) return false;
+		if (getClass() != obj.getClass()) return false;
+
+		var other = (Filename) obj;
+
+		if (protocol == null) {
+			if (other.protocol != null) return false;
+		}
+		else if (!protocol.equals(other.protocol)) return false;
+
+		if (path == null) {
+			if (other.path != null) return false;
+		}
+		else if (!path.equals(other.path)) return false;
+		return true;
+	}
+
+	public Filename(String protocol, String path) {
+		path = path.trim();
+		protocol = protocol.trim();
+		this.protocol = protocol;
+		this.path = path;
+	}
+
+	public static Filename parse(String val) {
+		var i = val.indexOf("://");
+		if (i >= 0) return new Filename(val.substring(0, i).trim(), val.substring(i + 3).trim());
+		else return new Filename("file", val.trim());
+	}
+	public static Filename fromFile(File file) {
+		return new Filename("file", file.getAbsolutePath());
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/FunctionBody.java

@@ -0,0 +1,16 @@
+package me.topchetoeu.j2s.common;
+
+public class FunctionBody {
+	public final FunctionBody[] children;
+	public final Instruction[] instructions;
+	public final int localsN, capturablesN, capturesN, length;
+
+	public FunctionBody(int localsN, int capturablesN, int capturesN, int length,  Instruction[] instructions, FunctionBody[] children) {
+		this.children = children;
+		this.length = length;
+		this.localsN = localsN;
+		this.capturablesN = capturablesN;
+		this.capturesN = capturesN;
+		this.instructions = instructions;
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/FunctionMap.java

@@ -0,0 +1,62 @@
+package me.topchetoeu.j2s.common;
+
+import java.util.Arrays;
+import java.util.regex.Pattern;
+
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+
+public interface FunctionMap {
+	public static final FunctionMap EMPTY = new FunctionMap() {
+		@Override public Location first() {
+			return null;
+		}
+		@Override public Location last() {
+			return null;
+		}
+
+		@Override public Location toLocation(int i, boolean approximate) {
+			return null;
+		}
+
+		@Override public BreakpointType getBreakpoint(int i) {
+			return BreakpointType.NONE;
+		}
+		@Override public Iterable<Location> breakpoints(Location start, Location end) {
+			return Arrays.asList();
+		}
+
+		@Override public Location correctBreakpoint(Location i) {
+			return null;
+		}
+		@Override public Iterable<Location> correctBreakpoint(Pattern filename, int line, int column) {
+			return Arrays.asList();
+		}
+
+		@Override public String[] localNames() {
+			return null;
+		}
+		@Override public String[] capturableNames() {
+			return null;
+		}
+		@Override public String[] captureNames() {
+			return null;
+		}
+	};
+
+	Location first();
+	Location last();
+
+	Location toLocation(int i, boolean approximate);
+	default Location toLocation(int i) {
+		return toLocation(i, false);
+	}
+
+	BreakpointType getBreakpoint(int i);
+	Location correctBreakpoint(Location i);
+	Iterable<Location> correctBreakpoint(Pattern filename, int line, int column);
+	Iterable<Location> breakpoints(Location start, Location end);
+
+	String[] localNames();
+	String[] capturableNames();
+	String[] captureNames();
+}

common/src/main/java/me/topchetoeu/j2s/common/Instruction.java

@@ -0,0 +1,348 @@
+package me.topchetoeu.j2s.common;
+
+import java.util.HashMap;
+import java.util.function.IntFunction;
+import java.util.function.IntSupplier;
+
+public class Instruction {
+	public static enum Type {
+		RETURN(0x00),
+		NOP(0x01),
+		THROW(0x02),
+		THROW_SYNTAX(0x03),
+		DELETE(0x04),
+		TRY_START(0x05),
+		TRY_END(0x06),
+
+		CALL(0x10),
+		CALL_NEW(0x12),
+		JMP_IF(0x18),
+		JMP_IFN(0x19),
+		JMP(0x1A),
+
+		PUSH_UNDEFINED(0x20),
+		PUSH_NULL(0x21),
+		PUSH_BOOL(0x22),
+		PUSH_NUMBER(0x23),
+		PUSH_STRING(0x24),
+		DUP(0x25),
+		DISCARD(0x26),
+
+		LOAD_FUNC(0x30),
+		LOAD_ARR(0x31),
+		LOAD_OBJ(0x32),
+
+		LOAD_GLOB(0x38),
+		LOAD_INTRINSICS(0x39),
+		LOAD_ARG(0x3A),
+		LOAD_ARGS_N(0x3B),
+		LOAD_ARGS(0x3C),
+		LOAD_CALLED(0x3D),
+		LOAD_THIS(0x3E),
+		LOAD_ERROR(0x3F),
+
+		LOAD_VAR(0x40),
+		LOAD_MEMBER(0x41),
+		LOAD_MEMBER_INT(0x42),
+		LOAD_MEMBER_STR(0x43),
+
+		STORE_VAR(0x48),
+		STORE_MEMBER(0x49),
+		STORE_MEMBER_INT(0x4A),
+		STORE_MEMBER_STR(0x4B),
+
+		GLOB_GET(0x50),
+		GLOB_SET(0x51),
+		GLOB_DEF(0x52),
+
+		OPERATION(0x56);
+
+		private static final HashMap<Integer, Type> types = new HashMap<>();
+		public final int numeric;
+
+		static {
+			for (var val : Type.values()) types.put(val.numeric, val);
+		}
+
+		private Type(int numeric) {
+			this.numeric = numeric;
+		}
+
+		public static Type fromNumeric(int i) {
+			return types.get(i);
+		}
+	}
+	public static enum BreakpointType {
+		/**
+		 * A debugger should never stop at such instruction, unless a breakpoint has been set on it
+		 */
+		NONE,
+		/**
+		 * Debuggers should pause at instructions marked with this breakpoint type
+		 * after any step command
+		 */
+		STEP_OVER,
+		/**
+		 * Debuggers should pause at instructions marked with this breakpoint type
+		 * only after a step-in command
+		 */
+		STEP_IN;
+
+		public boolean shouldStepIn() {
+			return this != NONE;
+		}
+		public boolean shouldStepOver() {
+			return this == STEP_OVER;
+		}
+	}
+
+	public final Type type;
+	public final Object[] params;
+
+	@SuppressWarnings("unchecked")
+	public <T> T get(int i) {
+		if (i >= params.length || i < 0) return null;
+		return (T)params[i];
+	}
+
+	private Instruction(Type type, Object ...params) {
+		this.type = type;
+		this.params = params;
+	}
+
+	/**
+	 * Signals the start of a protected context
+	 * @param catchStart The point to witch to jump if an error has been caught
+	 * @param finallyStart The point to witch to jump after either the try or catch bodies have exited
+	 * @param end The point to which to jump after exiting the whole protected context
+	 */
+	public static Instruction tryStart(int catchStart, int finallyStart, int end) {
+		return new Instruction(Type.TRY_START, catchStart, finallyStart, end);
+	}
+	/**
+	 * Signifies that the current protected section (try, catch or finally) has ended
+	 */
+	public static Instruction tryEnd() {
+		return new Instruction(Type.TRY_END);
+	}
+	/**
+	 * Throws the top stack value
+	 */
+	public static Instruction throwInstr() {
+		return new Instruction(Type.THROW);
+	}
+	/**
+	 * Converts the given exception to a runtime syntax error and throws it
+	 */
+	public static Instruction throwSyntax(SyntaxException err) {
+		return new Instruction(Type.THROW_SYNTAX, err.getMessage());
+	}
+	/**
+	 * Converts the given exception to a runtime syntax error and throws it
+	 */
+	public static Instruction throwSyntax(String err) {
+		return new Instruction(Type.THROW_SYNTAX, err);
+	}
+	/**
+	 * Converts the given exception to a runtime syntax error and throws it
+	 */
+	public static Instruction throwSyntax(Location loc, String err) {
+		return new Instruction(Type.THROW_SYNTAX, new SyntaxException(loc, err).getMessage());
+	}
+	/**
+	 * Performs a JS object property deletion.
+	 * Operands:
+	 * 1. Object to manipulate
+	 * 2. Key to delete
+	 */
+	public static Instruction delete() {
+		return new Instruction(Type.DELETE);
+	}
+	/**
+	 * Returns the top stack value
+	 */
+	public static Instruction ret() {
+		return new Instruction(Type.RETURN);
+	}
+	/**
+	 * A special NOP instruction telling any debugger to pause
+	 */
+	public static Instruction debug() {
+		return new Instruction(Type.NOP, "debug");
+	}
+
+	/**
+	 * Does nothing. May be used for metadata or implementation-specific instructions that don't alter the behavior
+	 */
+	public static Instruction nop(Object ...params) {
+		return new Instruction(Type.NOP, params);
+	}
+
+	public static Instruction call(int argn, boolean hasSelf) {
+		return new Instruction(Type.CALL, argn, hasSelf);
+	}
+	public static Instruction callNew(int argn) {
+		return new Instruction(Type.CALL_NEW, argn);
+	}
+
+	public static Instruction jmp(int offset) {
+		return new Instruction(Type.JMP, offset);
+	}
+	public static Instruction jmpIf(int offset) {
+		return new Instruction(Type.JMP_IF, offset);
+	}
+	public static Instruction jmpIfNot(int offset) {
+		return new Instruction(Type.JMP_IFN, offset);
+	}
+
+	public static IntFunction<Instruction> jmp(IntSupplier pos) {
+		return i -> new Instruction(Type.JMP, pos.getAsInt() - i);
+	}
+	public static IntFunction<Instruction> jmpIf(IntSupplier pos) {
+		return i -> new Instruction(Type.JMP_IF, pos.getAsInt() - i);
+	}
+	public static IntFunction<Instruction> jmpIfNot(IntSupplier pos) {
+		return i -> new Instruction(Type.JMP_IFN, pos.getAsInt() - i);
+	}
+
+	public static Instruction pushUndefined() {
+		return new Instruction(Type.PUSH_UNDEFINED);
+	}
+	public static Instruction pushNull() {
+		return new Instruction(Type.PUSH_NULL);
+	}
+	public static Instruction pushValue(boolean val) {
+		return new Instruction(Type.PUSH_BOOL, val);
+	}
+	public static Instruction pushValue(double val) {
+		return new Instruction(Type.PUSH_NUMBER, val);
+	}
+	public static Instruction pushValue(String val) {
+		return new Instruction(Type.PUSH_STRING, val);
+	}
+
+	public static Instruction globDef(String name) {
+		return new Instruction(Type.GLOB_DEF, name);
+	}
+	
+	public static Instruction globGet(String name, boolean force) {
+		return new Instruction(Type.GLOB_GET, name, force);
+	}
+	public static Instruction globSet(String name, boolean keep, boolean define) {
+		return new Instruction(Type.GLOB_SET, name, keep, define);
+	}
+
+	public static Instruction loadVar(int i) {
+		return new Instruction(Type.LOAD_VAR, i);
+	}
+	public static Instruction loadThis() {
+		return new Instruction(Type.LOAD_THIS);
+	}
+	/**
+	 * Loads the given argument
+	 * @param i The index of the argument to load. If -1, will get the index from the stack instead
+	 */
+	public static Instruction loadArg(int i) {
+		return new Instruction(Type.LOAD_ARG, i);
+	}
+	/**
+	 * Pushes the amount of arguments to the stack
+	 */
+	public static Instruction loadArgsN() {
+		return new Instruction(Type.LOAD_ARGS_N);
+	}
+	/**
+	 * Pushes the arguments object to the stack
+	 */
+	public static Instruction loadArgs() {
+		return new Instruction(Type.LOAD_ARGS);
+	}
+	/**
+	 * Loads a reference to the function being called
+	 */
+	public static Instruction loadCalled() {
+		return new Instruction(Type.LOAD_CALLED);
+	}
+	public static Instruction loadGlob() {
+		return new Instruction(Type.LOAD_GLOB);
+	}
+	public static Instruction loadIntrinsics(String key) {
+		return new Instruction(Type.LOAD_INTRINSICS, key);
+	}
+	public static Instruction loadError() {
+		return new Instruction(Type.LOAD_ERROR);
+	}
+	public static Instruction loadMember() {
+		return new Instruction(Type.LOAD_MEMBER);
+	}
+	public static Instruction loadMember(int member) {
+		return new Instruction(Type.LOAD_MEMBER_INT, member);
+	}
+	public static Instruction loadMember(String member) {
+		return new Instruction(Type.LOAD_MEMBER_STR, member);
+	}
+
+	// TODO: make this capturing a concern of the compiler
+	public static Instruction loadFunc(int id, String name, int[] captures) {
+		var args = new Object[2 + captures.length];
+		args[0] = id;
+		args[1] = name;
+		for (var i = 0; i < captures.length; i++) args[i + 2] = captures[i];
+		return new Instruction(Type.LOAD_FUNC, args);
+	}
+	public static Instruction loadObj() {
+		return new Instruction(Type.LOAD_OBJ);
+	}
+	public static Instruction loadArr(int count) {
+		return new Instruction(Type.LOAD_ARR, count);
+	}
+	public static Instruction dup() {
+		return new Instruction(Type.DUP, 1, 0);
+	}
+	public static Instruction dup(int count, int offset) {
+		return new Instruction(Type.DUP, count, offset);
+	}
+
+	public static Instruction storeVar(int i, boolean keep) {
+		return new Instruction(Type.STORE_VAR, i, keep);
+	}
+
+	public static Instruction storeMember() {
+		return new Instruction(Type.STORE_MEMBER, false);
+	}
+	public static Instruction storeMember(boolean keep) {
+		return new Instruction(Type.STORE_MEMBER, keep);
+	}
+
+	public static Instruction storeMember(String key) {
+		return new Instruction(Type.STORE_MEMBER_STR, key, false);
+	}
+	public static Instruction storeMember(String key, boolean keep) {
+		return new Instruction(Type.STORE_MEMBER_STR, key, keep);
+	}
+
+	public static Instruction storeMember(int key) {
+		return new Instruction(Type.STORE_MEMBER_INT, key, false);
+	}
+	public static Instruction storeMember(int key, boolean keep) {
+		return new Instruction(Type.STORE_MEMBER_INT, key, keep);
+	}
+
+	public static Instruction discard() {
+		return new Instruction(Type.DISCARD);
+	}
+
+	public static Instruction operation(Operation op) {
+		return new Instruction(Type.OPERATION, op);
+	}
+
+	@Override public String toString() {
+		var res = type.toString();
+
+		for (int i = 0; i < params.length; i++) {
+			res += " " + params[i];
+		}
+
+		return res;
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/Key.java

@@ -0,0 +1,3 @@
+package me.topchetoeu.j2s.common;
+
+public final class Key<T> { }

common/src/main/java/me/topchetoeu/j2s/common/Location.java

@@ -0,0 +1,124 @@
+package me.topchetoeu.j2s.common;
+
+import java.util.ArrayList;
+import java.util.Objects;
+
+public abstract class Location implements Comparable<Location> {
+	public static final Location INTERNAL = Location.of(new Filename(Metadata.name(), "native"), -1, -1);
+
+	public abstract int line();
+	public abstract int start();
+	public abstract Filename filename();
+
+	public final String toString() {
+		var res = new ArrayList<String>();
+
+		if (filename() != null) res.add(filename().toString());
+		if (line() >= 0) res.add(line() + 1 + "");
+		if (start() >= 0) res.add(start() + 1 + "");
+
+		return String.join(":", res);
+	}
+
+	public final Location add(int n) {
+		var self = this;
+
+		return new Location() {
+			@Override public Filename filename() { return self.filename(); }
+			@Override public int start() { return self.start() + n; }
+			@Override public int line() { return self.line(); }
+		};
+	}
+	public final Location nextLine() {
+		return nextLine(1);
+	}
+	public final Location nextLine(int offset) {
+		var self = this;
+
+		return new Location() {
+			@Override public Filename filename() { return self.filename(); }
+			@Override public int start() { return 0; }
+			@Override public int line() { return self.line() + offset; }
+		};
+	}
+
+	@Override public int hashCode() {
+		return Objects.hash(line(), start(), filename());
+	}
+	@Override public boolean equals(Object obj) {
+		if (this == obj) return true;
+		if (!(obj instanceof Location)) return false;
+		var other = (Location)obj;
+
+		if (!Objects.equals(this.start(), other.start())) return false;
+		if (!Objects.equals(this.line(), other.line())) return false;
+		if (!Objects.equals(this.filename(), other.filename())) return false;
+
+		return true;
+	}
+
+	@Override public int compareTo(Location other) {
+		int a;
+		var filenameA = filename();
+		var filenameB = other.filename();
+		if (filenameB == null && filenameA == null) a = 0;
+		else if (filenameA == null) a = -1;
+		else if (filenameB == null) a = 1;
+		else a = filenameA.toString().compareTo(filenameB.toString());
+
+		int b = Integer.compare(line(), other.line());
+		int c = Integer.compare(start(), other.start());
+
+		if (a != 0) return a;
+		if (b != 0) return b;
+
+		return c;
+	}
+
+	public static Location of(Filename filename, int line, int start) {
+		return new Location() {
+			@Override public Filename filename() { return filename; }
+			@Override public int start() { return start; }
+			@Override public int line() { return line; }
+		};
+	}
+
+	public static Location of(String raw) {
+		var i1 = raw.lastIndexOf(':');
+		if (i1 < 0) return Location.of(Filename.parse(raw), -1, -1);
+
+		var i0 = raw.substring(0, i1).lastIndexOf(':', i1);
+		if (i0 < 0) {
+			try {
+				return Location.of(null, Integer.parseInt(raw.substring(0, i1)) - 1, Integer.parseInt(raw.substring(i1 + 1)) - 1);
+			}
+			catch (NumberFormatException e) {}
+
+			try {
+				return Location.of(Filename.parse(raw.substring(0, i1)), Integer.parseInt(raw.substring(i1 + 1)) - 1, -1);
+			}
+			catch (NumberFormatException e) {}
+
+			return Location.of(Filename.parse(raw), -1, -1);
+		}
+
+		int start, line;
+
+
+		try {
+			start = Integer.parseInt(raw.substring(i1 + 1));
+		}
+		catch (NumberFormatException e) {
+			return Location.of(Filename.parse(raw), -1, -1);
+		}
+
+		try {
+			line = Integer.parseInt(raw.substring(i0 + 1, i1));
+		}
+		catch (NumberFormatException e) {
+			return Location.of(Filename.parse(raw.substring(0, i1)), start - 1, -1);
+		}
+
+		return Location.of(Filename.parse(raw.substring(0, i0)), line - 1, start - 1);
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/Metadata.java

@@ -0,0 +1,58 @@
+package me.topchetoeu.j2s.common;
+
+public class Metadata {
+	private static String VERSION;
+	private static String AUTHOR;
+	private static String NAME;
+
+	static {
+		var raw = Reading.resourceToString("metadata").split("\n");
+		var line = 0;
+		var file = "internal://metadata";
+
+		for (var el : raw) {
+			line++;
+
+			el = el.trim();
+			if (el.startsWith("#")) continue;
+			if (el.isEmpty()) continue;
+
+			var i = el.indexOf(":");
+			if (i < 0) throw new RuntimeException(String.format("%s:%s: Expected colon on line", file, line));
+
+			var name = el.substring(0, i).trim();
+			var value = el.substring(i + 1).trim();
+
+			switch (name) {
+				case "version":
+					VERSION = value;
+					break;
+				case "author":
+					AUTHOR = value;
+					break;
+				case "name":
+					NAME = value;
+					break;
+				default:
+					throw new RuntimeException(String.format("%s:%s: Unexpected metadata key '%s'", file, line, name));
+			}
+		}
+
+		if (VERSION == null) throw new RuntimeException(String.format("%s:%s: No version specified", file, line));
+		if (AUTHOR == null) throw new RuntimeException(String.format("%s:%s: No author specified", file, line));
+		if (NAME == null) throw new RuntimeException(String.format("%s:%s: No name specified", file, line));
+	}
+
+	public static String version() {
+		if (VERSION.equals("${VERSION}")) return "1337-devel";
+		else return VERSION;
+	}
+	public static String author() {
+		if (AUTHOR.equals("${AUTHOR}")) return "anonymous";
+		else return AUTHOR;
+	}
+	public static String name() {
+		if (NAME.equals("${NAME}")) return "some-product";
+		else return NAME;
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/Operation.java

@@ -0,0 +1,55 @@
+package me.topchetoeu.j2s.common;
+
+import java.util.HashMap;
+
+public enum Operation {
+	TYPEOF(0x10, 1),
+	INSTANCEOF(0x11, 2),
+	IN(0x12, 2),
+
+	MULTIPLY(0x20, 2),
+	DIVIDE(0x21, 2),
+	MODULO(0x22, 2),
+	ADD(0x23, 2),
+	SUBTRACT(0x24, 2),
+
+	USHIFT_RIGHT(0x30, 2),
+	SHIFT_RIGHT(0x31, 2),
+	SHIFT_LEFT(0x32, 2),
+
+	GREATER(0x40, 2),
+	LESS(0x41, 2),
+	GREATER_EQUALS(0x42, 2),
+	LESS_EQUALS(0x43, 2),
+	LOOSE_EQUALS(0x44, 2),
+	LOOSE_NOT_EQUALS(0x45, 2),
+	EQUALS(0x46, 2),
+	NOT_EQUALS(0x47, 2),
+
+	AND(0x50, 2),
+	OR(0x51, 2),
+	XOR(0x52, 2),
+
+	NEG(0x60, 1),
+	POS(0x61, 1),
+	NOT(0x62, 1),
+	INVERSE(0x63, 1);
+
+	private static final HashMap<Integer, Operation> operations = new HashMap<>();
+
+	static {
+		for (var val : Operation.values()) operations.put(val.numeric, val);
+	}
+
+	public final int numeric;
+	public final int operands;
+
+	private Operation(int numeric, int n) {
+		this.numeric = numeric;
+		this.operands = n;
+	}
+
+	public static Operation fromNumeric(int i) {
+		return operations.get(i);
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/Reading.java

@@ -0,0 +1,92 @@
+package me.topchetoeu.j2s.common;
+
+import java.io.BufferedReader;
+import java.io.IOException;
+import java.io.InputStream;
+import java.io.InputStreamReader;
+import java.io.UncheckedIOException;
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.List;
+
+public class Reading {
+	private static final BufferedReader reader = new BufferedReader(new InputStreamReader(System.in));
+
+	public static synchronized String readline() throws IOException {
+		return reader.readLine();
+	}
+
+	public static byte[] streamToBytes(InputStream in) {
+		if (in == null) return null;
+
+		try {
+			List<byte[]> bufs = null;
+			byte[] result = null;
+			int total = 0;
+			int n;
+
+			do {
+				var buf = new byte[8192];
+				int nread = 0;
+
+				// read to EOF which may read more or less than buffer size
+				while ((n = in.read(buf, nread, buf.length - nread)) > 0) {
+					nread += n;
+				}
+
+				if (nread > 0) {
+					if (Integer.MAX_VALUE - 8 - total < nread) throw new OutOfMemoryError("Required array size too large");
+					if (nread < buf.length) buf = Arrays.copyOfRange(buf, 0, nread);
+					total += nread;
+
+					if (result == null) result = buf;
+					else {
+						if (bufs == null) {
+							bufs = new ArrayList<>();
+							bufs.add(result);
+						}
+
+						bufs.add(buf);
+					}
+				}
+				// if the last call to read returned -1 or the number of bytes
+				// requested have been read then break
+			} while (n >= 0);
+
+			if (bufs == null) {
+				if (result == null) return new byte[0];
+				return result.length == total ? result : Arrays.copyOf(result, total);
+			}
+
+			result = new byte[total];
+
+			int offset = 0;
+			int remaining = total;
+
+			for (byte[] b : bufs) {
+				int count = Math.min(b.length, remaining);
+				System.arraycopy(b, 0, result, offset, count);
+				offset += count;
+				remaining -= count;
+			}
+
+			return result;
+		}
+		catch (IOException e) { throw new UncheckedIOException(e); }
+	}
+	public static String streamToString(InputStream in) {
+		var bytes = streamToBytes(in);
+		if (bytes == null) return null;
+		else return new String(bytes);
+	}
+	
+	public static InputStream resourceToStream(String name) {
+		return Reading.class.getResourceAsStream("/" + name);
+	}
+	public static String resourceToString(String name) {
+		return streamToString(resourceToStream(name));
+	}
+	public static byte[] resourceToBytes(String name) {
+		return streamToBytes(resourceToStream(name));
+	}
+}

common/src/main/java/me/topchetoeu/j2s/common/StringifyUtils.java

@@ -0,0 +1,123 @@
+package me.topchetoeu.j2s.common;
+
+import java.math.BigDecimal;
+
+public class StringifyUtils {
+	public static String quoteString(String raw) {
+		var res = new StringBuilder("\"");
+		var alphabet = "0123456789ABCDEF".toCharArray();
+
+		for (var c : raw.toCharArray()) {
+			if (c < 32 || c >= 127) {
+				res
+					.append("\\u")
+					.append(alphabet[(c >> 12) & 0xF])
+					.append(alphabet[(c >> 8) & 0xF])
+					.append(alphabet[(c >> 4) & 0xF])
+					.append(alphabet[(c >> 0) & 0xF]);
+			}
+			else if (c == '\\')
+				res.append("\\\\");
+			else if (c == '"')
+				res.append("\\\"");
+			else res.append(c);
+		}
+
+		return res.append('"').toString();
+	}
+
+	public static String quoteNumber(Double num) {
+		if (num == Double.NEGATIVE_INFINITY) return "-Infinity";
+		if (num == Double.POSITIVE_INFINITY) return "Infinity";
+		if (Double.isNaN(num)) return "NaN";
+		return BigDecimal.valueOf(num).stripTrailingZeros().toPlainString();
+	}
+
+	private static double power(double a, long b) {
+		if (b == 0) return 1;
+		if (b == 1) return a;
+		if (b < 0) return 1 / power(a, -b);
+
+		if ((b & 1) == 0) return power(a * a, b / 2);
+		else return a * power(a * a, b / 2);
+	}
+
+	public static Double unqoteNumber(String src) {
+		var i = 0;
+
+		double whole = 0;
+		double fract = 0;
+		long exponent = 0;
+		boolean parsedAny = false;
+		boolean negative = false;
+
+		if (src.charAt(i) == '-') {
+			negative = true;
+			i++;
+		}
+
+		while (i < src.length()) {
+			var c = src.charAt(i);
+			if (c < '0' || c > '9') break;
+
+			parsedAny = true;
+			whole *= 10;
+			whole += src.charAt(i++) - '0';
+		}
+
+		if (i < src.length() && src.charAt(i) == '.') {
+			parsedAny = true;
+			i++;
+
+			while (i < src.length()) {
+				var c = src.charAt(i);
+				if (c < '0' || c > '9') break;
+
+				parsedAny = true;
+				fract += src.charAt(i++) - '0';
+				fract /= 10;
+			}
+		}
+
+		if (i < src.length() && (src.charAt(i) == 'e' || src.charAt(i) == 'E')) {
+			i++;
+			parsedAny = true;
+			boolean expNegative = false;
+			boolean parsedE = false;
+
+			if (i < src.length()) {
+				if (src.charAt(i) == '-') {
+					expNegative = true;
+					i++;
+				}
+				else if (src.charAt(i) == '+') {
+					i++;
+				}
+			}
+
+
+			while (i < src.length()) {
+				var c = src.charAt(i);
+				if (c < '0' || c > '9') break;
+
+				parsedE = true;
+				exponent *= 10;
+
+				if (expNegative) exponent -= src.charAt(i) - '0';
+				else exponent += src.charAt(i) - '0';
+			}
+
+			if (!parsedE) return Double.NaN;
+		}
+
+		if (i != src.length()) return Double.NaN;
+
+		if (!parsedAny) {
+			if (negative) return Double.NaN;
+			return 0.;
+		}
+		else if (negative) return -(whole + fract) * power(10, exponent);
+		else return (whole + fract) * power(10, exponent);
+	}
+}
+

common/src/main/java/me/topchetoeu/j2s/common/SyntaxException.java

@@ -0,0 +1,12 @@
+package me.topchetoeu.j2s.common;
+
+public class SyntaxException extends RuntimeException {
+	public final Location loc;
+	public final String msg;
+
+	public SyntaxException(Location loc, String msg) {
+		super(String.format("Syntax error %s: %s", loc, msg));
+		this.loc = loc;
+		this.msg = msg;
+	}
+}

common/src/main/resources/metadata

@@ -0,0 +1,3 @@
+version: ${version}
+name: ${name}
+author: TopchetoEU

common/src/test/java/me/topchetoeu/j2s/common/TestEnvironment.java

@@ -0,0 +1,69 @@
+package me.topchetoeu.j2s.common;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+import static org.junit.jupiter.api.Assertions.assertInstanceOf;
+
+import org.junit.jupiter.api.Test;
+
+public class TestEnvironment {
+	private final Key<String> FOO = new Key<>();
+	private final Key<Void> MARKER = new Key<>();
+
+	@Test public void testShouldCreate() {
+		new Environment();
+		Environment.empty();
+	}
+	@Test public void testShouldNotExist() {
+		var env = new Environment();
+		assertEquals(null, env.get(FOO));
+		assertEquals(false, env.has(FOO));
+	}
+
+	@Test public void testShouldAdd() {
+		var env = new Environment();
+		env.add(FOO, "test");
+		assertEquals("test", env.get(FOO));
+	}
+
+	@Test public void testShouldGetFromParent() {
+		var parent = new Environment();
+		parent.add(FOO, "test");
+		var child = parent.child();
+		assertEquals("test", child.get(FOO));
+		assertEquals(true, child.has(FOO));
+	}
+	@Test public void testShouldHideParent() {
+		var parent = new Environment();
+		parent.add(FOO, "test");
+		var child = parent.child();
+		child.remove(FOO);
+		assertEquals(null, child.get(FOO));
+		assertEquals(false, child.has(FOO));
+	}
+
+	@Test public void testShouldAddMarker() {
+		var env = new Environment();
+		env.add(MARKER);
+		assertEquals(true, env.has(MARKER));
+		assertEquals(false, env.hasNotNull(MARKER));
+	}
+
+	@Test public void testShouldInitOnce() {
+		var env = new Environment();
+		assertEquals("a", env.init(FOO, "a"));
+		assertEquals("a", env.init(FOO, "b"));
+		assertEquals("a", env.get(FOO));
+	}
+	@Test public void testShouldInitOnceFrom() {
+		var env = new Environment();
+		assertEquals("a", env.initFrom(FOO, () -> "a"));
+		assertEquals("a", env.initFrom(FOO, () -> "b"));
+		assertEquals("a", env.get(FOO));
+	}
+
+	@Test public void testShouldWrap() {
+		var env = new Environment();
+		assertEquals(env, Environment.wrap(env));
+		assertInstanceOf(Environment.class, Environment.wrap(null));
+	}
+}

common/src/test/java/me/topchetoeu/j2s/common/TestFilename.java

@@ -0,0 +1,37 @@
+package me.topchetoeu.j2s.common;
+
+import org.junit.jupiter.api.Test;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+
+public class TestFilename {
+	@Test public void testShouldParseFilePath() {
+		var filename = Filename.parse("file://hello.world");
+		assertEquals("file", filename.protocol);
+		assertEquals("hello.world", filename.path);
+	}
+	@Test public void testShouldParseNoProtocolFilename() {
+		var filename = Filename.parse("hello.world");
+		assertEquals("file", filename.protocol);
+		assertEquals("hello.world", filename.path);
+	}
+	@Test public void testShouldParseAdditionalSlashFilename() {
+		var filename = Filename.parse("test:///hello.world");
+		assertEquals("test", filename.protocol);
+		assertEquals("/hello.world", filename.path);
+	}
+	@Test public void testShouldParseOneSlashFilename() {
+		var filename = Filename.parse("test:/hello.world");
+		assertEquals("file", filename.protocol);
+		assertEquals("test:/hello.world", filename.path);
+	}
+	@Test public void testShouldParseMatroshkaFilename() {
+		var a = Filename.parse("a://b://hello.world");
+		assertEquals("a", a.protocol);
+		assertEquals("b://hello.world", a.path);
+
+		var b = Filename.parse(a.path);
+		assertEquals("b", b.protocol);
+		assertEquals("hello.world", b.path);
+	}
+}

common/src/test/java/me/topchetoeu/j2s/common/TestLocation.java

@@ -0,0 +1,159 @@
+package me.topchetoeu.j2s.common;
+
+import org.junit.jupiter.api.Test;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+
+public class TestLocation {
+	@Test public void testShouldCreateLocation() {
+		var loc = Location.of(new Filename("file", "test.txt"), 10, 5);
+		assertEquals("test.txt", loc.filename().path);
+		assertEquals(10, loc.line());
+		assertEquals(5, loc.start());
+	}
+
+	@Test public void testShouldGetNextLineLocation() {
+		var loc = Location.of("test.txt:10:5");
+		var next = loc.nextLine();
+		assertEquals(new Filename("file", "test.txt"), next.filename());
+		assertEquals(10, next.line());
+		assertEquals(0, next.start());
+		assertEquals(new Filename("file", "test.txt"), loc.filename());
+		assertEquals(9, loc.line());
+		assertEquals(4, loc.start());
+	}
+	@Test public void testShouldGetNextNthLineLocation() {
+		var loc = Location.of(new Filename("file", "test.txt"), 10, 5);
+		var next = loc.nextLine(5);
+		assertEquals(15, next.line());
+		assertEquals(0, next.start());
+		assertEquals(10, loc.line());
+		assertEquals(5, loc.start());
+	}
+
+	@Test public void testShouldGetNextLocation() {
+		var loc = Location.of("test:10:5");
+		var next = loc.add(10);
+		assertEquals(new Filename("file", "test"), next.filename());
+		assertEquals(9, next.line());
+		assertEquals(14, next.start());
+		assertEquals(new Filename("file", "test"), loc.filename());
+		assertEquals(9, loc.line());
+		assertEquals(4, loc.start());
+	}
+
+	@Test public void testShouldParseLocation() {
+		var loc = Location.of("test.txt:10:5");
+		assertEquals(new Filename("file", "test.txt"), loc.filename());
+		assertEquals(9, loc.line());
+		assertEquals(4, loc.start());
+	}
+	@Test public void testShouldParseComplexFilenameLocation() {
+		var loc = Location.of("testificate://test.txt:10:5");
+		assertEquals(new Filename("testificate", "test.txt"), loc.filename());
+		assertEquals(9, loc.line());
+		assertEquals(4, loc.start());
+	}
+	@Test public void testShouldParseNoFilenameLocation() {
+		var loc = Location.of("10:5");
+		assertEquals(null, loc.filename());
+		assertEquals(9, loc.line());
+		assertEquals(4, loc.start());
+	}
+	@Test public void testShouldParseNoStartLocationA() {
+		var loc = Location.of("file://10:5");
+		assertEquals(new Filename("file", "10"), loc.filename());
+		assertEquals(4, loc.line());
+		assertEquals(-1, loc.start());
+	}
+	@Test public void testShouldParseNoStartLocationB() {
+		var loc = Location.of("file:5");
+		assertEquals(new Filename("file", "file"), loc.filename());
+		assertEquals(4, loc.line());
+		assertEquals(-1, loc.start());
+	}
+	@Test public void testShouldParseOnlyFilenameLocationA() {
+		var loc = Location.of("http://example.org/test.txt");
+		assertEquals(new Filename("http", "example.org/test.txt"), loc.filename());
+		assertEquals(-1, loc.line());
+		assertEquals(-1, loc.start());
+	}
+	@Test public void testShouldParseOnlyFilenameLocationB() {
+		var loc = Location.of("test.txt");
+		assertEquals(new Filename("file", "test.txt"), loc.filename());
+		assertEquals(-1, loc.line());
+		assertEquals(-1, loc.start());
+	}
+	@Test public void testShouldParseOnlyFilenameWithColonLocation() {
+		var loc = Location.of("my-file:bad-file");
+		assertEquals(new Filename("file", "my-file:bad-file"), loc.filename());
+		assertEquals(-1, loc.line());
+		assertEquals(-1, loc.start());
+	}
+	@Test public void testShouldParseOnlyFilenameWithTripleColonLocation() {
+		var loc = Location.of("a:my-file:bad-file");
+		assertEquals(new Filename("file", "a:my-file:bad-file"), loc.filename());
+		assertEquals(-1, loc.line());
+		assertEquals(-1, loc.start());
+	}
+
+	@Test public void testCompareEqualLoc() {
+		var locA = Location.of("test:10:5");
+		var locB = Location.of("test:10:5");
+
+		assertEquals(0, locA.compareTo(locB));
+		assertEquals(0, locB.compareTo(locA));
+	}
+	@Test public void testCompareNoFileLoc() {
+		var locA = Location.of("10:5");
+		var locB = Location.of("11:5");
+
+		assertEquals(-1, locA.compareTo(locB));
+		assertEquals(1, locB.compareTo(locA));
+	}
+	@Test public void testCompareOneNoFileLoc() {
+		var locA = Location.of("10:5");
+		var locB = Location.of("test:10:5");
+
+		assertEquals(-1, locA.compareTo(locB));
+		assertEquals(1, locB.compareTo(locA));
+	}
+	@Test public void testCompareDiffFileLoc() {
+		var locA = Location.of("a:10:5");
+		var locB = Location.of("b:10:5");
+
+		assertEquals(-1, locA.compareTo(locB));
+		assertEquals(1, locB.compareTo(locA));
+	}
+	@Test public void testCompareDiffLineLoc() {
+		var locA = Location.of("test:10:5");
+		var locB = Location.of("test:11:5");
+
+		assertEquals(-1, locA.compareTo(locB));
+		assertEquals(1, locB.compareTo(locA));
+	}
+	@Test public void testCompareDiffStartLoc() {
+		var locA = Location.of("test:10:5");
+		var locB = Location.of("test:10:10");
+
+		assertEquals(-1, locA.compareTo(locB));
+		assertEquals(1, locB.compareTo(locA));
+	}
+
+	@Test public void testToStringAll() {
+		var locA = Location.of("test:10:5");
+		assertEquals("file://test:10:5", locA.toString());
+	}
+	@Test public void testToStringNoFilename() {
+		var locA = Location.of("10:5");
+		assertEquals("10:5", locA.toString());
+	}
+	@Test public void testToStringNoStart() {
+		var locA = Location.of("file:5");
+		assertEquals("file://file:5", locA.toString());
+	}
+	@Test public void testToStringNoLoc() {
+		var locA = Location.of("file");
+		assertEquals("file://file", locA.toString());
+	}
+}

compilation/build.gradle.kts

@@ -0,0 +1,13 @@
+plugins {
+	id("common-java");
+}
+
+description = "A compiler of EcmaScript 5 code to J2S bytecode";
+
+tasks.test {
+	useJUnitPlatform();
+}
+
+dependencies {
+	implementation(project(":common"));
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/CompilationFunctionMap.java

@@ -0,0 +1,219 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.HashMap;
+import java.util.List;
+import java.util.Map;
+import java.util.NavigableSet;
+import java.util.Objects;
+import java.util.TreeMap;
+import java.util.TreeSet;
+import java.util.function.Function;
+import java.util.regex.Pattern;
+import java.util.stream.Collectors;
+
+import me.topchetoeu.j2s.common.Filename;
+import me.topchetoeu.j2s.common.FunctionMap;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+
+public final class CompilationFunctionMap implements FunctionMap {
+	public static class FunctionMapBuilder {
+		private Location first, last;
+		private final TreeMap<Integer, Location> sourceMap = new TreeMap<>();
+		private final HashMap<Location, BreakpointType> breakpoints = new HashMap<>();
+
+		public Location toLocation(int pc) {
+			return sourceMap.headMap(pc, true).firstEntry().getValue();
+		}
+
+		public FunctionMapBuilder setDebug(Location loc, BreakpointType type) {
+			if (loc == null || type == null || type == BreakpointType.NONE) return this;
+			breakpoints.put(loc, type);
+			return this;
+		}
+		public FunctionMapBuilder setLocation(int i, Location loc) {
+			if (loc == null || i < 0) return this;
+			if (first == null || first.compareTo(loc) > 0) first = loc;
+			if (last == null || last.compareTo(loc) < 0) last = loc;
+
+			sourceMap.put(i, loc);
+			return this;
+		}
+		public FunctionMapBuilder setLocationAndDebug(int i, Location loc, BreakpointType type) {
+			setDebug(loc, type);
+			setLocation(i, loc);
+			return this;
+		}
+
+		public Location first() {
+			return first;
+		}
+		public Location last() {
+			return last;
+		}
+
+		public FunctionMapBuilder map(Function<Location, Location> mapper) {
+			var newSourceMaps = new HashMap<Integer, Location>();
+			var newBreakpoints = new HashMap<Location, BreakpointType>();
+
+			for (var key : sourceMap.keySet()) {
+				var mapped = mapper.apply(sourceMap.get(key));
+				if (mapped == null) continue;
+				newSourceMaps.put(key, mapped);
+			}
+			for (var key : breakpoints.keySet()) {
+				var mapped = mapper.apply(key);
+				if (mapped == null) continue;
+				newBreakpoints.put(mapped, breakpoints.get(key));
+			}
+
+			sourceMap.clear();
+			sourceMap.putAll(newSourceMaps);
+
+			breakpoints.clear();
+			breakpoints.putAll(newBreakpoints);
+
+			return this;
+		}
+
+		public CompilationFunctionMap build(String[] localNames, String[] capturableNames, String[] captureNames) {
+			return new CompilationFunctionMap(sourceMap, breakpoints, first, last, localNames, capturableNames, captureNames);
+		}
+		public CompilationFunctionMap build() {
+			return new CompilationFunctionMap(sourceMap, breakpoints, first, last, new String[0], new String[0], new String[0]);
+		}
+
+		private FunctionMapBuilder() { }
+	}
+
+	public static final CompilationFunctionMap EMPTY = new CompilationFunctionMap();
+
+	private final HashMap<Integer, BreakpointType> bps = new HashMap<>();
+	private final HashMap<Filename, TreeSet<Location>> bpLocs = new HashMap<>();
+
+	private final TreeMap<Integer, Location> pcToLoc = new TreeMap<>();
+
+	public final String[] localNames, capturableNames, captureNames;
+	public final Location first, last;
+
+	@Override public Location toLocation(int pc, boolean approximate) {
+		if (pcToLoc.size() == 0 || pc < 0 || pc > pcToLoc.lastKey()) return null;
+		var res = pcToLoc.get(pc);
+		if (!approximate || res != null) return res;
+		var entry = pcToLoc.headMap(pc, true).lastEntry();
+		if (entry == null) return null;
+		else return entry.getValue();
+	}
+	@Override public Location toLocation(int pc) {
+		return toLocation(pc, false);
+	}
+
+	@Override public BreakpointType getBreakpoint(int pc) {
+		return bps.getOrDefault(pc, BreakpointType.NONE);
+	}
+	@Override public Location correctBreakpoint(Location loc) {
+		var set = bpLocs.get(loc.filename());
+		if (set == null) return null;
+		else return set.ceiling(loc);
+	}
+	@Override public List<Location> correctBreakpoint(Pattern filename, int line, int column) {
+		var candidates = new HashMap<Filename, TreeSet<Location>>();
+
+		for (var name : bpLocs.keySet()) {
+			if (filename.matcher(name.toString()).matches()) {
+				candidates.put(name, bpLocs.get(name));
+			}
+		}
+
+		var res = new ArrayList<Location>(candidates.size());
+		for (var candidate : candidates.entrySet()) {
+			var val = correctBreakpoint(Location.of(candidate.getKey(), line, column));
+			if (val == null) continue;
+			res.add(val);
+		}
+
+		return res;
+	}
+	@Override public List<Location> breakpoints(Location start, Location end) {
+		if (!Objects.equals(start.filename(), end.filename())) return Arrays.asList();
+		NavigableSet<Location> set = bpLocs.get(start.filename());
+		if (set == null) return Arrays.asList();
+
+		if (start != null) set = set.tailSet(start, true);
+		if (end != null) set = set.headSet(end, true);
+
+		return set.stream().collect(Collectors.toList());
+	}
+
+	public Location start() {
+		if (pcToLoc.size() == 0) return null;
+		return pcToLoc.firstEntry().getValue();
+	}
+	public Location end() {
+		if (pcToLoc.size() == 0) return null;
+		return pcToLoc.lastEntry().getValue();
+	}
+
+	@Override public Location first() {
+		return first;
+	}
+	@Override public Location last() {
+		return last;
+	}
+
+	@Override public String[] capturableNames() {
+		return capturableNames;
+	}
+	@Override public String[] captureNames() {
+		return captureNames;
+	}
+	@Override public String[] localNames() {
+		return localNames;
+	}
+
+	public CompilationFunctionMap clone() {
+		var res = new CompilationFunctionMap(new HashMap<>(), new HashMap<>(), first, last, localNames, capturableNames, captureNames);
+		res.pcToLoc.putAll(this.pcToLoc);
+		res.bps.putAll(bps);
+		res.bpLocs.putAll(bpLocs);
+		res.pcToLoc.putAll(pcToLoc);
+		return res;
+	}
+
+	public CompilationFunctionMap(Map<Integer, Location> map, Map<Location, BreakpointType> breakpoints, Location first, Location last, String[] localNames, String[] capturableNames, String[] captureNames) {
+		var locToPc = new HashMap<Location, Integer>();
+
+		for (var el : map.entrySet()) {
+			pcToLoc.put(el.getKey(), el.getValue());
+			locToPc.putIfAbsent(el.getValue(), el.getKey());
+		}
+
+		for (var el : breakpoints.entrySet()) {
+			if (el.getValue() == null || el.getValue() == BreakpointType.NONE) continue;
+			bps.put(locToPc.get(el.getKey()), el.getValue());
+
+			if (!bpLocs.containsKey(el.getKey().filename())) bpLocs.put(el.getKey().filename(), new TreeSet<>());
+			bpLocs.get(el.getKey().filename()).add(el.getKey());
+		}
+
+		this.localNames = localNames;
+		this.captureNames = captureNames;
+		this.capturableNames = capturableNames;
+
+		this.first = first;
+		this.last = last;
+	}
+	private CompilationFunctionMap() {
+		localNames = new String[0];
+		captureNames = new String[0];
+		capturableNames = new String[0];
+		first = null;
+		last = null;
+	}
+
+	public static FunctionMapBuilder builder() {
+		return new FunctionMapBuilder();
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/CompileResult.java

@@ -0,0 +1,168 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.List;
+import java.util.Map;
+import java.util.Stack;
+import java.util.function.Function;
+
+import me.topchetoeu.j2s.common.Environment;
+import me.topchetoeu.j2s.common.FunctionBody;
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Key;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompilationFunctionMap.FunctionMapBuilder;
+import me.topchetoeu.j2s.compilation.control.TryNode;
+import me.topchetoeu.j2s.compilation.scope.FunctionScope;
+import me.topchetoeu.j2s.compilation.scope.Variable;
+
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.Iterator;
+import java.util.LinkedList;
+
+public final class CompileResult {
+	public static final Key<Void> DEBUG_LOG = new Key<>();
+
+	private FunctionBody body;
+	public final List<Instruction> instructions;
+	public final List<CompileResult> children;
+	public final Map<FunctionNode, CompileResult> childrenMap = new HashMap<>();
+	public final Map<FunctionNode, Integer> childrenIndices = new HashMap<>();
+	public final FunctionMapBuilder map;
+	public final Environment env;
+	public int length;
+	public final FunctionScope scope;
+	public final Map<TryNode, Variable> catchBindings = new HashMap<>();
+
+	public int temp() {
+		instructions.add(null);
+		return instructions.size() - 1;
+	}
+
+	public CompileResult add(Instruction instr) {
+		instructions.add(instr);
+		return this;
+	}
+	public CompileResult set(int i, Instruction instr) {
+		instructions.set(i, instr);
+		return this;
+	}
+
+	public int size() { return instructions.size(); }
+
+	public void setDebug(Location loc, BreakpointType type) {
+		map.setDebug(loc, type);
+	}
+	public void setLocation(int i, Location loc) {
+		map.setLocation(i, loc);
+	}
+	public void setLocationAndDebug(int i, Location loc, BreakpointType type) {
+		map.setLocationAndDebug(i, loc, type);
+	}
+	public void setDebug(BreakpointType type) {
+		setDebug(map.last(), type);
+	}
+	public void setLocation(Location type) {
+		setLocation(instructions.size() - 1, type);
+	}
+
+	public void setLocationAndDebug(Location loc, BreakpointType type) {
+		setLocationAndDebug(instructions.size() - 1, loc, type);
+	}
+	
+	public Iterable<CompileResult> all() {
+		var stack = new Stack<CompileResult>();
+		stack.push(this);
+
+		return () -> new Iterator<CompileResult>() {
+			@Override public CompileResult next() {
+				if (stack.empty()) return null;
+				else {
+					var res = stack.pop();
+					for (var child : res.children) {
+						stack.push(child);
+					}
+					return res;
+				}
+			}
+			@Override public boolean hasNext() {
+				return !stack.empty();
+			}
+		};
+	}
+
+	public CompileResult addChild(FunctionNode node, CompileResult res) {
+		this.children.add(res);
+		this.childrenMap.put(node, res);
+		this.childrenIndices.put(node, this.children.size() - 1);
+		return res;
+	}
+
+	public Instruction[] instructions() {
+		return instructions.toArray(new Instruction[0]);
+	}
+
+	public CompilationFunctionMap map(Function<Location, Location> mapper) {
+		return map.map(mapper).build(scope.localNames(), scope.capturableNames(), scope.captureNames());
+	}
+	public CompilationFunctionMap map() {
+		return map.build(scope.localNames(), scope.capturableNames(), scope.captureNames());
+	}
+	public FunctionBody body() {
+		if (body != null) return body;
+
+		var builtChildren = new FunctionBody[children.size()];
+		for (var i = 0; i < children.size(); i++) builtChildren[i] = children.get(i).body();
+
+		var instrRes = instructions();
+
+		if (env.has(DEBUG_LOG)) {
+			System.out.println("================= BODY =================");
+			System.out.println("LOCALS: " + scope.localsCount());
+			System.out.println("CAPTURABLES: " + scope.capturablesCount());
+			System.out.println("CAPTURES: " + scope.capturesCount());
+
+			for (var instr : instrRes) System.out.println(instr);
+		}
+
+		return body = new FunctionBody(
+			scope.localsCount(), scope.capturablesCount(), scope.capturesCount(),
+			length, instrRes, builtChildren
+		);
+	}
+
+	public CompileResult subtarget() {
+		return new CompileResult(env, new FunctionScope(scope), this);
+	}
+
+	public CompileResult setEnvironment(Environment env) {
+		return new CompileResult(env, scope, this);
+	}
+	/**
+	 * Returns a compile result with a child of the environment that relates to the given key.
+	 * In essence, this is used to create a compile result which is back at the root environment of the compilation
+	 */
+	public CompileResult rootEnvironment(Key<Environment> env) {
+		return new CompileResult(this.env.get(env).child(), scope, this);
+	}
+	public CompileResult subEnvironment() {
+		return new CompileResult(env.child(), scope, this);
+	}
+
+	public CompileResult(Environment env, FunctionScope scope, int length) {
+		this.scope = scope;
+		this.instructions = new ArrayList<>();
+		this.children = new LinkedList<>();
+		this.map = CompilationFunctionMap.builder();
+		this.env = env;
+		this.length = length;
+	}
+	private CompileResult(Environment env, FunctionScope scope, CompileResult parent) {
+		this.scope = scope;
+		this.instructions = parent.instructions;
+		this.children = parent.children;
+		this.map = parent.map;
+		this.env = env;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/CompoundNode.java

@@ -0,0 +1,112 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.List;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+
+public class CompoundNode extends Node {
+	public final Node[] statements;
+	public Location end;
+
+	@Override public void resolve(CompileResult target) {
+		for (var stm : statements) stm.resolve(target);
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		for (var stm : statements) stm.compileFunctions(target);
+	}
+
+	public void compile(CompileResult target, boolean pollute, BreakpointType type) {
+		List<Node> statements = new ArrayList<Node>();
+
+		for (var stm : this.statements) {
+			if (stm instanceof FunctionStatementNode func) {
+				func.compile(target, false);
+			}
+			else statements.add(stm);
+		}
+
+		var polluted = false;
+
+		for (var i = 0; i < statements.size(); i++) {
+			var stm = statements.get(i);
+
+			if (i != statements.size() - 1) stm.compile(target, false, BreakpointType.STEP_OVER);
+			else stm.compile(target, polluted = pollute, BreakpointType.STEP_OVER);
+		}
+
+		if (!polluted && pollute) {
+			target.add(Instruction.pushUndefined());
+		}
+	}
+
+	public CompoundNode setEnd(Location loc) {
+		this.end = loc;
+		return this;
+	}
+
+	public CompoundNode(Location loc, Node ...statements) {
+		super(loc);
+		this.statements = statements;
+	}
+
+	public static ParseRes<CompoundNode> parseComma(Source src, int i, Node prev, int precedence) {
+		if (precedence > 1) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, ",")) return ParseRes.failed();
+		n++;
+
+		var curr = JavaScript.parseExpression(src, i + n, 2);
+		if (!curr.isSuccess()) return curr.chainError(src.loc(i + n), "Expected a value after the comma");
+		n += curr.n;
+
+		if (prev instanceof CompoundNode comp) {
+			var children = new ArrayList<Node>();
+			children.addAll(Arrays.asList(comp.statements));
+			children.add(curr.result);
+
+			return ParseRes.res(new CompoundNode(loc, children.toArray(new Node[0])), n);
+		}
+		else return ParseRes.res(new CompoundNode(loc, prev, curr.result), n);
+	}
+	public static ParseRes<CompoundNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "{")) return ParseRes.failed();
+		n++;
+
+		var statements = new ArrayList<Node>();
+
+		while (true) {
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (src.is(i + n, "}")) {
+				n++;
+				break;
+			}
+			if (src.is(i + n, ";")) {
+				n++;
+				continue;
+			}
+
+			var res = JavaScript.parseStatement(src, i + n);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected a statement");
+			n += res.n;
+
+			statements.add(res.result);
+		}
+
+		return ParseRes.res(new CompoundNode(loc, statements.toArray(new Node[0])).setEnd(src.loc(i + n - 1)), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/DeferredIntSupplier.java

@@ -0,0 +1,19 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.function.IntSupplier;
+
+public final class DeferredIntSupplier implements IntSupplier {
+	private int value;
+	private boolean set;
+
+	public void set(int val) {
+		if (set) throw new RuntimeException("A deferred int supplier may be set only once");
+		value = val;
+		set = true;
+	}
+
+	@Override public int getAsInt() {
+		if (!set) throw new RuntimeException("Deferred int supplier accessed too early");
+		return value;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/FunctionNode.java

@@ -0,0 +1,125 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.List;
+
+import me.topchetoeu.j2s.common.Environment;
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.scope.FunctionScope;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public abstract class FunctionNode extends Node {
+	public final CompoundNode body;
+	public final List<VariableNode> params;
+	public final Location end;
+
+	public abstract String name();
+	public final String name(String fallback) {
+		return this.name() != null ? this.name() : fallback;
+	}
+	protected final int[] captures(CompileResult target) {
+		return target.childrenMap.get(this).scope.getCaptureIndices();
+	}
+
+	protected final Environment rootEnv(Environment env) {
+		return env.get(JavaScript.COMPILE_ROOT);
+	}
+
+	@Override public void resolve(CompileResult target) { }
+
+	public final CompileResult compileBody(Environment env, FunctionScope scope, boolean lastReturn, String selfName) {
+		var target = new CompileResult(env, scope, params.size());
+		var i = 0;
+
+		body.resolve(target);
+
+		for (var param : params) scope.define(param.name);
+
+		var hasSelf = false;
+
+		if (selfName != null && !scope.has(selfName, false)) {
+			hasSelf = true;
+			scope.define(selfName);
+		}
+
+		body.compileFunctions(target);
+
+		for (var param : params) {
+			target.add(Instruction.loadArg(i++)).setLocation(param.loc());
+			target.add(scope.define(param.name).index().toSet(false)).setLocation(param.loc());
+		}
+		if (hasSelf) {
+			target.add(Instruction.loadCalled());
+			target.add(scope.define(selfName).index().toSet(false));
+		}
+
+		body.compile(target, lastReturn, BreakpointType.NONE);
+
+		return target;
+	}
+	public final CompileResult compileBody(CompileResult parent, String selfName) {
+		return compileBody(rootEnv(parent.env).child(), new FunctionScope(parent.scope), false, selfName);
+	}
+
+	public abstract void compile(CompileResult target, boolean pollute, String name, BreakpointType bp);
+	public void compile(CompileResult target, boolean pollute, String name) {
+		compile(target, pollute, name, BreakpointType.NONE);
+	}
+	@Override public void compile(CompileResult target, boolean pollute, BreakpointType bp) {
+		compile(target, pollute, (String)null, bp);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		compile(target, pollute, (String)null, BreakpointType.NONE);
+	}
+
+	public FunctionNode(Location loc, Location end, List<VariableNode> params, CompoundNode body) {
+		super(loc);
+
+		this.end = end;
+		this.params = params;
+		this.body = body;
+	}
+
+	public static void compileWithName(Node stm, CompileResult target, boolean pollute, String name) {
+		if (stm instanceof FunctionNode) ((FunctionNode)stm).compile(target, pollute, name);
+		else stm.compile(target, pollute);
+	}
+	public static void compileWithName(Node stm, CompileResult target, boolean pollute, String name, BreakpointType bp) {
+		if (stm instanceof FunctionNode) ((FunctionNode)stm).compile(target, pollute, name, bp);
+		else stm.compile(target, pollute, bp);
+	}
+
+	public static ParseRes<FunctionNode> parseFunction(Source src, int i, boolean statement) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "function")) return ParseRes.failed();
+		n += 8;
+
+		var name = Parsing.parseIdentifier(src, i + n);
+		if (!name.isSuccess() && statement) return ParseRes.error(src.loc(i + n), "A statement function requires a name");
+		n += name.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		var params = JavaScript.parseParameters(src, i + n);
+		if (!params.isSuccess()) return params.chainError(src.loc(i + n), "Expected a parameter list");
+		n += params.n;
+
+		var body = CompoundNode.parse(src, i + n);
+		if (!body.isSuccess()) return body.chainError(src.loc(i + n), "Expected a compound statement for function");
+		n += body.n;
+
+		if (statement) return ParseRes.res(new FunctionStatementNode(
+			loc, src.loc(i + n - 1),
+			params.result, body.result, name.result
+		), n);
+		else return ParseRes.res(new FunctionValueNode(
+			loc, src.loc(i + n - 1),
+			params.result, body.result, name.result
+		), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/FunctionStatementNode.java

@@ -0,0 +1,33 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.List;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.scope.Variable;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public class FunctionStatementNode extends FunctionNode {
+	public final String name;
+
+	@Override public String name() { return name; }
+
+	@Override public void resolve(CompileResult target) {
+		target.scope.define(new Variable(name, false));
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		target.addChild(this, compileBody(target, name()));
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute, String name, BreakpointType bp) {
+		target.add(Instruction.loadFunc(target.childrenIndices.get(this), name(name), captures(target))).setLocation(loc());
+		target.add(VariableNode.toSet(target, end, this.name, false, true)).setLocation(loc());
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public FunctionStatementNode(Location loc, Location end, List<VariableNode> params, CompoundNode body, String name) {
+		super(loc, end, params, body);
+		this.name = name;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/FunctionValueNode.java

@@ -0,0 +1,28 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.List;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public class FunctionValueNode extends FunctionNode {
+	public final String name;
+
+	@Override public String name() { return name; }
+
+	@Override public void compileFunctions(CompileResult target) {
+		target.addChild(this, compileBody(target, name()));
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute, String name, BreakpointType bp) {
+		target.add(Instruction.loadFunc(target.childrenIndices.get(this), name(name), captures(target))).setLocation(loc());
+		if (!pollute) target.add(Instruction.discard());
+	}
+
+	public FunctionValueNode(Location loc, Location end, List<VariableNode> params, CompoundNode body, String name) {
+		super(loc, end, params, body);
+		this.name = name;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/JavaScript.java

@@ -0,0 +1,325 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.HashSet;
+import java.util.List;
+import java.util.Set;
+
+import me.topchetoeu.j2s.common.Environment;
+import me.topchetoeu.j2s.common.Filename;
+import me.topchetoeu.j2s.common.Key;
+import me.topchetoeu.j2s.common.SyntaxException;
+import me.topchetoeu.j2s.compilation.control.BreakNode;
+import me.topchetoeu.j2s.compilation.control.ContinueNode;
+import me.topchetoeu.j2s.compilation.control.DebugNode;
+import me.topchetoeu.j2s.compilation.control.DeleteNode;
+import me.topchetoeu.j2s.compilation.control.DoWhileNode;
+import me.topchetoeu.j2s.compilation.control.ForInNode;
+import me.topchetoeu.j2s.compilation.control.ForNode;
+import me.topchetoeu.j2s.compilation.control.IfNode;
+import me.topchetoeu.j2s.compilation.control.ReturnNode;
+import me.topchetoeu.j2s.compilation.control.SwitchNode;
+import me.topchetoeu.j2s.compilation.control.ThrowNode;
+import me.topchetoeu.j2s.compilation.control.TryNode;
+import me.topchetoeu.j2s.compilation.control.WhileNode;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.scope.FunctionScope;
+import me.topchetoeu.j2s.compilation.values.ArgumentsNode;
+import me.topchetoeu.j2s.compilation.values.ArrayNode;
+import me.topchetoeu.j2s.compilation.values.GlobalThisNode;
+import me.topchetoeu.j2s.compilation.values.ObjectNode;
+import me.topchetoeu.j2s.compilation.values.RegexNode;
+import me.topchetoeu.j2s.compilation.values.ThisNode;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+import me.topchetoeu.j2s.compilation.values.constants.BoolNode;
+import me.topchetoeu.j2s.compilation.values.constants.NullNode;
+import me.topchetoeu.j2s.compilation.values.constants.NumberNode;
+import me.topchetoeu.j2s.compilation.values.constants.StringNode;
+import me.topchetoeu.j2s.compilation.values.operations.CallNode;
+import me.topchetoeu.j2s.compilation.values.operations.ChangeNode;
+import me.topchetoeu.j2s.compilation.values.operations.DiscardNode;
+import me.topchetoeu.j2s.compilation.values.operations.IndexNode;
+import me.topchetoeu.j2s.compilation.values.operations.OperationNode;
+import me.topchetoeu.j2s.compilation.values.operations.PostfixNode;
+import me.topchetoeu.j2s.compilation.values.operations.TypeofNode;
+
+public final class JavaScript {
+	public static enum DeclarationType {
+		@Deprecated
+		VAR;
+	}
+
+	public static final Key<Environment> COMPILE_ROOT = new Key<>();
+
+	static final Set<String> reserved = new HashSet<>(Arrays.asList(
+		"true", "false", "void", "null", "this", "if", "else", "try", "catch",
+		"finally", "for", "do", "while", "switch", "case", "default", "new",
+		"function", "var", "return", "throw", "typeof", "delete", "break",
+		"continue", "debugger", "implements", "interface", "package", "private",
+		"protected", "public", "static", "arguments", "class", "extends"
+	));
+
+	public static ParseRes<? extends Node> parseParens(Source src, int i) {
+		int n = 0;
+
+		var openParen = Parsing.parseOperator(src, i + n, "(");
+		if (!openParen.isSuccess()) return openParen.chainError();
+		n += openParen.n;
+
+		var res = JavaScript.parseExpression(src, i + n, 0);
+		if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected an expression in parens");
+		n += res.n;
+
+		var closeParen = Parsing.parseOperator(src, i + n, ")");
+		if (!closeParen.isSuccess()) return closeParen.chainError(src.loc(i + n), "Expected a closing paren");
+		n += closeParen.n;
+
+		return ParseRes.res(res.result, n);
+	}
+
+	public static ParseRes<? extends Node> parseSimple(Source src, int i, boolean statement) {
+		return ParseRes.first(src, i,
+			(s, j) -> statement ? ParseRes.failed() : ObjectNode.parse(s, j),
+			(s, j) -> statement ? ParseRes.failed() : FunctionNode.parseFunction(s, j, false),
+			JavaScript::parseLiteral,
+			StringNode::parse,
+			RegexNode::parse,
+			NumberNode::parse,
+			ChangeNode::parsePrefixDecrease,
+			ChangeNode::parsePrefixIncrease,
+			OperationNode::parsePrefix,
+			ArrayNode::parse,
+			JavaScript::parseParens,
+			CallNode::parseNew,
+			TypeofNode::parse,
+			DiscardNode::parse,
+			DeleteNode::parse,
+			VariableNode::parse
+		);
+	}
+
+	public static ParseRes<? extends Node> parseLiteral(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var id = Parsing.parseIdentifier(src, i);
+		if (!id.isSuccess()) return id.chainError();
+		n += id.n;
+
+		if (id.result.equals("true")) return ParseRes.res(new BoolNode(loc, true), n);
+		if (id.result.equals("false")) return ParseRes.res(new BoolNode(loc, false), n);
+		if (id.result.equals("null")) return ParseRes.res(new NullNode(loc), n);
+		if (id.result.equals("this")) return ParseRes.res(new ThisNode(loc), n);
+		if (id.result.equals("arguments")) return ParseRes.res(new ArgumentsNode(loc), n);
+		if (id.result.equals("globalThis")) return ParseRes.res(new GlobalThisNode(loc), n);
+
+		return ParseRes.failed();
+	}
+
+	public static ParseRes<Node> parseExpression(Source src, int i, int precedence, boolean statement) {
+		var n = Parsing.skipEmpty(src, i);
+		Node prev = null;
+
+		while (true) {
+			if (prev == null) {
+				var res = parseSimple(src, i + n, statement);
+				if (res.isSuccess()) {
+					n += res.n;
+					prev = res.result;
+				}
+				else if (res.isError()) return res.chainError();
+				else break;
+			}
+			else {
+				var _prev = prev;
+				ParseRes<Node> res = ParseRes.first(src, i + n,
+					(s, j) -> OperationNode.parseInstanceof(s, j, _prev, precedence),
+					(s, j) -> OperationNode.parseIn(s, j, _prev, precedence),
+					(s, j) -> PostfixNode.parsePostfixIncrease(s, j, _prev, precedence),
+					(s, j) -> PostfixNode.parsePostfixDecrease(s, j, _prev, precedence),
+					(s, j) -> OperationNode.parseOperator(s, j, _prev, precedence),
+					(s, j) -> IfNode.parseTernary(s, j, _prev, precedence),
+					(s, j) -> IndexNode.parseMember(s, j, _prev, precedence),
+					(s, j) -> IndexNode.parseIndex(s, j, _prev, precedence),
+					(s, j) -> CallNode.parseCall(s, j, _prev, precedence),
+					(s, j) -> CompoundNode.parseComma(s, j, _prev, precedence)
+				);
+
+				if (res.isSuccess()) {
+					n += res.n;
+					prev = res.result;
+					continue;
+				}
+				else if (res.isError()) return res.chainError();
+
+				break;
+			}
+		}
+
+		if (prev == null) return ParseRes.failed();
+		else return ParseRes.res(prev, n);
+	}
+
+	public static ParseRes<Node> parseExpression(Source src, int i, int precedence) {
+		return parseExpression(src, i, precedence, false);
+	}
+
+	public static ParseRes<Node> parseExpressionStatement(Source src, int i) {
+		var res = parseExpression(src, i, 0, true);
+		if (!res.isSuccess()) return res.chainError();
+
+		var end = JavaScript.parseStatementEnd(src, i + res.n);
+		if (!end.isSuccess()) return ParseRes.error(src.loc(i + res.n), "Expected an end of statement");
+
+		return res.addN(end.n);
+	}
+
+	public static ParseRes<Node> parseStatement(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (src.is(i + n, ";")) return ParseRes.res(new DiscardNode(src.loc(i+ n), null), n + 1);
+		if (Parsing.isIdentifier(src, i + n, "with")) return ParseRes.error(src.loc(i + n), "'with' statements are not allowed.");
+
+		ParseRes<Node> res = ParseRes.first(src, i + n,
+			VariableDeclareNode::parse,
+			ReturnNode::parse,
+			ThrowNode::parse,
+			ContinueNode::parse,
+			BreakNode::parse,
+			DebugNode::parse,
+			IfNode::parse,
+			WhileNode::parse,
+			SwitchNode::parse,
+			ForNode::parse,
+			ForInNode::parse,
+			DoWhileNode::parse,
+			TryNode::parse,
+			CompoundNode::parse,
+			(s, j) -> FunctionNode.parseFunction(s, j, true),
+			JavaScript::parseExpressionStatement
+		);
+		return res.addN(n);
+	}
+
+	public static ParseRes<Boolean> parseStatementEnd(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		if (i + n >= src.size()) return ParseRes.res(true, n);
+
+		for (var j = i; j < i + n; j++) {
+			if (src.is(j, '\n')) return ParseRes.res(true, n);
+		}
+
+		if (src.is(i + n, ';')) return ParseRes.res(true, n + 1);
+		if (src.is(i + n, '}')) return ParseRes.res(true, n);
+
+		return ParseRes.failed();
+	}
+
+	public static ParseRes<Boolean> parseDeclarationType(Source src, int i) {
+		var res = Parsing.parseIdentifier(src, i);
+		if (!res.isSuccess()) return res.chainError();
+
+		if (res.result.equals("var")) return ParseRes.res(true, res.n);
+
+		return ParseRes.failed();
+	}
+
+	public static Node[] parse(Environment env, Filename filename, String raw) {
+		var src = new Source(env, filename, raw);
+		var list = new ArrayList<Node>();
+		int i = 0;
+
+		while (true) {
+			i += Parsing.skipEmpty(src, i);
+			if (i >= src.size()) break;
+
+			var res = parseStatement(src, i);
+
+			if (res.isError()) throw new SyntaxException(res.errorLocation, res.error);
+			else if (res.isFailed()) throw new SyntaxException(src.loc(i), "Unexpected syntax");
+
+			i += res.n;
+			i += Parsing.skipEmpty(src, i);
+
+			list.add(res.result);
+		}
+
+		return list.toArray(new Node[0]);
+	}
+
+	public static boolean checkVarName(String name) {
+		return !JavaScript.reserved.contains(name);
+	}
+
+	public static CompileResult compile(Environment env, boolean passthrough, Node ...statements) {
+		env = env.child();
+		env.add(COMPILE_ROOT, env);
+
+		var func = new FunctionValueNode(null, null, Arrays.asList(), new CompoundNode(null, statements), null);
+		var res = func.compileBody(env, new FunctionScope(passthrough), true, null);
+		return res;
+	}
+
+	public static CompileResult compile(Environment env, Filename filename, String raw, boolean passthrough) {
+		return JavaScript.compile(env, passthrough, JavaScript.parse(env, filename, raw));
+	}
+	public static CompileResult compile(Filename filename, String raw, boolean passthrough) {
+		var env = new Environment();
+		return JavaScript.compile(env, passthrough, JavaScript.parse(env, filename, raw));
+	}
+
+	public static ParseRes<String> parseLabel(Source src, int i) {
+		int n = Parsing.skipEmpty(src, i);
+	
+		var nameRes = Parsing.parseIdentifier(src, i + n);
+		if (!nameRes.isSuccess()) return nameRes.chainError();
+		n += nameRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+	
+		if (!src.is(i + n, ":")) return ParseRes.failed();
+		n++;
+	
+		return ParseRes.res(nameRes.result, n);
+	}
+
+	public static ParseRes<List<VariableNode>> parseParameters(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+	
+		var openParen = Parsing.parseOperator(src, i + n, "(");
+		if (!openParen.isSuccess()) return openParen.chainError(src.loc(i + n), "Expected a parameter list");
+		n += openParen.n;
+	
+		var params = new ArrayList<VariableNode>();
+	
+		var closeParen = Parsing.parseOperator(src, i + n, ")");
+		n += closeParen.n;
+	
+		if (!closeParen.isSuccess()) {
+			while (true) {
+				n += Parsing.skipEmpty(src, i + n);
+	
+				var param = VariableNode.parse(src, i + n);
+				if (!param.isSuccess()) return ParseRes.error(src.loc(i + n), "Expected a parameter or a closing brace");
+				n += param.n;
+				n += Parsing.skipEmpty(src, i + n);
+	
+				params.add(param.result);
+	
+				if (src.is(i + n, ",")) {
+					n++;
+					n += Parsing.skipEmpty(src, i + n);
+				}
+	
+				if (src.is(i + n, ")")) {
+					n++;
+					break;
+				}
+			}
+		}
+	
+		return ParseRes.res(params, n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/LabelContext.java

@@ -0,0 +1,120 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.ArrayList;
+import java.util.HashMap;
+import java.util.LinkedList;
+import java.util.function.IntSupplier;
+
+import me.topchetoeu.j2s.common.Environment;
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Key;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.SyntaxException;
+
+public class LabelContext {
+	public static final Key<LabelContext> BREAK_CTX = new Key<>();
+	public static final Key<LabelContext> CONTINUE_CTX = new Key<>();
+
+	private final LinkedList<IntSupplier> list = new LinkedList<>();
+	private final HashMap<String, IntSupplier> map = new HashMap<>();
+
+	private final LinkedList<ArrayList<Runnable>> deferredList = new LinkedList<>();
+	private final HashMap<String, ArrayList<Runnable>> deferredMap = new HashMap<>();
+
+	public IntSupplier get() {
+		return list.peekLast();
+	}
+	public IntSupplier get(String name) {
+		return map.get(name);
+	}
+
+	public void flushAdders(String name) {
+		for (var adder : deferredList.peek()) {
+			adder.run();
+		}
+
+		deferredList.pop();
+
+		if (name != null) {
+			var adders = deferredMap.remove(name);
+			if (adders != null) {
+				for (var adder : adders) adder.run();
+				
+			}
+		}
+	}
+
+	public boolean jump(CompileResult target) {
+		var res = get();
+		if (res != null) {
+			var tmp = target.temp();
+			this.deferredList.peek().add(() -> target.set(tmp, Instruction.jmp(res.getAsInt() - tmp)));
+			return true;
+		}
+		else return false;
+	}
+	public boolean jump(CompileResult target, String name) {
+		var res = name == null ? get() : get(name);
+		if (res != null) {
+			var tmp = target.temp();
+			Runnable task = () -> target.set(tmp, Instruction.jmp(res.getAsInt() - tmp));
+
+			if (name == null) this.deferredList.peekLast().add(task);
+			else if (deferredMap.containsKey(name)) this.deferredMap.get(name).add(task);
+			else return false;
+
+			return true;
+		}
+		else return false;
+	}
+
+	public void push(IntSupplier jumpTarget) {
+		list.add(jumpTarget);
+	}
+	public void push(Location loc, String name, IntSupplier jumpTarget) {
+		if (name == null) return;
+		if (map.containsKey(name)) throw new SyntaxException(loc, String.format("Label '%s' has already been declared", name));
+		map.put(name, jumpTarget);
+	}
+
+	public void pushLoop(Location loc, String name, IntSupplier jumpTarget) {
+		push(jumpTarget);
+		push(loc, name, jumpTarget);
+		deferredList.push(new ArrayList<>());
+		if (name != null) deferredMap.put(name, new ArrayList<>());
+	}
+
+	public void pop() {
+		list.removeLast();
+	}
+	public void pop(String name) {
+		if (name == null) return;
+		map.remove(name);
+	}
+
+	public void popLoop(String name) {
+		pop();
+		pop(name);
+		flushAdders(name);
+	}
+
+	public static LabelContext getBreak(Environment env) {
+		return env.initFrom(BREAK_CTX, () -> new LabelContext());
+	}
+	public static LabelContext getCont(Environment env) {
+		return env.initFrom(CONTINUE_CTX, () -> new LabelContext());
+	}
+
+	public static void pushLoop(Environment env, Location loc, String name, IntSupplier breakTarget, int contTarget) {
+		LabelContext.getBreak(env).pushLoop(loc, name, breakTarget);
+		LabelContext.getCont(env).pushLoop(loc, name, () -> contTarget);
+	}
+	public static void pushLoop(Environment env, Location loc, String name, IntSupplier breakTarget, IntSupplier contTarget) {
+		LabelContext.getBreak(env).pushLoop(loc, name, breakTarget);
+		LabelContext.getCont(env).pushLoop(loc, name, contTarget);
+	}
+	public static void popLoop(Environment env, String name) {
+		LabelContext.getBreak(env).popLoop(name);
+		LabelContext.getCont(env).popLoop(name);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/Node.java

@@ -0,0 +1,28 @@
+package me.topchetoeu.j2s.compilation;
+
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+
+public abstract class Node {
+	private Location loc;
+
+	public void resolve(CompileResult target) {}
+
+	public void compile(CompileResult target, boolean pollute, BreakpointType type) {
+		int start = target.size();
+		compile(target, pollute);
+		if (target.size() != start) target.setLocationAndDebug(start, loc(), type);
+	}
+	public void compile(CompileResult target, boolean pollute) {
+		compile(target, pollute, BreakpointType.NONE);
+	}
+
+	public abstract void compileFunctions(CompileResult target);
+
+	public Location loc() { return loc; }
+	public void setLoc(Location loc) { this.loc = loc; }
+
+	protected Node(Location loc) {
+		this.loc = loc;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/NodeChildren.java

@@ -0,0 +1,93 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.ArrayList;
+import java.util.Iterator;
+import java.util.function.Function;
+
+public final class NodeChildren implements Iterable<Node> {
+	public static final class Slot {
+		private Node node;
+		private final Function<Node, Node> replacer;
+
+		public final void replace(Node node) {
+			this.node = this.replacer.apply(node);
+		}
+
+		public Slot(Node nodes, Function<Node, Node> replacer) {
+			this.node = nodes;
+			this.replacer = replacer;
+		}
+	}
+
+	private final Slot[] slots;
+
+	private NodeChildren(Slot[] slots) {
+		this.slots = slots;
+	}
+
+	@Override public Iterator<Node> iterator() {
+		return new Iterator<Node>() {
+			private int i = 0;
+			private Slot[] arr = slots;
+
+			@Override public boolean hasNext() {
+				if (arr == null) return false;
+				else if (i >= arr.length) {
+					arr = null;
+					return false;
+				}
+				else return true;
+			}
+			@Override public Node next() {
+				if (!hasNext()) return null;
+				return arr[i++].node;
+			}
+		};
+	}
+	public Iterable<Slot> slots() {
+		return () -> new Iterator<Slot>() {
+			private int i = 0;
+			private Slot[] arr = slots;
+
+			@Override public boolean hasNext() {
+				if (arr == null) return false;
+				else if (i >= arr.length) {
+					arr = null;
+					return false;
+				}
+				else return true;
+			}
+			@Override public Slot next() {
+				if (!hasNext()) return null;
+				return arr[i++];
+			}
+		};
+	}
+
+	public static final class Builder {
+		private final ArrayList<Slot> slots = new ArrayList<>();
+
+		public final Builder add(Slot ...children) {
+			for (var child : children) {
+				this.slots.add(child);
+			}
+
+			return this;
+		}
+		public final Builder add(Iterable<Slot> children) {
+			for (var child : children) {
+				this.slots.add(child);
+			}
+
+			return this;
+		}
+		public final Builder add(Node child, Function<Node, Node> replacer) {
+			slots.add(new Slot(child, replacer));
+			return this;
+		}
+
+		public final NodeChildren build() {
+			return new NodeChildren(slots.toArray(new Slot[0]));
+		}
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/Parameter.java

@@ -0,0 +1,15 @@
+package me.topchetoeu.j2s.compilation;
+
+import me.topchetoeu.j2s.common.Location;
+
+public final class Parameter {
+	public final Location loc;
+	public final String name;
+	public final Node node;
+
+	public Parameter(Location loc, String name, Node node) {
+		this.name = name;
+		this.node = node;
+		this.loc = loc;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/VariableDeclareNode.java

@@ -0,0 +1,115 @@
+package me.topchetoeu.j2s.compilation;
+
+import java.util.ArrayList;
+import java.util.List;
+
+import com.github.bsideup.jabel.Desugar;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public class VariableDeclareNode extends Node {
+	@Desugar
+	public static record Pair(VariableNode var, Node value) { }
+
+	public final List<Pair> values;
+
+	@Override public void resolve(CompileResult target) {
+		for (var entry : values) {
+			target.scope.define(entry.var.name);
+		}
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		for (var pair : values) {
+			if (pair.value != null) pair.value.compileFunctions(target);
+		}
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		for (var entry : values) {
+			var index = target.scope.get(entry.var.name, false);
+
+			if (entry.value != null) {
+				entry.value.compile(target, true);
+			}
+
+			if (index == null) {
+				if (entry.value == null) {
+					target.add(Instruction.globDef(entry.var.name));
+				}
+				else {
+					target.add(Instruction.globSet(entry.var.name, false, true));
+				}
+			}
+			else if (entry.value != null) {
+				target.add(index.index().toSet(false));
+			}
+		}
+
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public VariableDeclareNode(Location loc, List<Pair> values) {
+		super(loc);
+		this.values = values;
+	}
+
+	public static ParseRes<VariableDeclareNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var declType = JavaScript.parseDeclarationType(src, i + n);
+		if (!declType.isSuccess()) return declType.chainError();
+		n += declType.n;
+
+		var res = new ArrayList<Pair>();
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new VariableDeclareNode(loc, res), n);
+		}
+
+		while (true) {
+			var nameLoc = src.loc(i + n);
+
+			var name = Parsing.parseIdentifier(src, i + n);
+			if (!name.isSuccess()) return name.chainError(nameLoc, "Expected a variable name");
+			n += name.n;
+
+			Node val = null;
+			var endN = n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (src.is(i + n, "=")) {
+				n++;
+
+				var valRes = JavaScript.parseExpression(src, i + n, 2);
+				if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after '='");
+
+				n += valRes.n;
+				endN = n;
+				n += Parsing.skipEmpty(src, i + n);
+				val = valRes.result;
+			}
+
+			res.add(new Pair(new VariableNode(nameLoc, name.result), val));
+
+			if (src.is(i + n, ",")) {
+				n++;
+				continue;
+			}
+
+			end = JavaScript.parseStatementEnd(src, i + endN);
+
+			if (end.isSuccess()) {
+				n += end.n + endN - n;
+				return ParseRes.res(new VariableDeclareNode(loc, res), n);
+			}
+			else return end.chainError(src.loc(i + n), "Expected a comma or end of statement");
+		}
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/BreakNode.java

@@ -0,0 +1,58 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.SyntaxException;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class BreakNode extends Node {
+	public final String label;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (!LabelContext.getBreak(target.env).jump(target, label)) {
+			if (label != null) throw new SyntaxException(loc(), String.format("Undefined label '%s'", label));
+			else throw new SyntaxException(loc(), "Illegal break statement");
+		}
+
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public BreakNode(Location loc, String label) {
+		super(loc);
+		this.label = label;
+	}
+
+	public static ParseRes<BreakNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "break")) return ParseRes.failed();
+		n += 5;
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new BreakNode(loc, null), n);
+		}
+
+		var label = Parsing.parseIdentifier(src, i + n);
+		if (label.isFailed()) return ParseRes.error(src.loc(i + n), "Expected a label name or an end of statement");
+		n += label.n;
+
+		end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new BreakNode(loc, label.result), n);
+		}
+		else return end.chainError(src.loc(i + n), "Expected end of statement");
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/ContinueNode.java

@@ -0,0 +1,58 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.SyntaxException;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class ContinueNode extends Node {
+	public final String label;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (!LabelContext.getCont(target.env).jump(target)) {
+			if (label != null) throw new SyntaxException(loc(), String.format("Undefined label '%s'", label));
+			else throw new SyntaxException(loc(), "Illegal continue statement");
+		}
+
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public ContinueNode(Location loc, String label) {
+		super(loc);
+		this.label = label;
+	}
+
+	public static ParseRes<ContinueNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "continue")) return ParseRes.failed();
+		n += 8;
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new ContinueNode(loc, null), n);
+		}
+
+		var label = Parsing.parseIdentifier(src, i + n);
+		if (label.isFailed()) return ParseRes.error(src.loc(i + n), "Expected a label name or an end of statement");
+		n += label.n;
+
+		end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new ContinueNode(loc, label.result), n);
+		}
+		else return end.chainError(src.loc(i + n), "Expected end of statement");
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/DebugNode.java

@@ -0,0 +1,40 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class DebugNode extends Node {
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		target.add(Instruction.debug());
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public DebugNode(Location loc) {
+		super(loc);
+	}
+
+	public static ParseRes<DebugNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "debugger")) return ParseRes.failed();
+		n += 8;
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new DebugNode(loc), n);
+		}
+		else return end.chainError(src.loc(i + n), "Expected end of statement");
+	}
+
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/DeleteNode.java

@@ -0,0 +1,57 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+import me.topchetoeu.j2s.compilation.values.constants.BoolNode;
+import me.topchetoeu.j2s.compilation.values.operations.IndexNode;
+
+public class DeleteNode extends Node {
+	public final Node key;
+	public final Node value;
+
+	@Override public void compileFunctions(CompileResult target) {
+		key.compileFunctions(target);
+		value.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		value.compile(target, true);
+		key.compile(target, true);
+
+		target.add(Instruction.delete());
+		if (pollute) target.add(Instruction.pushValue(true));
+	}
+
+	public static ParseRes<? extends Node> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "delete")) return ParseRes.failed();
+		n += 6;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 15);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after 'delete'");
+		n += valRes.n;
+
+		if (valRes.result instanceof IndexNode) {
+			var index = (IndexNode)valRes.result;
+			return ParseRes.res(new DeleteNode(loc, index.index, index.object), n);
+		}
+		else if (valRes.result instanceof VariableNode) {
+			return ParseRes.error(src.loc(i + n), "A variable may not be deleted");
+		}
+		else return ParseRes.res(new BoolNode(loc, true), n);
+	}
+
+	public DeleteNode(Location loc, Node key, Node value) {
+		super(loc);
+		this.key = key;
+		this.value = value;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/DoWhileNode.java

@@ -0,0 +1,88 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class DoWhileNode extends Node {
+	public final Node condition, body;
+	public final String label;
+
+	@Override public void compileFunctions(CompileResult target) {
+		condition.compileFunctions(target);
+		body.compileFunctions(target);
+	}
+	@Override public void resolve(CompileResult target) {
+		body.resolve(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		int start = target.size();
+		var end = new DeferredIntSupplier();
+
+		LabelContext.pushLoop(target.env, loc(), label, end, start);
+		body.compile(target, false, BreakpointType.STEP_OVER);
+
+		condition.compile(target, true, BreakpointType.STEP_OVER);
+		int endI = target.size();
+		end.set(endI + 1);
+
+		LabelContext.popLoop(target.env, label);
+
+		target.add(Instruction.jmpIf(start - endI));
+	}
+
+	public DoWhileNode(Location loc, String label, Node condition, Node body) {
+		super(loc);
+		this.label = label;
+		this.condition = condition;
+		this.body = body;
+	}
+
+	public static ParseRes<DoWhileNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var labelRes = JavaScript.parseLabel(src, i + n);
+		n += labelRes.n;
+
+		if (!Parsing.isIdentifier(src, i + n, "do")) return ParseRes.failed();
+		n += 2;
+
+		var bodyRes = JavaScript.parseStatement(src, i + n);
+		if (!bodyRes.isSuccess()) return bodyRes.chainError(src.loc(i + n), "Expected a do-while body.");
+		n += bodyRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "while")) return ParseRes.failed();
+		n += 5;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "(")) return ParseRes.error(src.loc(i + n), "Expected a open paren after 'while'.");
+		n++;
+
+		var condRes = JavaScript.parseExpression(src, i + n, 0);
+		if (!condRes.isSuccess()) return condRes.chainError(src.loc(i + n), "Expected a do-while condition.");
+		n += condRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a closing paren after do-while condition.");
+		n++;
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new DoWhileNode(loc, labelRes.result, condRes.result, bodyRes.result), n);
+		}
+		else return end.chainError(src.loc(i + n), "Expected end of statement");
+	}
+
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/ForInNode.java

@@ -0,0 +1,122 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public class ForInNode extends Node {
+	public final boolean isDecl;
+	public final VariableNode binding;
+	public final Node object, body;
+	public final String label;
+
+	@Override public void resolve(CompileResult target) {
+		body.resolve(target);
+		if (isDecl) {
+			target.scope.define(binding.name);
+		}
+	}
+
+	@Override public void compileFunctions(CompileResult target) {
+		object.compileFunctions(target);
+		body.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		target.add(Instruction.loadIntrinsics("keys"));
+		object.compile(target, true, BreakpointType.STEP_OVER);
+		target.add(Instruction.pushValue(false));
+		target.add(Instruction.pushValue(true));
+		target.add(Instruction.call(3, false));
+
+		int start = target.size();
+		target.add(Instruction.dup());
+		target.add(Instruction.call(0, false));
+		target.add(Instruction.dup());
+		target.add(Instruction.loadMember("done"));
+		int mid = target.temp();
+		target.add(Instruction.loadMember("value")).setLocation(binding.loc());
+		target.add(VariableNode.toSet(target, loc(), binding.name, false, true)).setLocation(binding.loc());
+
+		target.setLocationAndDebug(object.loc(), BreakpointType.STEP_OVER);
+
+		var end = new DeferredIntSupplier();
+
+		LabelContext.pushLoop(target.env, loc(), label, end, start);
+		body.compile(target, false, BreakpointType.STEP_OVER);
+
+		int endI = target.size();
+
+		target.add(Instruction.jmp(start - endI));
+		target.add(Instruction.discard());
+		target.set(mid, Instruction.jmpIf(endI - mid + 1));
+
+		end.set(endI + 1);
+		LabelContext.popLoop(target.env, label);
+
+		target.add(Instruction.discard());
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public ForInNode(Location loc, String label, VariableNode binding, boolean isDecl, Node object, Node body) {
+		super(loc);
+		this.label = label;
+		this.binding = binding;
+		this.isDecl = isDecl;
+		this.object = object;
+		this.body = body;
+	}
+
+	public static ParseRes<ForInNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var label = JavaScript.parseLabel(src, i + n);
+		n += label.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "for")) return ParseRes.failed();
+		n += 3;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "(")) return ParseRes.error(src.loc(i + n), "Expected an opening paren");
+		n++;
+		n += Parsing.skipEmpty(src, i + n);
+
+		var varKw = JavaScript.parseDeclarationType(src, i + n);
+		n += varKw.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		var bindingLoc = src.loc(i + n);
+
+		var name = Parsing.parseIdentifier(src, i + n);
+		if (!name.isSuccess()) return name.chainError(src.loc(i + n), "Expected a variable name");
+		n += name.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "in")) return ParseRes.error(src.loc(i + n), "Expected 'in' keyword after variable declaration");
+		n += 2;
+
+		var obj = JavaScript.parseExpression(src, i + n, 0);
+		if (!obj.isSuccess()) return obj.chainError(src.loc(i + n), "Expected a value");
+		n += obj.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a closing paren");
+		n++;
+
+		var bodyRes = JavaScript.parseStatement(src, i + n);
+		if (!bodyRes.isSuccess()) return bodyRes.chainError(src.loc(i + n), "Expected a for-in body");
+		n += bodyRes.n;
+
+		return ParseRes.res(new ForInNode(loc, label.result, new VariableNode(bindingLoc, name.result), varKw.isSuccess(), obj.result, bodyRes.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/ForNode.java

@@ -0,0 +1,132 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.VariableDeclareNode;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class ForNode extends Node {
+	public final Node declaration, assignment, condition, body;
+	public final String label;
+
+	@Override public void resolve(CompileResult target) {
+		if (declaration != null) declaration.resolve(target);
+		body.resolve(target);
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		if (declaration != null) declaration.compileFunctions(target);
+		if (assignment != null) assignment.compileFunctions(target);
+		if (condition != null) condition.compileFunctions(target);
+		body.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (declaration != null) declaration.compile(target, false, BreakpointType.STEP_OVER);
+
+		var continueTarget = new DeferredIntSupplier();
+		int start = target.size();
+		int mid = -1;
+		if (condition != null) {
+			condition.compile(target, true, BreakpointType.STEP_OVER);
+			mid = target.temp();
+		}
+
+		var end = new DeferredIntSupplier();
+
+		LabelContext.pushLoop(target.env, loc(), label, end, continueTarget);
+		body.compile(target, false, BreakpointType.STEP_OVER);
+
+		continueTarget.set(target.size());
+		if (assignment != null) assignment.compile(target, false, BreakpointType.STEP_OVER);
+		int endI = target.size();
+
+		end.set(endI + 1);
+		LabelContext.popLoop(target.env, label);
+
+		target.add(Instruction.jmp(start - endI));
+		if (condition != null) target.set(mid, Instruction.jmpIfNot(endI - mid + 1));
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public ForNode(Location loc, String label, Node declaration, Node condition, Node assignment, Node body) {
+		super(loc);
+		this.label = label;
+		this.declaration = declaration;
+		this.condition = condition;
+		this.assignment = assignment;
+		this.body = body;
+	}
+
+	private static ParseRes<Node> parseSemicolon(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n, ";")) return ParseRes.failed();
+		else return ParseRes.res(null, n + 1);
+	}
+	private static ParseRes<Node> parseCondition(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		var res = JavaScript.parseExpression(src, i + n, 0);
+		if (!res.isSuccess()) return res.chainError();
+		n += res.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ";")) return ParseRes.error(src.loc(i + n), "Expected a semicolon");
+		else return ParseRes.res(res.result, n + 1);
+	}
+	private static ParseRes<? extends Node> parseUpdater(Source src, int i) {
+		return JavaScript.parseExpression(src, i, 0);
+	}
+
+	public static ParseRes<ForNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var labelRes = JavaScript.parseLabel(src, i + n);
+		n += labelRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "for")) return ParseRes.failed();
+		n += 3;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "(")) return ParseRes.error(src.loc(i + n), "Expected a open paren after 'for'");
+		n++;
+
+		ParseRes<Node> decl = ParseRes.first(src, i + n,
+			ForNode::parseSemicolon,
+			VariableDeclareNode::parse,
+			ForNode::parseCondition
+		);
+		if (!decl.isSuccess()) return decl.chainError(src.loc(i + n), "Expected a declaration or an expression");
+		n += decl.n;
+
+		ParseRes<Node> cond = ParseRes.first(src, i + n,
+			ForNode::parseSemicolon,
+			ForNode::parseCondition
+		);
+		if (!cond.isSuccess()) return cond.chainError(src.loc(i + n), "Expected a condition");
+		n += cond.n;
+
+		var update = parseUpdater(src, i + n);
+		if (update.isError()) return update.chainError();
+		n += update.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a close paren after for updater");
+		n++;
+
+		var body = JavaScript.parseStatement(src, i + n);
+		if (!body.isSuccess()) return body.chainError(src.loc(i + n), "Expected a for body.");
+		n += body.n;
+
+		return ParseRes.res(new ForNode(loc, labelRes.result, decl.result, cond.result, update.result, body.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/IfNode.java

@@ -0,0 +1,135 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class IfNode extends Node {
+	public final Node condition, body, elseBody;
+	public final String label;
+
+	@Override public void resolve(CompileResult target) {
+		body.resolve(target);
+		if (elseBody != null) elseBody.resolve(target);
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		condition.compileFunctions(target);
+		body.compileFunctions(target);
+		if (elseBody != null) elseBody.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute, BreakpointType breakpoint) {
+		condition.compile(target, true, breakpoint);
+
+		if (elseBody == null) {
+			int start = target.temp();
+			var end = new DeferredIntSupplier();
+
+			LabelContext.getBreak(target.env).push(loc(), label, end);
+			body.compile(target, pollute, BreakpointType.STEP_OVER);
+			LabelContext.getBreak(target.env).pop(label);
+
+			int endI = target.size();
+			end.set(endI);
+
+			target.set(start, Instruction.jmpIfNot(endI - start));
+		}
+		else {
+			int start = target.temp();
+			var end = new DeferredIntSupplier();
+
+			LabelContext.getBreak(target.env).push(loc(), label, end);
+			body.compile(target, pollute, BreakpointType.STEP_OVER);
+
+			int mid = target.temp();
+
+			elseBody.compile(target, pollute, BreakpointType.STEP_OVER);
+			LabelContext.getBreak(target.env).pop(label);
+
+			int endI = target.size();
+			end.set(endI);
+
+			target.set(start, Instruction.jmpIfNot(mid - start + 1));
+			target.set(mid, Instruction.jmp(endI - mid));
+		}
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		compile(target, pollute, BreakpointType.STEP_IN);
+	}
+
+	public IfNode(Location loc, Node condition, Node body, Node elseBody, String label) {
+		super(loc);
+		this.condition = condition;
+		this.body = body;
+		this.elseBody = elseBody;
+		this.label = label;
+	}
+
+	public static ParseRes<IfNode> parseTernary(Source src, int i, Node prev, int precedence) {
+		if (precedence > 2) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n, "?")) return ParseRes.failed();
+		var loc = src.loc(i + n);
+		n++;
+
+		var a = JavaScript.parseExpression(src, i + n, 2);
+		if (!a.isSuccess()) return a.chainError(src.loc(i + n), "Expected a value after the ternary operator.");
+		n += a.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ":")) return ParseRes.failed();
+		n++;
+
+		var b = JavaScript.parseExpression(src, i + n, 2);
+		if (!b.isSuccess()) return b.chainError(src.loc(i + n), "Expected a second value after the ternary operator.");
+		n += b.n;
+
+		return ParseRes.res(new IfNode(loc, prev, a.result, b.result, null), n);
+	}
+	public static ParseRes<IfNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var label = JavaScript.parseLabel(src, i + n);
+		n += label.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "if")) return ParseRes.failed();
+		n += 2;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "(")) return ParseRes.error(src.loc(i + n), "Expected a open paren after 'if'.");
+		n++;
+
+		var condRes = JavaScript.parseExpression(src, i + n, 0);
+		if (!condRes.isSuccess()) return condRes.chainError(src.loc(i + n), "Expected an if condition.");
+		n += condRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a closing paren after if condition.");
+		n++;
+
+		var res = JavaScript.parseStatement(src, i + n);
+		if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected an if body.");
+		n += res.n;
+
+		var elseKw = Parsing.parseIdentifier(src, i + n, "else");
+		if (!elseKw.isSuccess()) return ParseRes.res(new IfNode(loc, condRes.result, res.result, null, label.result), n);
+		n += elseKw.n;
+
+		var elseRes = JavaScript.parseStatement(src, i + n);
+		if (!elseRes.isSuccess()) return elseRes.chainError(src.loc(i + n), "Expected an else body.");
+		n += elseRes.n;
+
+		return ParseRes.res(new IfNode(loc, condRes.result, res.result, elseRes.result, label.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/ReturnNode.java

@@ -0,0 +1,53 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class ReturnNode extends Node {
+	public final Node value;
+
+	@Override public void compileFunctions(CompileResult target) {
+		if (value != null) value.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (value == null) target.add(Instruction.pushUndefined());
+		else value.compile(target, true);
+		target.add(Instruction.ret()).setLocation(loc());
+	}
+
+	public ReturnNode(Location loc, Node value) {
+		super(loc);
+		this.value = value;
+	}
+
+	public static ParseRes<ReturnNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "return")) return ParseRes.failed();
+		n += 6;
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new ReturnNode(loc, null), n);
+		}
+
+		var val = JavaScript.parseExpression(src, i + n, 0);
+		if (val.isError()) return val.chainError();
+		n += val.n;
+
+		end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new ReturnNode(loc, val.result), n);
+		}
+		else return end.chainError(src.loc(i + n), "Expected end of statement or a return value");
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/SwitchNode.java

@@ -0,0 +1,198 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import java.util.ArrayList;
+import java.util.HashMap;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class SwitchNode extends Node {
+	public static class SwitchCase {
+		public final Node value;
+		public final int statementI;
+
+		public SwitchCase(Node value, int statementI) {
+			this.value = value;
+			this.statementI = statementI;
+		}
+	}
+
+	public final Node value;
+	public final SwitchCase[] cases;
+	public final Node[] body;
+	public final int defaultI;
+	public final String label;
+
+	@Override public void resolve(CompileResult target) {
+		for (var stm : body) stm.resolve(target);
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		value.compileFunctions(target);
+		for (var _case : cases) {
+			_case.value.compileFunctions(target);
+		}
+		for (var stm : body) {
+			stm.compileFunctions(target);
+		}
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		var caseToStatement = new HashMap<Integer, Integer>();
+		var statementToIndex = new HashMap<Integer, Integer>();
+
+		value.compile(target, true, BreakpointType.STEP_OVER);
+
+		// TODO: create a jump map
+		for (var ccase : cases) {
+			target.add(Instruction.dup());
+			ccase.value.compile(target, true);
+			target.add(Instruction.operation(Operation.EQUALS));
+			caseToStatement.put(target.temp(), ccase.statementI);
+		}
+
+		int start = target.temp();
+		var end = new DeferredIntSupplier();
+
+		LabelContext.getBreak(target.env).pushLoop(loc(), label, end);
+		for (var stm : body) {
+			statementToIndex.put(statementToIndex.size(), target.size());
+			stm.compile(target, false, BreakpointType.STEP_OVER);
+		}
+
+		int endI = target.size();
+		end.set(endI);
+		LabelContext.getBreak(target.env).popLoop(label);
+
+		target.add(Instruction.discard());
+		if (pollute) target.add(Instruction.pushUndefined());
+
+		if (defaultI < 0 || defaultI >= body.length) target.set(start, Instruction.jmp(endI - start));
+		else target.set(start, Instruction.jmp(statementToIndex.get(defaultI) - start));
+
+		for (var el : caseToStatement.entrySet()) {
+			var i = statementToIndex.get(el.getValue());
+			if (i == null) i = endI;
+			target.set(el.getKey(), Instruction.jmpIf(i - el.getKey()));
+		}
+
+	}
+
+	public SwitchNode(Location loc, String label, Node value, int defaultI, SwitchCase[] cases, Node[] body) {
+		super(loc);
+		this.label = label;
+		this.value = value;
+		this.defaultI = defaultI;
+		this.cases = cases;
+		this.body = body;
+	}
+
+	private static ParseRes<Node> parseSwitchCase(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!Parsing.isIdentifier(src, i + n, "case")) return ParseRes.failed();
+		n += 4;
+
+		var val = JavaScript.parseExpression(src, i + n, 0);
+		if (!val.isSuccess()) return val.chainError(src.loc(i + n), "Expected a value after 'case'");
+		n += val.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ":")) return ParseRes.error(src.loc(i + n), "Expected colons after 'case' value");
+		n++;
+
+		return ParseRes.res(val.result, n);
+	}
+	private static ParseRes<Void> parseDefaultCase(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!Parsing.isIdentifier(src, i + n, "default")) return ParseRes.failed();
+		n += 7;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ":")) return ParseRes.error(src.loc(i + n), "Expected colons after 'default'");
+		n++;
+
+		return ParseRes.res(null, n);
+	}
+	public static ParseRes<SwitchNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var label = JavaScript.parseLabel(src, i + n);
+		n += label.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "switch")) return ParseRes.failed();
+		n += 6;
+		n += Parsing.skipEmpty(src, i + n);
+		if (!src.is(i + n, "(")) return ParseRes.error(src.loc(i + n), "Expected a open paren after 'switch'");
+		n++;
+
+		var val = JavaScript.parseExpression(src, i + n, 0);
+		if (!val.isSuccess()) return val.chainError(src.loc(i + n), "Expected a switch value");
+		n += val.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a closing paren after switch value");
+		n++;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "{")) return ParseRes.error(src.loc(i + n), "Expected an opening brace after switch value");
+		n++;
+		n += Parsing.skipEmpty(src, i + n);
+
+		var statements = new ArrayList<Node>();
+		var cases = new ArrayList<SwitchCase>();
+		var defaultI = -1;
+
+		while (true) {
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (src.is(i + n, "}")) {
+				n++;
+				break;
+			}
+			if (src.is(i + n, ";")) {
+				n++;
+				continue;
+			}
+
+			ParseRes<Node> caseRes = ParseRes.first(src, i + n,
+				SwitchNode::parseDefaultCase,
+				SwitchNode::parseSwitchCase
+			);
+
+			if (caseRes.isSuccess()) {
+				n += caseRes.n;
+
+				if (caseRes.result == null) defaultI = statements.size();
+				else cases.add(new SwitchCase(caseRes.result, statements.size()));
+				continue;
+			}
+			if (caseRes.isError()) return caseRes.chainError();
+
+			var stm = JavaScript.parseStatement(src, i + n);
+			if (stm.isSuccess()) {
+				n += stm.n;
+				statements.add(stm.result);
+				continue;
+			}
+			else stm.chainError(src.loc(i + n), "Expected a statement, 'case' or 'default'");
+		}
+
+		return ParseRes.res(new SwitchNode(
+			loc, label.result, val.result, defaultI,
+			cases.toArray(new SwitchCase[0]),
+			statements.toArray(new Node[0])
+		), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/ThrowNode.java

@@ -0,0 +1,46 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class ThrowNode extends Node {
+	public final Node value;
+
+	@Override public void compileFunctions(CompileResult target) {
+		value.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		value.compile(target, true);
+		target.add(Instruction.throwInstr()).setLocation(loc());
+	}
+
+	public ThrowNode(Location loc, Node value) {
+		super(loc);
+		this.value = value;
+	}
+
+	public static ParseRes<ThrowNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "throw")) return ParseRes.failed();
+		n += 5;
+
+		var val = JavaScript.parseExpression(src, i + n, 0);
+		if (val.isFailed()) return ParseRes.error(src.loc(i + n), "Expected a throw value");
+		n += val.n;
+
+		var end = JavaScript.parseStatementEnd(src, i + n);
+		if (end.isSuccess()) {
+			n += end.n;
+			return ParseRes.res(new ThrowNode(loc, val.result), n);
+		}
+		else return end.chainError(src.loc(i + n), "Expected end of statement");
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/TryNode.java

@@ -0,0 +1,148 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.CompoundNode;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class TryNode extends Node {
+	public final CompoundNode tryBody;
+	public final CompoundNode catchBody;
+	public final CompoundNode finallyBody;
+	public final String captureName;
+	public final String label;
+
+	@Override public void resolve(CompileResult target) {
+		tryBody.resolve(target);
+		if (catchBody != null) catchBody.resolve(target);
+		if (finallyBody != null) finallyBody.resolve(target);
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		tryBody.compileFunctions(target);
+		if (catchBody != null) {
+			if (captureName != null) {
+				var index = target.scope.defineCatch(captureName);
+				target.catchBindings.put(this, index);
+			}
+			catchBody.compileFunctions(target);
+			if (captureName != null) target.scope.undefineCatch();
+		}
+		if (finallyBody != null) finallyBody.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute, BreakpointType bpt) {
+		int replace = target.temp();
+		var endSuppl = new DeferredIntSupplier();
+
+		int start = replace + 1, catchStart = -1, finallyStart = -1;
+
+		LabelContext.getBreak(target.env).push(loc(), label, endSuppl);
+
+		tryBody.compile(target, false);
+		target.add(Instruction.tryEnd());
+
+		if (catchBody != null) {
+			catchStart = target.size() - start;
+
+			if (captureName != null) {
+				var catchVar = target.catchBindings.get(this);
+				target.scope.defineCatch(captureName, catchVar);
+				target.add(Instruction.loadError()).setLocation(catchBody.loc());
+				target.add(catchVar.index().toSet(false)).setLocation(catchBody.loc());
+				catchBody.compile(target, false);
+				target.scope.undefineCatch();
+			}
+			else catchBody.compile(target, false);
+
+			target.add(Instruction.tryEnd());
+		}
+
+		if (finallyBody != null) {
+			finallyStart = target.size() - start;
+			finallyBody.compile(target, false);
+			target.add(Instruction.tryEnd());
+		}
+
+		LabelContext.getBreak(target.env).pop(label);
+
+		endSuppl.set(target.size());
+
+		target.set(replace, Instruction.tryStart(catchStart, finallyStart, target.size() - start));
+		target.setLocationAndDebug(replace, loc(), BreakpointType.STEP_OVER);
+
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public TryNode(Location loc, String label, CompoundNode tryBody, CompoundNode catchBody, CompoundNode finallyBody, String captureName) {
+		super(loc);
+		this.tryBody = tryBody;
+		this.catchBody = catchBody;
+		this.finallyBody = finallyBody;
+		this.captureName = captureName;
+		this.label = label;
+	}
+
+	public static ParseRes<TryNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var labelRes = JavaScript.parseLabel(src, i + n);
+		n += labelRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "try")) return ParseRes.failed();
+		n += 3;
+
+		var tryBody = CompoundNode.parse(src, i + n);
+		if (!tryBody.isSuccess()) return tryBody.chainError(src.loc(i + n), "Expected a try body");
+		n += tryBody.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		String capture = null;
+		CompoundNode catchBody = null, finallyBody = null;
+
+		if (Parsing.isIdentifier(src, i + n, "catch")) {
+			n += 5;
+			n += Parsing.skipEmpty(src, i + n);
+			if (src.is(i + n, "(")) {
+				n++;
+				var nameRes = Parsing.parseIdentifier(src, i + n);
+				if (!nameRes.isSuccess()) return nameRes.chainError(src.loc(i + n), "xpected a catch variable name");
+				capture = nameRes.result;
+				n += nameRes.n;
+				n += Parsing.skipEmpty(src, i + n);
+
+				if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a closing paren after catch variable name");
+				n++;
+			}
+
+			var bodyRes = CompoundNode.parse(src, i + n);
+			if (!bodyRes.isSuccess()) return tryBody.chainError(src.loc(i + n), "Expected a catch body");
+			n += bodyRes.n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			catchBody = bodyRes.result;
+		}
+
+		if (Parsing.isIdentifier(src, i + n, "finally")) {
+			n += 7;
+
+			var bodyRes = CompoundNode.parse(src, i + n);
+			if (!bodyRes.isSuccess()) return tryBody.chainError(src.loc(i + n), "Expected a finally body");
+			n += bodyRes.n;
+			n += Parsing.skipEmpty(src, i + n);
+			finallyBody = bodyRes.result;
+		}
+
+		if (finallyBody == null && catchBody == null) ParseRes.error(src.loc(i + n), "Expected catch or finally");
+
+		return ParseRes.res(new TryNode(loc, labelRes.result, tryBody.result, catchBody, finallyBody, capture), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/control/WhileNode.java

@@ -0,0 +1,82 @@
+package me.topchetoeu.j2s.compilation.control;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.DeferredIntSupplier;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.LabelContext;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class WhileNode extends Node {
+	public final Node condition, body;
+	public final String label;
+
+	@Override public void resolve(CompileResult target) {
+		body.resolve(target);
+	}
+	@Override public void compileFunctions(CompileResult target) {
+		condition.compileFunctions(target);
+		body.compileFunctions(target);
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		int start = target.size();
+		condition.compile(target, true);
+		int mid = target.temp();
+
+		var end = new DeferredIntSupplier();
+
+
+		LabelContext.pushLoop(target.env, loc(), label, end, start);
+		body.compile(target, false, BreakpointType.STEP_OVER);
+
+		var endI = target.size();
+		end.set(endI + 1);
+		LabelContext.popLoop(target.env, label);
+
+		target.add(Instruction.jmp(start - endI));
+		target.set(mid, Instruction.jmpIfNot(endI - mid + 1));
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public WhileNode(Location loc, String label, Node condition, Node body) {
+		super(loc);
+		this.label = label;
+		this.condition = condition;
+		this.body = body;
+	}
+
+	public static ParseRes<WhileNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var label = JavaScript.parseLabel(src, i + n);
+		n += label.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "while")) return ParseRes.failed();
+		n += 5;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "(")) return ParseRes.error(src.loc(i + n), "Expected a open paren after 'while'.");
+		n++;
+
+		var cond = JavaScript.parseExpression(src, i + n, 0);
+		if (!cond.isSuccess()) return cond.chainError(src.loc(i + n), "Expected a while condition.");
+		n += cond.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ")")) return ParseRes.error(src.loc(i + n), "Expected a closing paren after while condition.");
+		n++;
+
+		var body = JavaScript.parseStatement(src, i + n);
+		if (!body.isSuccess()) return body.chainError(src.loc(i + n), "Expected a while body.");
+		n += body.n;
+
+		return ParseRes.res(new WhileNode(loc, label.result, cond.result, body.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/json/JSON.java

@@ -0,0 +1,147 @@
+package me.topchetoeu.j2s.compilation.json;
+
+import java.util.HashMap;
+import java.util.stream.Collectors;
+
+import me.topchetoeu.j2s.common.Filename;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Metadata;
+import me.topchetoeu.j2s.common.StringifyUtils;
+import me.topchetoeu.j2s.common.SyntaxException;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class JSON {
+	public static ParseRes<JSONElement> parseString(Source src, int i) {
+		var res = Parsing.parseString(src, i);
+		if (!res.isSuccess()) return res.chainError();
+		return ParseRes.res(JSONElement.string(res.result), res.n);
+	}
+	public static ParseRes<JSONElement> parseNumber(Source src, int i) {
+		var res = Parsing.parseNumber(src, i, true);
+		if (!res.isSuccess()) return res.chainError();
+		else return ParseRes.res(JSONElement.number(res.result), res.n);
+	}
+	public static ParseRes<JSONElement> parseLiteral(Source src, int i) {
+		var id = Parsing.parseIdentifier(src, i);
+
+		if (!id.isSuccess()) return ParseRes.failed();
+		else if (id.result.equals("true")) return ParseRes.res(JSONElement.bool(true), id.n);
+		else if (id.result.equals("false")) return ParseRes.res(JSONElement.bool(false), id.n);
+		else if (id.result.equals("null")) return ParseRes.res(JSONElement.NULL, id.n);
+		else return ParseRes.failed();
+	}
+
+	public static ParseRes<JSONElement> parseValue(Source src, int i) {
+		return ParseRes.first(src, i,
+			JSON::parseString,
+			JSON::parseNumber,
+			JSON::parseLiteral,
+			JSON::parseMap,
+			JSON::parseList
+		);
+	}
+
+	public static ParseRes<JSONElement> parseMap(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n, "{")) return ParseRes.failed();
+		n++;
+
+		var values = new JSONMap();
+
+		if (src.is(i + n, "}")) return ParseRes.res(JSONElement.map(new JSONMap(new HashMap<>())), n + 1);
+		while (true) {
+			var name = parseString(src, i + n);
+			if (!name.isSuccess()) return name.chainError(src.loc(i + n), "Expected an index");
+			n += name.n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (!src.is(i + n, ":")) return name.chainError(src.loc(i + n), "Expected a colon");
+			n++;
+
+			var res = parseValue(src, i + n);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected a list element");
+			values.put(name.result.toString(), res.result);
+			n += res.n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (src.is(i + n, ",")) n++;
+			else if (src.is(i + n, "}")) {
+				n++;
+				break;
+			}
+		}
+
+		return ParseRes.res(JSONElement.map(values), n);
+	}
+	public static ParseRes<JSONElement> parseList(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n++, "[")) return ParseRes.failed();
+
+		var values = new JSONList();
+
+		if (src.is(i + n, "]")) return ParseRes.res(JSONElement.list(new JSONList()), n + 1);
+		while (true) {
+			var res = parseValue(src, i + n);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected a list element");
+			values.add(res.result);
+			n += res.n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (src.is(i + n, ",")) n++;
+			else if (src.is(i + n, "]")) {
+				n++;
+				break;
+			}
+		}
+
+		return ParseRes.res(JSONElement.list(values), n);
+	}
+	public static JSONElement parse(Filename filename, String raw) {
+		if (filename == null) filename = new Filename(Metadata.name(), "json");
+
+		var res = parseValue(new Source(null, filename, raw), 0);
+		if (res.isFailed()) throw new SyntaxException(Location.of(filename, 0, 0), "Invalid JSON given");
+		else if (res.isError()) throw new SyntaxException(res.errorLocation, res.error);
+		else return JSONElement.of(res.result);
+	}
+
+	public static String stringify(JSONElement el) {
+		if (el.isNumber()) return StringifyUtils.quoteNumber(el.number());
+		if (el.isString()) return StringifyUtils.quoteString(el.string());
+		if (el.isBoolean()) return el.bool() ? "true" : "false";
+		if (el.isNull()) return "null";
+		if (el.isList()) {
+			var res = new StringBuilder().append("[");
+			for (int i = 0; i < el.list().size(); i++) {
+				if (i != 0) res.append(",");
+				res.append(stringify(el.list().get(i)));
+			}
+			res.append("]");
+			return res.toString();
+		}
+		if (el.isMap()) {
+			var res = new StringBuilder().append("{");
+			var entries = el.map().entrySet().stream().collect(Collectors.toList());
+
+			for (int i = 0; i < entries.size(); i++) {
+				if (i != 0) res.append(",");
+				res.append(StringifyUtils.quoteString(entries.get(i).getKey()));
+				res.append(":");
+				res.append(stringify(entries.get(i).getValue()));
+			}
+			res.append("}");
+			return res.toString();
+		}
+		return null;
+	}
+	public static String stringify(JSONMap map) {
+		return stringify(JSONElement.of(map));
+	}
+	public static String stringify(JSONList list) {
+		return stringify(JSONElement.of(list));
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/json/JSONElement.java

@@ -0,0 +1,88 @@
+package me.topchetoeu.j2s.compilation.json;
+
+public class JSONElement {
+	public static enum Type {
+		STRING,
+		NUMBER,
+		BOOLEAN,
+		NULL,
+		LIST,
+		MAP,
+	}
+
+	public static final JSONElement NULL = new JSONElement(Type.NULL, null);
+
+	public static JSONElement map(JSONMap val) {
+		return new JSONElement(Type.MAP, val);
+	}
+	public static JSONElement list(JSONList val) {
+		return new JSONElement(Type.LIST, val);
+	}
+	public static JSONElement string(String val) {
+		return new JSONElement(Type.STRING, val);
+	}
+	public static JSONElement number(double val) {
+		return new JSONElement(Type.NUMBER, val);
+	}
+	public static JSONElement bool(boolean val) {
+		return new JSONElement(Type.BOOLEAN, val);
+	}
+
+	public static JSONElement of(Object val) {
+		if (val instanceof JSONElement el) return el;
+		else if (val instanceof JSONMap map) return map(map);
+		else if (val instanceof JSONList list) return list(list);
+		else if (val instanceof String str) return string(str);
+		else if (val instanceof Boolean bool) return bool(bool);
+		else if (val instanceof Number num) return number(num.doubleValue());
+		else if (val == null) return NULL;
+		else throw new IllegalArgumentException("val must be: String, Boolean, Number, JSONList or JSONMap");
+	}
+
+	public final Type type;
+	private final Object value;
+
+	public boolean isMap() { return type == Type.MAP; }
+	public boolean isList() { return type == Type.LIST; }
+	public boolean isString() { return type == Type.STRING; }
+	public boolean isNumber() { return type == Type.NUMBER; }
+	public boolean isBoolean() { return type == Type.BOOLEAN; }
+	public boolean isNull() { return type == Type.NULL; }
+
+	public JSONMap map() {
+		if (!isMap()) throw new IllegalStateException("Element is not a map");
+		return (JSONMap)value;
+	}
+	public JSONList list() {
+		if (!isList()) throw new IllegalStateException("Element is not a map");
+		return (JSONList)value;
+	}
+	public String string() {
+		if (!isString()) throw new IllegalStateException("Element is not a string");
+		return (String)value;
+	}
+	public double number() {
+		if (!isNumber()) throw new IllegalStateException("Element is not a number");
+		return (double)value;
+	}
+	public boolean bool() {
+		if (!isBoolean()) throw new IllegalStateException("Element is not a boolean");
+		return (boolean)value;
+	}
+
+	@Override public String toString() {
+		if (isMap()) return "{...}";
+		if (isList()) return "[...]";
+		if (isString()) return (String)value;
+		if (isString()) return (String)value;
+		if (isNumber()) return (double)value + "";
+		if (isBoolean()) return (boolean)value + "";
+		if (isNull()) return "null";
+		return "";
+	}
+
+	private JSONElement(Type type, Object val) {
+		this.type = type;
+		this.value = val;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/json/JSONList.java

@@ -0,0 +1,26 @@
+package me.topchetoeu.j2s.compilation.json;
+
+import java.util.ArrayList;
+import java.util.Arrays;
+import java.util.Collection;
+import java.util.Map;
+
+public class JSONList extends ArrayList<JSONElement> {
+	public JSONList() {}
+	public JSONList(JSONElement ...els) {
+		super(Arrays.asList(els));
+	}
+	public JSONList(Collection<JSONElement> els) {
+		super(els);
+	}
+
+	public JSONList addNull() { this.add(JSONElement.NULL); return this; }
+	public JSONList add(String val) { this.add(JSONElement.of(val)); return this; }
+	public JSONList add(double val) { this.add(JSONElement.of(val)); return this; }
+	public JSONList add(boolean val) { this.add(JSONElement.of(val)); return this; }
+	public JSONList add(Map<String, JSONElement> val) { this.add(JSONElement.of(val)); return this; }
+	public JSONList add(Collection<JSONElement> val) { this.add(JSONElement.of(val)); return this; }
+	public JSONList add(JSONMap val) { this.add(JSONElement.of(val)); return this; }
+	public JSONList add(JSONList val) { this.add(JSONElement.of(val)); return this; }
+
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/json/JSONMap.java

@@ -0,0 +1,136 @@
+package me.topchetoeu.j2s.compilation.json;
+
+import java.util.Collection;
+import java.util.HashMap;
+import java.util.Map;
+import java.util.Set;
+
+public class JSONMap implements Map<String, JSONElement> {
+	private Map<String, JSONElement> elements = new HashMap<>();
+
+	public JSONElement get(String path) {
+		JSONElement curr = JSONElement.map(this);
+
+		for (var seg : path.split("\\.")) {
+			if (!curr.isMap()) return null;
+			curr = curr.map().elements.get(seg);
+		}
+
+		return curr;
+	}
+
+	public boolean isMap(String path) {
+		var el = get(path);
+		return el != null && el.isMap();
+	}
+	public boolean isList(String path) {
+		var el = get(path);
+		return el != null && el.isList();
+	}
+	public boolean isString(String path) {
+		var el = get(path);
+		return el != null && el.isString();
+	}
+	public boolean isNumber(String path) {
+		var el = get(path);
+		return el != null && el.isNumber();
+	}
+	public boolean isBoolean(String path) {
+		var el = get(path);
+		return el != null && el.isBoolean();
+	}
+	public boolean isNull(String path) {
+		var el = get(path);
+		return el != null && el.isNull();
+	}
+	public boolean contains(String path) {
+		return get(path) != null;
+	}
+
+	public JSONMap map(String path) {
+		var el = get(path);
+		if (el == null) throw new RuntimeException(String.format("'%s' doesn't exist", path));
+		return el.map();
+	}
+	public JSONMap map(String path, JSONMap defaultVal) {
+		var el = get(path);
+		if (el == null) return defaultVal;
+		if (el.isMap()) return el.map();
+		return defaultVal;
+	}
+
+	public JSONList list(String path) {
+		var el = get(path);
+		if (el == null) throw new RuntimeException(String.format("'%s' doesn't exist", path));
+		return el.list();
+	}
+	public JSONList list(String path, JSONList defaultVal) {
+		var el = get(path);
+		if (el == null) return defaultVal;
+		if (el.isList()) return el.list();
+		return defaultVal;
+	}
+
+	public String string(String path) {
+		var el = get(path);
+		if (el == null) throw new RuntimeException(String.format("'%s' doesn't exist", path));
+		return el.string();
+	}
+	public String string(String path, String defaultVal) {
+		var el = get(path);
+		if (el == null) return defaultVal;
+		if (el.isString()) return el.string();
+		return defaultVal;
+	}
+
+	public double number(String path) {
+		var el = get(path);
+		if (el == null) throw new RuntimeException(String.format("'%s' doesn't exist", path));
+		return el.number();
+	}
+	public double number(String path, double defaultVal) {
+		var el = get(path);
+		if (el == null) return defaultVal;
+		if (el.isNumber()) return el.number();
+		return defaultVal;
+	}
+
+	public boolean bool(String path) {
+		var el = get(path);
+		if (el == null) throw new RuntimeException(String.format("'%s' doesn't exist", path));
+		return el.bool();
+	}
+	public boolean bool(String path, boolean defaultVal) {
+		var el = get(path);
+		if (el == null) return defaultVal;
+		if (el.isBoolean()) return el.bool();
+		return defaultVal;
+	}
+
+	public JSONMap setNull(String key) { elements.put(key, JSONElement.NULL); return this; }
+	public JSONMap set(String key, String val) { elements.put(key, JSONElement.of(val)); return this; }
+	public JSONMap set(String key, double val) { elements.put(key, JSONElement.of(val)); return this; }
+	public JSONMap set(String key, boolean val) { elements.put(key, JSONElement.of(val)); return this; }
+	public JSONMap set(String key, Map<String, JSONElement> val) { elements.put(key, JSONElement.of(val)); return this; }
+	public JSONMap set(String key, Collection<JSONElement> val) { elements.put(key, JSONElement.of(val)); return this; }
+
+	@Override public int size() { return elements.size(); }
+	@Override public boolean isEmpty() { return elements.isEmpty(); }
+	@Override public boolean containsKey(Object key) { return elements.containsKey(key); }
+	@Override public boolean containsValue(Object value) { return elements.containsValue(value); }
+	@Override public JSONElement get(Object key) { return elements.get(key); }
+	@Override public JSONElement put(String key, JSONElement value) { return elements.put(key, value); }
+	@Override public JSONElement remove(Object key) { return elements.remove(key); }
+	@Override public void putAll(Map<? extends String, ? extends JSONElement> m) { elements.putAll(m); }
+
+	@Override public void clear() { elements.clear(); }
+
+	@Override public Set<String> keySet() { return elements.keySet(); }
+	@Override public Collection<JSONElement> values() { return elements.values(); }
+	@Override public Set<Entry<String, JSONElement>> entrySet() { return elements.entrySet(); }
+
+	public JSONMap() { }
+	public JSONMap(Map<String, JSONElement> els) {
+		this.elements = new HashMap<>(els);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/members/FieldMemberNode.java

@@ -0,0 +1,59 @@
+package me.topchetoeu.j2s.compilation.members;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.ObjectNode;
+
+public class FieldMemberNode implements Member {
+	public final Location loc;
+	public final Node key;
+	public final Node value;
+
+	@Override public Location loc() { return loc; }
+
+	@Override public void compileFunctions(CompileResult target) {
+		key.compileFunctions(target);
+		value.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.dup());
+		key.compile(target, true);
+
+		if (value == null) target.add(Instruction.pushUndefined());
+		else value.compile(target, true);
+
+		target.add(Instruction.storeMember());
+	}
+
+	public FieldMemberNode(Location loc, Node key, Node value) {
+		this.loc = loc;
+		this.key = key;
+		this.value = value;
+	}
+
+	public static ParseRes<FieldMemberNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var name = ObjectNode.parsePropName(src, i + n);
+		if (!name.isSuccess()) return name.chainError();
+		n += name.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, ":")) return ParseRes.failed();
+		n++;
+
+		var value = JavaScript.parseExpression(src, i + n, 2);
+		if (!value.isSuccess()) return value.chainError(src.loc(i + n), "Expected a value");
+		n += value.n;
+
+		return ParseRes.res(new FieldMemberNode(loc, name.result, value.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/members/Member.java

@@ -0,0 +1,11 @@
+package me.topchetoeu.j2s.compilation.members;
+
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+
+public interface Member {
+	Location loc();
+
+	void compileFunctions(CompileResult target);
+	void compile(CompileResult target, boolean pollute);
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/members/PropertyMemberNode.java

@@ -0,0 +1,92 @@
+package me.topchetoeu.j2s.compilation.members;
+
+import java.util.Arrays;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.CompoundNode;
+import me.topchetoeu.j2s.compilation.FunctionNode;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.ObjectNode;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+import me.topchetoeu.j2s.compilation.values.constants.StringNode;
+
+public final class PropertyMemberNode extends FunctionNode implements Member {
+	public final Node key;
+	public final VariableNode argument;
+
+	@Override public String name() {
+		if (key instanceof StringNode str) {
+			if (isGetter()) return "get " + str.value;
+			else return "set " + str.value;
+		}
+		else return null;
+	}
+
+	public boolean isGetter() { return argument == null; }
+	public boolean isSetter() { return argument != null; }
+
+	@Override public void compileFunctions(CompileResult target) {
+		key.compileFunctions(target);
+		target.addChild(this, compileBody(target, null));
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute, String name, BreakpointType bp) {
+		if (isGetter()) {
+			target.add(Instruction.loadIntrinsics("defGetter"));
+		}
+		else {
+			target.add(Instruction.loadIntrinsics("defSetter"));
+		}
+
+		target.add(Instruction.dup(1, 1));
+		key.compile(target, true);
+		target.add(Instruction.loadFunc(target.childrenIndices.get(this), name(name), captures(target))).setLocation(loc());
+		target.add(Instruction.call(3, false));
+		target.add(Instruction.discard());
+
+		if (!pollute) target.add(Instruction.discard());
+	}
+
+	public PropertyMemberNode(Location loc, Location end, Node key, VariableNode argument, CompoundNode body) {
+		super(loc, end, argument == null ? Arrays.asList() : Arrays.asList(argument), body);
+		this.key = key;
+		this.argument = argument;
+	}
+
+	public static ParseRes<PropertyMemberNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var access = Parsing.parseIdentifier(src, i + n);
+		if (!access.isSuccess()) return ParseRes.failed();
+		if (!access.result.equals("get") && !access.result.equals("set")) return ParseRes.failed();
+		n += access.n;
+
+		var name = ObjectNode.parsePropName(src, i + n);
+		if (!name.isSuccess()) return name.chainError(src.loc(i + n), "Expected a property name after '" + access + "'");
+		n += name.n;
+
+		var params = JavaScript.parseParameters(src, i + n);
+		if (!params.isSuccess()) return params.chainError(src.loc(i + n), "Expected an argument list");
+		if (access.result.equals("get") && params.result.size() != 0) return ParseRes.error(src.loc(i + n), "Getter must not have any parameters");
+		if (access.result.equals("set") && params.result.size() != 1) return ParseRes.error(src.loc(i + n), "Setter must have exactly one parameter");
+		n += params.n;
+
+		var body = CompoundNode.parse(src, i + n);
+		if (!body.isSuccess()) return body.chainError(src.loc(i + n), "Expected a compound statement for property accessor.");
+		n += body.n;
+
+		var end = src.loc(i + n - 1);
+
+		return ParseRes.res(new PropertyMemberNode(
+			loc, end, name.result, access.result.equals("get") ? null : params.result.get(0), body.result
+		), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/parsing/ParseRes.java

@@ -0,0 +1,82 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+import me.topchetoeu.j2s.common.Location;
+
+public class ParseRes<T> {
+	public static enum State {
+		SUCCESS,
+		FAILED,
+		ERROR;
+
+		public boolean isSuccess() { return this == SUCCESS; }
+		public boolean isFailed() { return this == FAILED; }
+		public boolean isError() { return this == ERROR; }
+	}
+
+	public final ParseRes.State state;
+	public final Location errorLocation;
+	public final String error;
+	public final T result;
+	public final int n;
+
+	private ParseRes(ParseRes.State state, Location errorLocation, String error, T result, int readN) {
+		this.result = result;
+		this.n = readN;
+		this.state = state;
+		this.error = error;
+		this.errorLocation = errorLocation;
+	}
+
+	public ParseRes<T> setN(int i) {
+		if (!state.isSuccess()) return this;
+		return new ParseRes<>(state, null, null, result, i);
+	}
+	public ParseRes<T> addN(int n) {
+		if (!state.isSuccess()) return this;
+		return new ParseRes<>(state, null, null, result, this.n + n);
+	}
+	@SuppressWarnings("unchecked")
+	public <T2> ParseRes<T2> chainError() {
+		if (isSuccess()) throw new RuntimeException("Can't transform a ParseRes that hasn't failed");
+		return (ParseRes<T2>)this;
+	}
+	@SuppressWarnings("unchecked")
+	public <T2> ParseRes<T2> chainError(ParseRes<?> other) {
+		if (this.isError()) return other.chainError();
+		return (ParseRes<T2>)this;
+	}
+	@SuppressWarnings("unchecked")
+	public <T2> ParseRes<T2> chainError(Location loc, String error) {
+		if (!this.isError()) return new ParseRes<>(State.ERROR, loc, error, null, 0);
+		return (ParseRes<T2>)this;
+	}
+
+	public boolean isSuccess() { return state.isSuccess(); }
+	public boolean isFailed() { return state.isFailed(); }
+	public boolean isError() { return state.isError(); }
+
+	public static <T> ParseRes<T> failed() {
+		return new ParseRes<T>(State.FAILED, null, null, null, 0);
+	}
+	public static <T> ParseRes<T> error(Location loc, String error) {
+		// TODO: differentiate definitive and probable errors
+		return new ParseRes<>(State.ERROR, loc, error, null, 0);
+	}
+	public static <T> ParseRes<T> res(T val, int i) {
+		return new ParseRes<>(State.SUCCESS, null, null, val, i);
+	}
+
+	@SuppressWarnings("all")
+	public static <T> ParseRes<T> first(Source src, int i, Parser ...parsers) {
+		int n = Parsing.skipEmpty(src, i);
+		ParseRes<T> error = ParseRes.failed();
+
+		for (var parser : parsers) {
+			var res = parser.parse(src, i + n);
+			if (res.isSuccess()) return res.addN(n);
+			if (res.isError() && error.isFailed()) error = res.chainError();
+		}
+
+		return error;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/parsing/Parser.java

@@ -0,0 +1,5 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+public interface Parser<T> {
+	public ParseRes<T> parse(Source src, int i);
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/parsing/Parsing.java

@@ -0,0 +1,464 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+public class Parsing {
+	public static boolean isDigit(Character c) {
+		return c != null && c >= '0' && c <= '9';
+	}
+	public static boolean isAny(char c, String alphabet) {
+		return alphabet.contains(Character.toString(c));
+	}
+
+	public static int fromHex(char c) {
+		if (c >= 'A' && c <= 'F') return c - 'A' + 10;
+		if (c >= 'a' && c <= 'f') return c - 'a' + 10;
+		if (c >= '0' && c <= '9') return c - '0';
+		return -1;
+	}
+
+	public static int skipEmpty(Source src, int i) {
+		int n = 0;
+
+		if (i == 0 && src.is(0, "#!")) {
+			while (!src.is(n, '\n')) {
+				if (n >= src.size()) return src.size();
+				n++;
+			}
+			n++;
+		}
+
+		var isSingle = false;
+		var isMulti = false;
+
+		while (i + n < src.size()) {
+			if (isSingle) {
+				if (src.is(i + n, '\n')) {
+					n++;
+					isSingle = false;
+				}
+				else n++;
+			}
+			else if (isMulti) {
+				if (src.is(i + n, "*/")) {
+					n += 2;
+					isMulti = false;
+				}
+				else n++;
+			}
+			else if (src.is(i + n, "//")) {
+				n += 2;
+				isSingle = true;
+			}
+			else if (src.is(i + n, "/*")) {
+				n += 2;
+				isMulti = true;
+			}
+			else if (src.is(i + n, Character::isWhitespace)) {
+				n++;
+			}
+			else break;
+		}
+
+		return n;
+	}
+
+	public static ParseRes<Character> parseChar(Source src, int i) {
+		int n = 0;
+
+		if (src.is(i + n, '\\')) {
+			n++;
+			char c = src.at(i + n++);
+
+			if (c == 'b') return ParseRes.res('\b', n);
+			else if (c == 't') return ParseRes.res('\t', n);
+			else if (c == 'n') return ParseRes.res('\n', n);
+			else if (c == 'f') return ParseRes.res('\f', n);
+			else if (c == 'r') return ParseRes.res('\r', n);
+			else if (c == '0') {
+				if (src.is(i + n, Parsing::isDigit)) return ParseRes.error(src.loc(i), "Octal escape sequences are not allowed");
+				else return ParseRes.res('\0', n);
+			}
+			else if (c >= '1' && c <= '9') return ParseRes.error(src.loc(i), "Octal escape sequences are not allowed");
+			else if (c == 'x') {
+				var newC = 0;
+
+				for (var j = 0; j < 2; j++) {
+					if (i + n >= src.size()) return ParseRes.error(src.loc(i), "Invalid hexadecimal escape sequence");
+
+					int val = fromHex(src.at(i + n));
+					if (val == -1) return ParseRes.error(src.loc(i + n), "Invalid hexadecimal escape sequence");
+					n++;
+
+					newC = (newC << 4) | val;
+				}
+
+				return ParseRes.res((char)newC, n);
+			}
+			else if (c == 'u') {
+				var newC = 0;
+
+				for (var j = 0; j < 4; j++) {
+					if (i + n >= src.size()) return ParseRes.error(src.loc(i), "Invalid Unicode escape sequence");
+
+					int val = fromHex(src.at(i + n));
+					if (val == -1) return ParseRes.error(src.loc(i + n), "Invalid Unicode escape sequence");
+					n++;
+
+					newC = (newC << 4) | val;
+				}
+
+				return ParseRes.res((char)newC, n);
+			}
+			else if (c == '\n') return ParseRes.res(null, n);
+			else n--;
+		}
+
+		return ParseRes.res(src.at(i + n), n + 1);
+	}
+
+	public static ParseRes<String> parseIdentifier(Source src, int i) {
+		var n = skipEmpty(src, i);
+		var res = new StringBuilder();
+		var first = true;
+
+		while (true) {
+			if (i + n > src.size()) break;
+			char c = src.at(i + n, '\0');
+
+			if (first && Parsing.isDigit(c)) break;
+			if (!Character.isLetterOrDigit(c) && c != '_' && c != '$') break;
+			res.append(c);
+			n++;
+			first = false;
+		}
+
+		if (res.length() <= 0) return ParseRes.failed();
+		else return ParseRes.res(res.toString(), n);
+	}
+	public static ParseRes<String> parseIdentifier(Source src, int i, String test) {
+		var n = skipEmpty(src, i);
+		var res = new StringBuilder();
+		var first = true;
+
+		while (true) {
+			if (i + n > src.size()) break;
+			char c = src.at(i + n, '\0');
+
+			if (first && Parsing.isDigit(c)) break;
+			if (!Character.isLetterOrDigit(c) && c != '_' && c != '$') break;
+			res.append(c);
+			n++;
+			first = false;
+		}
+
+		if (res.length() <= 0) return ParseRes.failed();
+		else if (test == null || res.toString().equals(test)) return ParseRes.res(res.toString(), n);
+		else return ParseRes.failed();
+	}
+	public static boolean isIdentifier(Source src, int i, String test) {
+		return parseIdentifier(src, i, test).isSuccess();
+	}
+
+	public static ParseRes<String> parseOperator(Source src, int i, String op) {
+		var n = skipEmpty(src, i);
+
+		if (src.is(i + n, op)) return ParseRes.res(op, n + op.length());
+		else return ParseRes.failed();
+	}
+
+	private static ParseRes<Double> parseHex(Source src, int i) {
+		int n = 0;
+		double res = 0;
+
+		while (true) {
+			int digit = Parsing.fromHex(src.at(i + n, '\0'));
+			if (digit < 0) {
+				if (n <= 0) return ParseRes.failed();
+				else return ParseRes.res(res, n);
+			}
+			n++;
+
+			res *= 16;
+			res += digit;
+		}
+	}
+	private static ParseRes<Double> parseOct(Source src, int i) {
+		int n = 0;
+		double res = 0;
+
+		while (true) {
+			int digit = src.at(i + n, '\0') - '0';
+			if (digit < 0 || digit > 9) break;
+			if (digit > 7) return ParseRes.error(src.loc(i + n), "Digits in octal literals must be from 0 to 7, encountered " + digit);
+
+			if (digit < 0) {
+				if (n <= 0) return ParseRes.failed();
+				else return ParseRes.res(res, n);
+			}
+			n++;
+
+			res *= 8;
+			res += digit;
+		}
+
+		return ParseRes.res(res, n);
+	}
+	private static ParseRes<Double> parseBin(Source src, int i) {
+		int n = 0;
+		double res = 0;
+
+		while (true) {
+			int digit = src.at(i + n, '\0') - '0';
+			if (digit < 0 || digit > 9) break;
+			if (digit > 1) return ParseRes.error(src.loc(i + n), "Digits in binary literals must be from 0 to 1, encountered " + digit);
+
+			if (digit < 0) {
+				if (n <= 0) return ParseRes.failed();
+				else return ParseRes.res(res, n);
+			}
+			n++;
+
+			res *= 2;
+			res += digit;
+		}
+
+		return ParseRes.res(res, n);
+	}
+
+	public static ParseRes<String> parseString(Source src, int i) {
+		var n = skipEmpty(src, i);
+	
+		char quote;
+	
+		if (src.is(i + n, '\'')) quote = '\'';
+		else if (src.is(i + n, '"')) quote = '"';
+		else return ParseRes.failed();
+		n++;
+	
+		var res = new StringBuilder();
+	
+		while (true) {
+			if (i + n >= src.size()) return ParseRes.error(src.loc(i + n), "Unterminated string literal");
+			if (src.is(i + n, quote)) {
+				n++;
+				return ParseRes.res(res.toString(), n);
+			}
+
+			var charRes = parseChar(src, i + n);
+			if (!charRes.isSuccess()) return charRes.chainError(src.loc(i + n), "Invalid character");
+			n += charRes.n;
+
+			if (charRes.result != null) res.append(charRes.result);
+		}
+	}
+	public static ParseRes<Double> parseNumber(Source src, int i, boolean withMinus) {
+		var n = skipEmpty(src, i);
+
+		double whole = 0;
+		double fract = 0;
+		long exponent = 0;
+		boolean parsedAny = false;
+		boolean negative = false;
+
+		if (withMinus && src.is(i + n, "-")) {
+			negative = true;
+			n++;
+		}
+
+		if (src.is(i + n, "0x") || src.is(i + n, "0X")) {
+			n += 2;
+
+			var res = parseHex(src, i + n);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Incomplete hexadecimal literal");
+			n += res.n;
+
+			if (negative) return ParseRes.res(-res.result, n);
+			else return ParseRes.res(res.result, n);
+		}
+		else if (src.is(i + n, "0o") || src.is(i + n, "0O")) {
+			n += 2;
+
+			var res = parseOct(src, i + n);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Incomplete octal literal");
+			n += res.n;
+
+			if (negative) return ParseRes.res(-res.result, n);
+			else return ParseRes.res(res.result, n);
+		}
+		else if (src.is(i + n, "0b") || src.is(i + n, "0B")) {
+			n += 2;
+
+			var res = parseBin(src, i + n);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Incomplete binary literal");
+			n += res.n;
+
+			if (negative) return ParseRes.res(-res.result, n);
+			else return ParseRes.res(res.result, n);
+		}
+		else if (src.is(i + n, '0')) {
+			n++;
+			parsedAny = true;
+			if (src.is(i + n, Parsing::isDigit)) return ParseRes.error(src.loc(i + n), "Decimals with leading zeroes are not allowed");
+		}
+
+		while (src.is(i + n, Parsing::isDigit)) {
+			parsedAny = true;
+			whole *= 10;
+			whole += src.at(i + n++) - '0';
+		}
+
+		if (src.is(i + n, '.')) {
+			parsedAny = true;
+			n++;
+
+			while (src.is(i + n, Parsing::isDigit)) {
+				fract += src.at(i + n++) - '0';
+				fract /= 10;
+			}
+		}
+
+		if (parsedAny && src.is(i + n, 'e') || src.is(i + n, 'E')) {
+			n++;
+			boolean expNegative = false;
+			boolean parsedE = false;
+
+			if (src.is(i + n, '-')) {
+				expNegative = true;
+				n++;
+			}
+			else if (src.is(i + n, '+')) n++;
+
+			while (src.is(i + n, Parsing::isDigit)) {
+				parsedE = true;
+				exponent *= 10;
+
+				if (expNegative) exponent -= src.at(i + n++) - '0';
+				else exponent += src.at(i + n++) - '0';
+			}
+
+			if (!parsedE) return ParseRes.error(src.loc(i + n), "Incomplete number exponent");
+		}
+
+		if (!parsedAny) {
+			if (negative) return ParseRes.error(src.loc(i + n), "Expected number immediatly after minus");
+			return ParseRes.failed();
+		}
+		else if (negative) return ParseRes.res(-(whole + fract) * power(10, exponent), n);
+		else return ParseRes.res((whole + fract) * power(10, exponent), n);
+	}
+	public static ParseRes<Double> parseFloat(Source src, int i, boolean withMinus) {
+		var n = skipEmpty(src, i);
+
+		double whole = 0;
+		double fract = 0;
+		long exponent = 0;
+		boolean parsedAny = false;
+		boolean negative = false;
+
+		if (withMinus && src.is(i + n, "-")) {
+			negative = true;
+			n++;
+		}
+
+		while (src.is(i + n, Parsing::isDigit)) {
+			parsedAny = true;
+			whole *= 10;
+			whole += src.at(i + n++) - '0';
+		}
+
+		if (src.is(i + n, '.')) {
+			parsedAny = true;
+			n++;
+
+			while (src.is(i + n, Parsing::isDigit)) {
+				fract += src.at(i + n++) - '0';
+				fract /= 10;
+			}
+		}
+
+		if (src.is(i + n, 'e') || src.is(i + n, 'E')) {
+			n++;
+			parsedAny = true;
+			boolean expNegative = false;
+			boolean parsedE = false;
+
+			if (src.is(i + n, '-')) {
+				expNegative = true;
+				n++;
+			}
+			else if (src.is(i + n, '+')) n++;
+
+			while (src.is(i + n, Parsing::isDigit)) {
+				parsedE = true;
+				exponent *= 10;
+
+				if (expNegative) exponent -= src.at(i + n++) - '0';
+				else exponent += src.at(i + n++) - '0';
+			}
+
+			if (!parsedE) return ParseRes.error(src.loc(i + n), "Incomplete number exponent");
+		}
+
+		if (!parsedAny) {
+			if (negative) return ParseRes.error(src.loc(i + n), "Expected number immediatly after minus");
+			return ParseRes.failed();
+		}
+		else if (negative) return ParseRes.res(-(whole + fract) * power(10, exponent), n);
+		else return ParseRes.res((whole + fract) * power(10, exponent), n);
+	}
+
+	public static ParseRes<Double> parseInt(Source src, int i, String alphabet, boolean withMinus) {
+		var n = skipEmpty(src, i);
+
+		double result = 0;
+		boolean parsedAny = false;
+		boolean negative = false;
+
+		if (withMinus && src.is(i + n, "-")) {
+			negative = true;
+			n++;
+		}
+
+		if (alphabet == null && src.is(i + n, "0x") || src.is(i + n, "0X")) {
+			n += 2;
+
+			var res = parseHex(src, i);
+			if (!res.isSuccess())
+				return res.chainError(src.loc(i + n), "Incomplete hexadecimal literal");
+			n += res.n;
+
+			if (negative)
+				return ParseRes.res(-res.result, n);
+			else
+				return ParseRes.res(res.result, n);
+		}
+
+		while (true) {
+			var digit = alphabet.indexOf(Character.toLowerCase(src.at(i + n, '\0')));
+			if (digit < 0)
+				break;
+
+			parsedAny = true;
+			result *= alphabet.length();
+			result += digit;
+			n++;
+		}
+
+		if (!parsedAny) {
+			if (negative)
+				return ParseRes.error(src.loc(i + n), "Expected number immediatly after minus");
+			return ParseRes.failed();
+		} else if (negative)
+			return ParseRes.res(-result, n);
+		else
+			return ParseRes.res(result, n);
+	}
+
+	private static double power(double a, long b) {
+		if (b == 0) return 1;
+		if (b == 1) return a;
+		if (b < 0) return 1 / power(a, -b);
+
+		if ((b & 1) == 0) return power(a * a, b / 2);
+		else return a * power(a * a, b / 2);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/parsing/Source.java

@@ -0,0 +1,79 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+import java.util.function.Predicate;
+
+import me.topchetoeu.j2s.common.Environment;
+import me.topchetoeu.j2s.common.Filename;
+import me.topchetoeu.j2s.common.Location;
+
+public class Source {
+	public final Environment env;
+	public final Filename filename;
+	public final String src;
+
+	private int[] lineStarts;
+
+	public Location loc(int offset) {
+		if (offset < 0) offset = 0;
+		if (offset > src.length()) offset = src.length();
+		return new SourceLocation(filename, lineStarts, offset);
+	}
+	public boolean is(int i, char c) {
+		return i >= 0 && i < src.length() && src.charAt(i) == c;
+	}
+	public boolean is(int i, String src) {
+		if (i < 0 || i + src.length() > size()) return false;
+
+		for (int j = 0; j < src.length(); j++) {
+			if (at(i + j) != src.charAt(j)) return false;
+		}
+
+		return true;
+	}
+	public boolean is(int i, Predicate<Character> predicate) {
+		if (i < 0 || i >= src.length()) return false;
+		return predicate.test(at(i));
+	}
+	public char at(int i) {
+		return src.charAt(i);
+	}
+	public char at(int i, char defaultVal) {
+		if (i < 0 || i >= src.length()) return defaultVal;
+		else return src.charAt(i);
+	}
+	public int size() {
+		return src.length();
+	}
+	public String slice(int start, int end) {
+		return src.substring(start, end);
+	}
+
+	public Source(Environment env, Filename filename, String src) {
+		if (env == null) this.env = new Environment();
+		else this.env = env;
+
+		this.filename = filename;
+		this.src = src;
+
+		int n = 1;
+		lineStarts = new int[16];
+		lineStarts[0] = 0;
+
+		for (int i = src.indexOf("\n"); i > 0; i = src.indexOf("\n", i + 1)) {
+			if (n >= lineStarts.length) {
+				var newArr = new int[lineStarts.length * 2];
+				System.arraycopy(lineStarts, 0, newArr, 0, n);
+				lineStarts = newArr;
+			}
+
+			lineStarts[n++] = i + 1;
+		}
+
+		var newArr = new int[n];
+		System.arraycopy(lineStarts, 0, newArr, 0, n);
+		lineStarts = newArr;
+	}
+	public Source(String src) {
+		this(null, null, src);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/parsing/SourceLocation.java

@@ -0,0 +1,69 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+import java.util.Objects;
+
+import me.topchetoeu.j2s.common.Filename;
+import me.topchetoeu.j2s.common.Location;
+
+public class SourceLocation extends Location {
+	private int[] lineStarts;
+	private int line;
+	private int start;
+	private final Filename filename;
+	private final int offset;
+
+	private void update() {
+		if (lineStarts == null) return;
+
+		int a = 0;
+		int b = lineStarts.length;
+
+		while (true) {
+			if (a + 1 >= b) break;
+			var mid = -((-a - b) >> 1);
+			var el = lineStarts[mid];
+
+			if (el < offset) a = mid;
+			else if (el > offset) b = mid;
+			else {
+				this.line = mid;
+				this.start = 0;
+				this.lineStarts = null;
+				return;
+			}
+		}
+
+		this.line = a;
+		this.start = offset - lineStarts[a];
+		this.lineStarts = null;
+		return;
+	}
+
+	@Override public Filename filename() { return filename; }
+	@Override public int line() {
+		update();
+		return line;
+	}
+	@Override public int start() {
+		update();
+		return start;
+	}
+
+	@Override public int hashCode() {
+		return Objects.hash(offset);
+	}
+	@Override public int compareTo(Location other) {
+		if (other instanceof SourceLocation srcLoc) return Integer.compare(offset, srcLoc.offset);
+		else return super.compareTo(other);
+	}
+	@Override public boolean equals(Object obj) {
+		if (obj instanceof SourceLocation other) return this.offset == other.offset;
+		else return super.equals(obj);
+	}
+
+	public SourceLocation(Filename filename, int[] lineStarts, int offset) {
+		this.filename = filename;
+		this.lineStarts = lineStarts;
+		this.offset = offset;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/patterns/AssignTarget.java

@@ -0,0 +1,27 @@
+package me.topchetoeu.j2s.compilation.patterns;
+
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+
+/**
+ * Represents all nodes that can be assign targets
+ */
+public interface AssignTarget extends AssignTargetLike {
+	Location loc();
+
+	/**
+	 * Called to perform calculations before the assigned value is calculated
+	 */
+	default void beforeAssign(CompileResult target) {}
+	/**
+	 * Called to perform the actual assignemnt. Between the `beforeAssign` and this call a single value will have been pushed to the stack
+	 * @param pollute Whether or not to leave the original value on the stack
+	 */
+	void afterAssign(CompileResult target, boolean pollute);
+
+	default void assign(CompileResult target, boolean pollute) {
+		afterAssign(target, pollute);
+	}
+
+	@Override default AssignTarget toAssignTarget() { return this; }
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/patterns/AssignTargetLike.java

@@ -0,0 +1,8 @@
+package me.topchetoeu.j2s.compilation.patterns;
+
+/**
+ * Represents all nodes that can be converted to assign targets
+ */
+public interface AssignTargetLike {
+	AssignTarget toAssignTarget();
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/patterns/ChangeTarget.java

@@ -0,0 +1,7 @@
+package me.topchetoeu.j2s.compilation.patterns;
+
+import me.topchetoeu.j2s.compilation.CompileResult;
+
+public interface ChangeTarget extends AssignTarget {
+	void beforeChange(CompileResult target);
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/scope/FunctionScope.java

@@ -0,0 +1,221 @@
+package me.topchetoeu.j2s.compilation.scope;
+
+import java.util.ArrayList;
+import java.util.HashMap;
+
+public final class FunctionScope {
+	protected final VariableList locals = new VariableList(VariableIndex.IndexType.LOCALS);
+	protected final VariableList capturables = new VariableList(VariableIndex.IndexType.CAPTURABLES, this.locals);
+	private final VariableList captures = new VariableList(VariableIndex.IndexType.CAPTURES);
+
+	private final HashMap<String, Variable> localsMap = new HashMap<>();
+	private final HashMap<String, Variable> capturesMap = new HashMap<>();
+	private final ArrayList<Variable> catchesMap = new ArrayList<>();
+
+	private final HashMap<Variable, Variable> childToParent = new HashMap<>();
+	private final HashMap<Variable, Variable> parentToChild = new HashMap<>();
+
+	public final FunctionScope parent;
+	public final boolean passthrough;
+
+	private Variable addCaptured(Variable var, boolean captured) {
+		if (captured && !this.capturables.has(var) && !this.captures.has(var)) this.capturables.add(var);
+		return var;
+	}
+
+	private Variable getCatchVar(String name) {
+		for (var el : catchesMap) {
+			if (el.name.equals(name)) return el;
+		}
+
+		return null;
+	}
+
+	/**
+	 * @return If a variable with the same name exists, the old variable. Otherwise, the given variable
+	 */
+	public Variable define(Variable var) {
+		if (passthrough) return null;
+		else {
+			var catchVar = getCatchVar(var.name);
+			if (catchVar != null) return catchVar;
+			if (localsMap.containsKey(var.name)) return localsMap.get(var.name);
+			if (capturesMap.containsKey(var.name)) throw new RuntimeException("HEY!");
+
+			localsMap.put(var.name, var);
+			return locals.add(var);
+		}
+	}
+
+	/**
+	 * @return A variable with the given name, or null if a global variable
+	 */
+	public Variable define(String name) {
+		return define(new Variable(name, false));
+	}
+
+	/**
+	 * Creates a catch variable and returns it
+	 */
+	public Variable defineCatch(String name) {
+		var var = new Variable(name, false);
+		this.locals.add(var);
+		this.catchesMap.add(var);
+		return var;
+	}
+	/**
+	 * Creates a catch variable, using a specific variable instance
+	 * Used in the second pass
+	 */
+	public Variable defineCatch(String name, Variable var) {
+		this.locals.add(var);
+		this.catchesMap.add(var);
+		return var;
+	}
+	/**
+	 * Removes the last catch variable.
+	 * NOTE: the variable is still in the internal list. It just won't be findable by its name
+	 */
+	public void undefineCatch() {
+		this.catchesMap.remove(this.catchesMap.size() - 1);
+	}
+
+	/**
+	 * Gets the index supplier of the given variable name, or null if it is a global
+	 * 
+	 * @param capture If true, the variable is being captured by a function
+	 */
+	public Variable get(String name, boolean capture) {
+		var catchVar = getCatchVar(name);
+
+		if (catchVar != null) return addCaptured(catchVar, capture);
+		if (localsMap.containsKey(name)) return addCaptured(localsMap.get(name), capture);
+		if (capturesMap.containsKey(name)) return addCaptured(capturesMap.get(name), capture);
+
+		if (parent == null) return null;
+
+		var parentVar = parent.get(name, true);
+		if (parentVar == null) return null;
+
+		var childVar = captures.add(parentVar.clone().setIndexSupplier(null));
+		capturesMap.put(childVar.name, childVar);
+		childToParent.put(childVar, parentVar);
+		parentToChild.put(parentVar, childVar);
+
+		return childVar;
+	}
+
+	/**
+	 * If the variable given is contained in this function, just returns the variable itself.
+	 * However, this function is important to handle cases in which you might want to access
+	 * a captured variable. In such cases, this function will return a capture to the given variable.
+	 *
+	 * @param capture Whether or not to execute this capturing logic
+	 */
+	public Variable get(Variable var, boolean capture) {
+		if (captures.has(var)) return addCaptured(var, capture);
+		if (locals.has(var)) return addCaptured(var, capture);
+
+		if (capture) {
+			if (parentToChild.containsKey(var)) return addCaptured(parentToChild.get(var), capture);
+	
+			if (parent == null) return null;
+	
+			var parentVar = parent.get(var, true);
+			if (parentVar == null) return null;
+	
+			var childVar = captures.add(parentVar.clone());
+			childToParent.put(childVar, parentVar);
+			parentToChild.put(parentVar, childVar);
+	
+			return childVar;
+		}
+		else return null;
+	}
+
+	/**
+	 * Checks if the given variable name is accessible
+	 * 
+	 * @param capture If true, will check beyond this function's scope
+	 */
+	public boolean has(String name, boolean capture) {
+		if (localsMap.containsKey(name)) return true;
+
+		if (capture) {
+			if (capturesMap.containsKey(name)) return true;
+			if (parent != null) return parent.has(name, true);
+		}
+
+		return false;
+	}
+
+	public int localsCount() {
+		return locals.size();
+	}
+	public int capturesCount() {
+		return captures.size();
+	}
+	public int capturablesCount() {
+		return capturables.size();
+	}
+
+	public int[] getCaptureIndices() {
+		var res = new int[captures.size()];
+		var i = 0;
+
+		for (var el : captures) {
+			assert childToParent.containsKey(el);
+			res[i] = childToParent.get(el).index().toCaptureIndex();
+			i++;
+		}
+
+		return res;
+	}
+
+	public Iterable<Variable> capturables() {
+		return capturables;
+	}
+	public Iterable<Variable> locals() {
+		return locals;
+	}
+
+	public String[] captureNames() {
+		var res = new String[this.captures.size()];
+		var i = 0;
+
+		for (var el : this.captures) {
+			res[i++] = el.name;
+		}
+
+		return res;
+	}
+	public String[] localNames() {
+		var res = new String[this.locals.size()];
+		var i = 0;
+
+		for (var el : this.locals) {
+			res[i++] = el.name;
+		}
+
+		return res;
+	}
+	public String[] capturableNames() {
+		var res = new String[this.capturables.size()];
+		var i = 0;
+
+		for (var el : this.capturables) {
+			res[i++] = el.name;
+		}
+
+		return res;
+	}
+
+	public FunctionScope(FunctionScope parent) {
+		this.parent = parent;
+		this.passthrough = false;
+	}
+	public FunctionScope(boolean passthrough) {
+		this.parent = null;
+		this.passthrough = passthrough;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/scope/Variable.java

@@ -0,0 +1,35 @@
+package me.topchetoeu.j2s.compilation.scope;
+
+import java.util.function.Supplier;
+
+public final class Variable {
+	private Supplier<VariableIndex> indexSupplier;
+
+	public final boolean readonly;
+	public final String name;
+
+	public final VariableIndex index() {
+		return indexSupplier.get();
+	}
+
+	public final Variable setIndexSupplier(Supplier<VariableIndex> index) {
+		this.indexSupplier = index;
+		return this;
+	}
+	public final Supplier<VariableIndex> indexSupplier() {
+		return indexSupplier;
+	}
+
+	public final Variable clone() {
+		return new Variable(name, readonly).setIndexSupplier(indexSupplier);
+	}
+
+	public Variable(String name, boolean readonly) {
+		this.name = name;
+		this.readonly = readonly;
+	}
+
+	public static Variable of(String name, boolean readonly, VariableIndex index) {
+		return new Variable(name, readonly).setIndexSupplier(() -> index);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/scope/VariableIndex.java

@@ -0,0 +1,53 @@
+package me.topchetoeu.j2s.compilation.scope;
+
+import me.topchetoeu.j2s.common.Instruction;
+
+public final class VariableIndex {
+	public static enum IndexType {
+		/**
+		 * A simple variable that is only ever used within the function
+		 */
+		LOCALS,
+		/**
+		 * A variable that has the ability to be captured by children functions
+		 */
+		CAPTURABLES,
+		/**
+		 * A variable that has been captured from the parent function
+		 */
+		CAPTURES,
+	}
+
+	public final IndexType type;
+	public final int index;
+
+	public final int toCaptureIndex() {
+		switch (type) {
+			case CAPTURES: return ~index;
+			case CAPTURABLES: return index;
+			default: throw new UnsupportedOperationException("Index type " + type + " may not be captured");
+		}
+	}
+
+	public final Instruction toGet() {
+		switch (type) {
+			case CAPTURES: return Instruction.loadVar(~index);
+			case CAPTURABLES: return Instruction.loadVar(index);
+			case LOCALS: return Instruction.loadVar(index);
+			default: throw new UnsupportedOperationException("Unknown index type " + type);
+		}
+	}
+	public final Instruction toSet(boolean keep) {
+		switch (type) {
+			case CAPTURES: return Instruction.storeVar(~index, keep);
+			case CAPTURABLES: return Instruction.storeVar(index, keep);
+			case LOCALS: return Instruction.storeVar(index, keep);
+			default: throw new UnsupportedOperationException("Unknown index type " + type);
+		}
+	}
+
+	public VariableIndex(VariableIndex.IndexType type, int index) {
+		this.type = type;
+		this.index = index;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/scope/VariableList.java

@@ -0,0 +1,191 @@
+package me.topchetoeu.j2s.compilation.scope;
+
+import java.util.HashMap;
+import java.util.Iterator;
+import java.util.function.IntSupplier;
+import java.util.function.Supplier;
+
+import me.topchetoeu.j2s.compilation.scope.VariableIndex.IndexType;
+
+public final class VariableList implements Iterable<Variable> {
+	private final class VariableNode implements Supplier<VariableIndex> {
+		public Variable var;
+		public VariableNode next;
+		public VariableNode prev;
+		public int index;
+		public int indexIteration = -1;
+
+		public VariableList list() { return VariableList.this; }
+
+		private int getIndex() {
+			if (this.indexIteration != VariableList.this.indexIteration) {
+				this.indexIteration = VariableList.this.indexIteration;
+
+				if (prev == null) this.index = 0;
+				else this.index = prev.getIndex() + 1;
+			}
+
+			return this.index;
+		}
+
+		@Override public VariableIndex get() {
+			if (offset == null) return new VariableIndex(indexType, this.getIndex());
+			else return new VariableIndex(indexType, offset.getAsInt() + this.getIndex());
+		}
+
+		public VariableNode(Variable var, VariableNode next, VariableNode prev) {
+			this.var = var;
+			this.next = next;
+			this.prev = prev;
+		}
+	}
+
+	private VariableNode first, last;
+
+	private HashMap<Variable, VariableNode> varMap = new HashMap<>();
+
+	private final IntSupplier offset;
+	/**
+	 * Increased when indices need recalculation. VariableNode will check if
+	 * its internal indexIteration is up to date with this, and if not, will
+	 * recalculate its index
+	 */
+	private int indexIteration = 0;
+
+	public final VariableIndex.IndexType indexType;
+
+	/**
+	 * Adds the given variable to this list. If it already exists, does nothing
+	 * @return val
+	 */
+	public Variable add(Variable val) {
+		if (this.varMap.containsKey(val)) return val;
+		this.indexIteration++;
+
+		if (val.indexSupplier() instanceof VariableNode prevNode) {
+			prevNode.list().remove(val);
+		}
+
+		var node = new VariableNode(val, null, last);
+
+		if (last != null) {
+			assert first != null;
+
+			last.next = node;
+			node.prev = last;
+
+			last = node;
+		}
+		else {
+			first = last = node;
+		}
+
+		varMap.put(val, node);
+		val.setIndexSupplier(node);
+
+		return val;
+	}
+
+	/**
+	 * If the variable is not in the list, does nothing. Otherwise, removes the variable from the list
+	 * @return null if nothing was done, else the deleted variable (should be var)
+	 */
+	public Variable remove(Variable var) {
+		if (var == null) return null;
+
+		var node = varMap.get(var);
+		if (node == null) return null;
+
+		this.indexIteration++;
+
+		if (node.prev != null) {
+			assert node != first;
+			node.prev.next = node.next;
+		}
+		else {
+			assert node == first;
+			first = first.next;
+		}
+
+		if (node.next != null) {
+			assert node != last;
+			node.next.prev = node.prev;
+		}
+		else {
+			assert node == last;
+			last = last.prev;
+		}
+
+		node.next = null;
+		node.prev = null;
+
+		varMap.remove(node.var);
+		node.var.setIndexSupplier(null);
+
+		return node.var;
+	}
+
+	/**
+	 * Checks if the list has the given variable
+	 */
+	public boolean has(Variable var) {
+		return varMap.containsKey(var);
+	}
+
+	/**
+	 * Returns an indexer for the given variable
+	 */
+	public Supplier<VariableIndex> indexer(Variable var) {
+		return varMap.get(var);
+	}
+
+	public int size() {
+		return varMap.size();
+	}
+
+	public Iterator<Variable> iterator() {
+		return new Iterator<Variable>() {
+			private VariableNode curr = first;
+
+			@Override public boolean hasNext() {
+				return curr != null;
+			}
+			@Override public Variable next() {
+				if (curr == null) return null;
+
+				var res = curr;
+				curr = curr.next;
+				return res.var;
+			}
+		};
+	}
+
+	/**
+	 * @param offset Will offset the indices by the given amount from the supplier
+	 */
+	public VariableList(IndexType type, IntSupplier offset) {
+		this.indexType = type;
+		this.offset = offset;
+	}
+	/**
+	 * @param offset Will offset the indices by the given amount
+	 */
+	public VariableList(IndexType type, int offset) {
+		this.indexType = type;
+		this.offset = () -> offset;
+	}
+	/**
+	 * @param prev Will offset the indices by the size of the given list
+	 */
+	public VariableList(IndexType type, VariableList prev) {
+		this.indexType = type;
+		this.offset = () -> {
+			if (prev.offset != null) return prev.offset.getAsInt() + prev.size();
+			else return prev.size();
+		};
+	}
+	public VariableList(IndexType type) {
+		this.indexType = type;
+		this.offset = null;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/ArgumentsNode.java

@@ -0,0 +1,20 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+
+
+public class ArgumentsNode extends Node {
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.loadArgs());
+	}
+
+	public ArgumentsNode(Location loc) {
+		super(loc);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/ArrayNode.java

@@ -0,0 +1,87 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import java.util.ArrayList;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+
+public class ArrayNode extends Node {
+	public final Node[] statements;
+
+	@Override public void compileFunctions(CompileResult target) {
+		for (var stm : statements) {
+			if (stm != null) stm.compileFunctions(target);
+		}
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		target.add(Instruction.loadArr(statements.length));
+
+		for (var i = 0; i < statements.length; i++) {
+			var el = statements[i];
+			if (el != null) {
+				target.add(Instruction.dup());
+				el.compile(target, true);
+				target.add(Instruction.storeMember(i));
+			}
+		}
+
+		if (!pollute) target.add(Instruction.discard());
+	}
+
+	public ArrayNode(Location loc, Node[] statements) {
+		super(loc);
+		this.statements = statements;
+	}
+
+	public static ParseRes<ArrayNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "[")) return ParseRes.failed();
+		n++;
+
+		var values = new ArrayList<Node>();
+
+		loop: while (true) {
+			n += Parsing.skipEmpty(src, i + n);
+			if (src.is(i + n, "]")) {
+				n++;
+				break;
+			}
+
+			while (src.is(i + n, ",")) {
+				n++;
+				n += Parsing.skipEmpty(src, i + n);
+				values.add(null);
+
+				if (src.is(i + n, "]")) {
+					n++;
+					break loop;
+				}
+			}
+
+			var res = JavaScript.parseExpression(src, i + n, 2);
+			if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected an array element.");
+			n += res.n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			values.add(res.result);
+
+			if (src.is(i + n, ",")) n++;
+			else if (src.is(i + n, "]")) {
+				n++;
+				break;
+			}
+		}
+
+		return ParseRes.res(new ArrayNode(loc, values.toArray(new Node[0])), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/GlobalThisNode.java

@@ -0,0 +1,20 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+
+
+public class GlobalThisNode extends Node {
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.loadGlob());
+	}
+
+	public GlobalThisNode(Location loc) {
+		super(loc);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/ObjectNode.java

@@ -0,0 +1,114 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import java.util.LinkedList;
+import java.util.List;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.members.FieldMemberNode;
+import me.topchetoeu.j2s.compilation.members.Member;
+import me.topchetoeu.j2s.compilation.members.PropertyMemberNode;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.constants.NumberNode;
+import me.topchetoeu.j2s.compilation.values.constants.StringNode;
+
+public class ObjectNode extends Node {
+	public final List<Member> members;
+
+	@Override public void compileFunctions(CompileResult target) {
+		for (var member : members) member.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		target.add(Instruction.loadObj());
+		for (var el : members) el.compile(target, true);
+	}
+
+	public ObjectNode(Location loc, List<Member> map) {
+		super(loc);
+		this.members = map;
+	}
+
+	private static ParseRes<Node> parseComputePropName(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		if (!src.is(i + n, "[")) return ParseRes.failed();
+		n++;
+
+		var val = JavaScript.parseExpression(src, i, 0);
+		if (!val.isSuccess()) return val.chainError(src.loc(i + n), "Expected an expression in compute property");
+		n += val.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "]")) return ParseRes.error(src.loc(i + n), "Expected a closing bracket after compute property");
+		n++;
+
+		return ParseRes.res(val.result, n);
+	}
+	public static ParseRes<Node> parsePropName(Source src, int i) {
+		return ParseRes.first(src, i,
+			(s, j) -> {
+				var m = Parsing.skipEmpty(s, j);
+				var l = s.loc(j + m);
+
+				var r = Parsing.parseIdentifier(s, j + m);
+				if (r.isSuccess()) return ParseRes.res(new StringNode(l, r.result), r.n);
+				else return r.chainError();
+			},
+			StringNode::parse,
+			NumberNode::parse,
+			ObjectNode::parseComputePropName
+		);
+	}
+
+	public static ParseRes<ObjectNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "{")) return ParseRes.failed();
+		n++;
+		n += Parsing.skipEmpty(src, i + n);
+
+		var members = new LinkedList<Member>();
+
+		if (src.is(i + n, "}")) {
+			n++;
+			return ParseRes.res(new ObjectNode(loc, members), n);
+		}
+
+		while (true) {
+			ParseRes<Member> prop = ParseRes.first(src, i + n,
+				PropertyMemberNode::parse,
+				FieldMemberNode::parse
+			);
+			if (!prop.isSuccess()) return prop.chainError(src.loc(i + n), "Expected a member in object literal");
+			n += prop.n;
+
+			members.add(prop.result);
+
+			n += Parsing.skipEmpty(src, i + n);
+			if (src.is(i + n, ",")) {
+				n++;
+				n += Parsing.skipEmpty(src, i + n);
+
+				if (src.is(i + n, "}")) {
+					n++;
+					break;
+				}
+
+				continue;
+			}
+			else if (src.is(i + n, "}")) {
+				n++;
+				break;
+			}
+			else ParseRes.error(src.loc(i + n), "Expected a comma or a closing brace.");
+		}
+	
+		return ParseRes.res(new ObjectNode(loc, members), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/RegexNode.java

@@ -0,0 +1,89 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class RegexNode extends Node {
+	public final String pattern, flags;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		target.add(Instruction.loadIntrinsics("regex"));
+		target.add(Instruction.pushValue(pattern));
+		target.add(Instruction.pushValue(flags));
+		target.add(Instruction.call(2, false));
+		if (!pollute) target.add(Instruction.discard());
+	}
+
+	public static ParseRes<RegexNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n, '/')) return ParseRes.failed();
+		var loc = src.loc(i + n);
+		n++;
+
+		var source = new StringBuilder();
+		var flags = new StringBuilder();
+
+		var inBrackets = false;
+
+		loop: while (true) {
+			if (i + n >= src.size()) break;
+			switch (src.at(i + n)) {
+				case '[':
+					inBrackets = true;
+					source.append('[');
+					n++;
+					continue;
+				case ']':
+					inBrackets = false;
+					source.append(']');
+					n++;
+					continue;
+				case '/':
+					n++;
+					if (inBrackets) {
+						source.append('/');
+						continue;
+					}
+					else break loop;
+				case '\\':
+					source.append('\\');
+					source.append(src.at(i + n + 1));
+					n += 2;
+					break;
+				default:
+					source.append(src.at(i + n));
+					n++;
+					break;
+			}
+		}
+
+		while (true) {
+			char c = src.at(i + n, '\0');
+
+			if (src.is(i + n, v -> Parsing.isAny(c, "dgimsuy"))) {
+				if (flags.indexOf(c + "") >= 0) return ParseRes.error(src.loc(i + n), "The flags of a regular expression may not be repeated");
+				flags.append(c);
+			}
+			else break;
+
+			n++;
+		}
+
+		return ParseRes.res(new RegexNode(loc, source.toString(), flags.toString()), n);
+	}
+
+	public RegexNode(Location loc, String pattern, String flags) {
+		super(loc);
+		this.pattern = pattern;
+		this.flags = flags;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/ThisNode.java

@@ -0,0 +1,20 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+
+
+public class ThisNode extends Node {
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.loadThis());
+	}
+
+	public ThisNode(Location loc) {
+		super(loc);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/VariableNode.java

@@ -0,0 +1,73 @@
+package me.topchetoeu.j2s.compilation.values;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.patterns.ChangeTarget;
+
+public class VariableNode extends Node implements ChangeTarget {
+	public final String name;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	public String assignName() { return name; }
+
+	@Override public void beforeChange(CompileResult target) {
+		target.add(VariableNode.toGet(target, loc(), name));
+	}
+
+	@Override public void afterAssign(CompileResult target, boolean pollute) {
+		target.add(VariableNode.toSet(target, loc(), name, pollute, false)).setLocation(loc());
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		target.add(toGet(target, loc(), name, true, false)).setLocation(loc());
+	}
+
+	public static Instruction toGet(CompileResult target, Location loc, String name, boolean keep, boolean forceGet) {
+		var i = target.scope.get(name, false);
+
+		if (i != null) {
+			if (keep) return i.index().toGet();
+			else return Instruction.nop();
+		}
+		else return Instruction.globGet(name, forceGet);
+	}
+	public static Instruction toGet(CompileResult target, Location loc, String name) {
+		return toGet(target, loc, name, true, false);
+	}
+
+	public static Instruction toSet(CompileResult target, Location loc, String name, boolean keep, boolean init) {
+		var i = target.scope.get(name, false);
+
+		if (i != null) return i.index().toSet(keep);
+		else return Instruction.globSet(name, keep, init);
+	}
+
+	public VariableNode(Location loc, String name) {
+		super(loc);
+		this.name = name;
+	}
+
+	public static ParseRes<VariableNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var literal = Parsing.parseIdentifier(src, i);
+		if (!literal.isSuccess()) return literal.chainError();
+		n += literal.n;
+
+		if (!JavaScript.checkVarName(literal.result)) {
+			if (literal.result.equals("await")) return ParseRes.error(src.loc(i + n), "'await' expressions are not supported");
+			return ParseRes.error(src.loc(i + n), String.format("Unexpected keyword '%s'", literal.result));
+		}
+
+		return ParseRes.res(new VariableNode(loc, literal.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/constants/BoolNode.java

@@ -0,0 +1,22 @@
+package me.topchetoeu.j2s.compilation.values.constants;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+
+public class BoolNode extends Node {
+	public final boolean value;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.pushValue(value));
+	}
+
+	public BoolNode(Location loc, boolean value) {
+		super(loc);
+		this.value = value;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/constants/NullNode.java

@@ -0,0 +1,17 @@
+package me.topchetoeu.j2s.compilation.values.constants;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+
+public class NullNode extends Node {
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.pushNull());
+	}
+
+	public NullNode(Location loc) { super(loc); }
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/constants/NumberNode.java

@@ -0,0 +1,34 @@
+package me.topchetoeu.j2s.compilation.values.constants;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class NumberNode extends Node {
+	public final double value;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.pushValue(value));
+	}
+
+	public NumberNode(Location loc, double value) {
+		super(loc);
+		this.value = value;
+	}
+
+	public static ParseRes<NumberNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var res = Parsing.parseNumber(src, i + n, false);
+		if (res.isSuccess()) return ParseRes.res(new NumberNode(loc, res.result), n + res.n);
+		else return res.chainError();
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/constants/StringNode.java

@@ -0,0 +1,34 @@
+package me.topchetoeu.j2s.compilation.values.constants;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class StringNode extends Node {
+	public final String value;
+
+	@Override public void compileFunctions(CompileResult target) {
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (pollute) target.add(Instruction.pushValue(value));
+	}
+
+	public StringNode(Location loc, String value) {
+		super(loc);
+		this.value = value;
+	}
+
+	public static ParseRes<StringNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var res = Parsing.parseString(src, i + n);
+		if (res.isSuccess()) return ParseRes.res(new StringNode(loc, res.result), n + res.n);
+		else return res.chainError();
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/AssignNode.java

@@ -0,0 +1,51 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.common.SyntaxException;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.patterns.AssignTarget;
+
+public class AssignNode extends Node implements AssignTarget {
+	public final AssignTarget assignable;
+	public final Node value;
+
+	@Override public void compileFunctions(CompileResult target) {
+		((Node)assignable).compileFunctions(target);
+		value.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (assignable instanceof AssignNode other) throw new SyntaxException(other.loc(), "Assign deconstructor not allowed here");
+
+		assignable.beforeAssign(target);
+		value.compile(target, true);
+		assignable.afterAssign(target, pollute);
+	}
+
+	@Override public void afterAssign(CompileResult target, boolean pollute) {
+		if (assignable instanceof AssignNode other) throw new SyntaxException(other.loc(), "Double assign deconstructor not allowed");
+
+		if (pollute) target.add(Instruction.dup(2, 0));
+		else target.add(Instruction.dup());
+		target.add(Instruction.pushUndefined());
+		target.add(Instruction.operation(Operation.EQUALS));
+		var start = target.temp();
+		target.add(Instruction.discard());
+
+		value.compile(target, true);
+
+		target.set(start, Instruction.jmpIfNot(target.size() - start));
+
+		assignable.assign(target, false);
+		if (!pollute) target.add(Instruction.discard());
+	}
+
+	public AssignNode(Location loc, AssignTarget assignable, Node value) {
+		super(loc);
+		this.assignable = assignable;
+		this.value = value;
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/CallNode.java

@@ -0,0 +1,115 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import java.util.ArrayList;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class CallNode extends Node {
+	public final Node func;
+	public final Node[] args;
+	public final boolean isNew;
+
+	@Override public void compileFunctions(CompileResult target) {
+		func.compileFunctions(target);
+		for (var arg : args) arg.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute, BreakpointType type) {
+		if (!isNew && func instanceof IndexNode indexNode) {
+			var obj = indexNode.object;
+			var index = indexNode.index;
+
+			obj.compile(target, true);
+			target.add(Instruction.dup());
+			IndexNode.indexLoad(target, index, true);
+
+			for (var arg : args) arg.compile(target, true);
+
+			target.add(Instruction.call(args.length, true));
+
+			target.setLocationAndDebug(loc(), type);
+		}
+		else {
+			func.compile(target, true);
+			for (var arg : args) arg.compile(target, true);
+
+			if (isNew) target.add(Instruction.callNew(args.length)).setLocationAndDebug(loc(), type);
+			else target.add(Instruction.call(args.length, false)).setLocationAndDebug(loc(), type);
+		}
+		if (!pollute) target.add(Instruction.discard());
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		compile(target, pollute, BreakpointType.STEP_IN);
+	}
+
+	public CallNode(Location loc, boolean isNew, Node func, Node ...args) {
+		super(loc);
+		this.isNew = isNew;
+		this.func = func;
+		this.args = args;
+	}
+
+	public static ParseRes<CallNode> parseCall(Source src, int i, Node prev, int precedence) {
+		if (precedence > 17) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "(")) return ParseRes.failed();
+		n++;
+
+		var args = new ArrayList<Node>();
+		boolean prevArg = false;
+
+		while (true) {
+			var argRes = JavaScript.parseExpression(src, i + n, 2);
+			n += argRes.n;
+			n += Parsing.skipEmpty(src, i + n);
+
+			if (argRes.isSuccess()) {
+				args.add(argRes.result);
+				prevArg = true;
+			}
+			else if (argRes.isError()) return argRes.chainError();
+
+			if (prevArg && src.is(i + n, ",")) {
+				prevArg = false;
+				n++;
+			}
+			else if (src.is(i + n, ")")) {
+				n++;
+				break;
+			}
+			else if (prevArg) return ParseRes.error(src.loc(i + n), "Expected a comma or a closing paren");
+			else return ParseRes.error(src.loc(i + n), "Expected an expression or a closing paren");
+		}
+
+		return ParseRes.res(new CallNode(loc, false, prev, args.toArray(new Node[0])), n);
+	}
+	public static ParseRes<CallNode> parseNew(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "new")) return ParseRes.failed();
+		n += 3;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 18);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after 'new' keyword.");
+		n += valRes.n;
+
+		var callRes = CallNode.parseCall(src, i + n, valRes.result, 0);
+		if (callRes.isFailed()) return ParseRes.res(new CallNode(loc, true, valRes.result), n);
+		if (callRes.isError()) return callRes.chainError();
+		n += callRes.n;
+
+		return ParseRes.res(new CallNode(loc, true, callRes.result.func, callRes.result.args), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/ChangeNode.java

@@ -0,0 +1,65 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.patterns.ChangeTarget;
+import me.topchetoeu.j2s.compilation.values.constants.NumberNode;
+
+public class ChangeNode extends Node {
+	public final ChangeTarget changable;
+	public final Node value;
+	public final Operation op;
+
+	@Override public void compileFunctions(CompileResult target) {
+		((Node)changable).compileFunctions(target);
+		value.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		changable.beforeChange(target);
+		value.compile(target, true);
+		target.add(Instruction.operation(op));
+		changable.afterAssign(target, pollute);
+	}
+
+	public ChangeNode(Location loc, ChangeTarget changable, Node value, Operation op) {
+		super(loc);
+		this.changable = changable;
+		this.value = value;
+		this.op = op;
+	}
+
+	public static ParseRes<ChangeNode> parsePrefixIncrease(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "++")) return ParseRes.failed();
+		n += 2;
+
+		var res = JavaScript.parseExpression(src, i + n, 15);
+		if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected assignable value after prefix operator.");
+		else if (!(res.result instanceof ChangeTarget)) return ParseRes.error(src.loc(i + n), "Expected assignable value after prefix operator.");
+
+		return ParseRes.res(new ChangeNode(loc, (ChangeTarget)res.result, new NumberNode(loc, -1), Operation.SUBTRACT), n + res.n);
+	}
+	public static ParseRes<ChangeNode> parsePrefixDecrease(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "--")) return ParseRes.failed();
+		n += 2;
+
+		var res = JavaScript.parseExpression(src, i + n, 15);
+		if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected assignable value after prefix operator.");
+		else if (!(res.result instanceof ChangeTarget)) return ParseRes.error(src.loc(i + n), "Expected assignable value after prefix operator.");
+
+		return ParseRes.res(new ChangeNode(loc, (ChangeTarget)res.result, new NumberNode(loc, 1), Operation.SUBTRACT), n + res.n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/DiscardNode.java

@@ -0,0 +1,43 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+
+public class DiscardNode extends Node {
+	public final Node value;
+
+	@Override public void compileFunctions(CompileResult target) {
+		if (value != null) value.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (value != null) value.compile(target, false);
+		if (pollute) target.add(Instruction.pushUndefined());
+	}
+
+	public DiscardNode(Location loc, Node val) {
+		super(loc);
+		this.value = val;
+	}
+
+	public static ParseRes<DiscardNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "void")) return ParseRes.failed();
+		n += 4;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 14);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after 'void' keyword.");
+		n += valRes.n;
+
+		return ParseRes.res(new DiscardNode(loc, valRes.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/IndexNode.java

@@ -0,0 +1,154 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Instruction.BreakpointType;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.patterns.ChangeTarget;
+import me.topchetoeu.j2s.compilation.values.constants.NumberNode;
+import me.topchetoeu.j2s.compilation.values.constants.StringNode;
+
+public class IndexNode extends Node implements ChangeTarget {
+	public final Node object;
+	public final Node index;
+
+	@Override public void compileFunctions(CompileResult target) {
+		object.compileFunctions(target);
+		index.compileFunctions(target);
+	}
+
+	@Override public void beforeAssign(CompileResult target) {
+		object.compile(target, true);
+		indexStorePushKey(target, index);
+	}
+	@Override public void beforeChange(CompileResult target) {
+		object.compile(target, true);
+
+		if (index instanceof NumberNode num && (int)num.value == num.value) {
+			target.add(Instruction.dup());
+			target.add(Instruction.loadMember((int)num.value));
+		}
+		else if (index instanceof StringNode str) {
+			target.add(Instruction.dup());
+			target.add(Instruction.loadMember(str.value));
+		}
+		else {
+			index.compile(target, true);
+
+			target.add(Instruction.dup(1, 1));
+			target.add(Instruction.dup(1, 1));
+			target.add(Instruction.loadMember());
+		}
+	}
+
+	@Override public void assign(CompileResult target, boolean pollute) {
+		object.compile(target, true);
+		target.add(Instruction.dup(1, 1));
+		indexStorePushKey(target, index);
+		indexStore(target, index, pollute);
+	}
+
+	@Override public void afterAssign(CompileResult target, boolean pollute) {
+		indexStore(target, index, pollute);
+	}
+
+	public void compile(CompileResult target, boolean dupObj, boolean pollute) {
+		object.compile(target, true);
+		if (dupObj) target.add(Instruction.dup());
+
+		if (index instanceof NumberNode num && (int)num.value == num.value) {
+			target.add(Instruction.loadMember((int)num.value));
+		}
+		else if (index instanceof StringNode str) {
+			target.add(Instruction.loadMember(str.value));
+		}
+		else {
+			index.compile(target, true);
+			target.add(Instruction.loadMember());
+		}
+
+		target.setLocationAndDebug(loc(), BreakpointType.STEP_IN);
+
+		if (!pollute) target.add(Instruction.discard());
+	}
+	@Override public void compile(CompileResult target, boolean pollute) {
+		compile(target, false, pollute);
+	}
+
+	public IndexNode(Location loc, Node object, Node index) {
+		super(loc);
+		this.object = object;
+		this.index = index;
+	}
+
+	public static ParseRes<IndexNode> parseIndex(Source src, int i, Node prev, int precedence) {
+		if (precedence > 18) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "[")) return ParseRes.failed();
+		n++;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 0);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value in index expression");
+		n += valRes.n;
+		n += Parsing.skipEmpty(src, i + n);
+
+		if (!src.is(i + n, "]")) return ParseRes.error(src.loc(i + n), "Expected a closing bracket");
+		n++;
+
+		return ParseRes.res(new IndexNode(loc, prev, valRes.result), n);
+	}
+	public static ParseRes<IndexNode> parseMember(Source src, int i, Node prev, int precedence) {
+		if (precedence > 18) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, ".")) return ParseRes.failed();
+		n++;
+
+		var literal = Parsing.parseIdentifier(src, i + n);
+		if (!literal.isSuccess()) return literal.chainError(src.loc(i + n), "Expected an identifier after member access.");
+		n += literal.n;
+
+		return ParseRes.res(new IndexNode(loc, prev, new StringNode(loc, literal.result)), n);
+	}
+
+	public static void indexStorePushKey(CompileResult target, Node index) {
+		if (index instanceof NumberNode num && (int)num.value == num.value)  return;
+		if (index instanceof StringNode) return;
+		index.compile(target, true);
+	}
+	public static void indexStore(CompileResult target, Node index, boolean pollute) {
+		if (index instanceof NumberNode num && (int)num.value == num.value) {
+			target.add(Instruction.storeMember((int)num.value, pollute));
+		}
+		else if (index instanceof StringNode str) {
+			target.add(Instruction.storeMember(str.value, pollute));
+		}
+		else {
+			target.add(Instruction.storeMember(pollute));
+		}
+	}
+	public static void indexLoad(CompileResult target, Node index, boolean pollute) {
+		if (index instanceof NumberNode num && (int)num.value == num.value) {
+			target.add(Instruction.loadMember((int)num.value));
+		}
+		else if (index instanceof StringNode str) {
+			target.add(Instruction.loadMember(str.value));
+		}
+		else {
+			index.compile(target, true);
+			target.add(Instruction.loadMember());
+		}
+
+		if (!pollute) target.add(Instruction.discard());
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/LazyAndNode.java

@@ -0,0 +1,50 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class LazyAndNode extends Node {
+	public final Node first, second;
+
+	@Override public void compileFunctions(CompileResult target) {
+		first.compileFunctions(target);
+		second.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		first.compile(target, true);
+		if (pollute) target.add(Instruction.dup());
+		int start = target.temp();
+		if (pollute) target.add(Instruction.discard());
+		second.compile(target, pollute);
+		target.set(start, Instruction.jmpIfNot(target.size() - start));
+	}
+
+	public LazyAndNode(Location loc, Node first, Node second) {
+		super(loc);
+		this.first = first;
+		this.second = second;
+	}
+
+
+	public static ParseRes<LazyAndNode> parse(Source src, int i, Node prev, int precedence) {
+		if (precedence < 4) return ParseRes.failed();
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n, "&&")) return ParseRes.failed();
+		var loc = src.loc(i + n);
+		n += 2;
+
+		var res = JavaScript.parseExpression(src, i + n, 4);
+		if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected a value after the '&&' operator.");
+		n += res.n;
+
+		return ParseRes.res(new LazyAndNode(loc, prev, res.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/LazyOrNode.java

@@ -0,0 +1,51 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+
+public class LazyOrNode extends Node {
+	public final Node first, second;
+
+	@Override public void compileFunctions(CompileResult target) {
+		first.compileFunctions(target);
+		second.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		first.compile(target, true);
+		if (pollute) target.add(Instruction.dup());
+		int start = target.temp();
+		if (pollute) target.add(Instruction.discard());
+		second.compile(target, pollute);
+		target.set(start, Instruction.jmpIf(target.size() - start));
+	}
+
+	public LazyOrNode(Location loc, Node first, Node second) {
+		super(loc);
+		this.first = first;
+		this.second = second;
+	}
+
+
+	public static ParseRes<LazyOrNode> parse(Source src, int i, Node prev, int precedence) {
+		if (precedence < 3) return ParseRes.failed();
+		var n = Parsing.skipEmpty(src, i);
+
+		if (!src.is(i + n, "||")) return ParseRes.failed();
+		var loc = src.loc(i + n);
+		n += 2;
+
+		var res = JavaScript.parseExpression(src, i + n, 4);
+		if (!res.isSuccess()) return res.chainError(src.loc(i + n), "Expected a value after the '||' operator.");
+		n += res.n;
+
+		return ParseRes.res(new LazyOrNode(loc, prev, res.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/OperationNode.java

@@ -0,0 +1,237 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import java.util.Arrays;
+import java.util.List;
+import java.util.Map;
+import java.util.stream.Collectors;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.patterns.AssignTargetLike;
+import me.topchetoeu.j2s.compilation.patterns.ChangeTarget;
+
+public class OperationNode extends Node {
+	private static interface OperatorFactory {
+		String token();
+		int precedence();
+		ParseRes<Node> construct(Source src, int i, Node prev);
+	}
+
+	private static class NormalOperatorFactory implements OperatorFactory {
+		public final String token;
+		public final int precedence;
+		public final Operation operation;
+
+		@Override public int precedence() { return precedence; }
+		@Override public String token() { return token; }
+		@Override public ParseRes<Node> construct(Source src, int i, Node prev) {
+			var loc = src.loc(i);
+
+			var other = JavaScript.parseExpression(src, i, precedence + 1);
+			if (!other.isSuccess()) return other.chainError(src.loc(i + other.n), String.format("Expected a value after '%s'", token));
+			return ParseRes.res(new OperationNode(loc, operation, prev, (Node)other.result), other.n);
+		}
+
+		public NormalOperatorFactory(String token, int precedence, Operation operation) {
+			this.token = token;
+			this.precedence = precedence;
+			this.operation = operation;
+		}
+	}
+	private static class AssignmentOperatorFactory implements OperatorFactory {
+		public final String token;
+		public final int precedence;
+		public final Operation operation;
+
+		@Override public int precedence() { return precedence; }
+		@Override public String token() { return token; }
+		@Override public ParseRes<Node> construct(Source src, int i, Node prev) {
+			var loc = src.loc(i);
+
+			if (operation == null) {
+				if (!(prev instanceof AssignTargetLike target)) return ParseRes.error(loc, String.format("Expected an assignable expression before '%s'", token));
+
+				var other = JavaScript.parseExpression(src, i, precedence);
+				if (!other.isSuccess()) return other.chainError(src.loc(i + other.n), String.format("Expected a value after '%s'", token));
+
+				return ParseRes.res(new AssignNode(loc, target.toAssignTarget(), other.result), other.n);
+			}
+			else {
+				if (!(prev instanceof ChangeTarget target)) return ParseRes.error(loc, String.format("Expected a changeable expression before '%s'", token));
+
+				var other = JavaScript.parseExpression(src, i, precedence);
+				if (!other.isSuccess()) return other.chainError(src.loc(i + other.n), String.format("Expected a value after '%s'", token));
+
+				return ParseRes.res(new ChangeNode(loc, target, other.result, operation), other.n);
+			}
+		}
+
+		public AssignmentOperatorFactory(String token, int precedence, Operation operation) {
+			this.token = token;
+			this.precedence = precedence;
+			this.operation = operation;
+		}
+	}
+	private static class LazyAndFactory implements OperatorFactory {
+		@Override public int precedence() { return 5; }
+		@Override public String token() { return "&&"; }
+		@Override public ParseRes<Node> construct(Source src, int i, Node prev) {
+			var loc = src.loc(i);
+
+			var other = JavaScript.parseExpression(src, i, 6);
+			if (!other.isSuccess()) return other.chainError(src.loc(i + other.n), "Expected a value after '&&'");
+			return ParseRes.res(new LazyAndNode(loc, prev, (Node)other.result), other.n);
+		}
+	}
+	private static class LazyOrFactory implements OperatorFactory {
+		@Override public int precedence() { return 4; }
+		@Override public String token() { return "||"; }
+		@Override public ParseRes<Node> construct(Source src, int i, Node prev) {
+			var loc = src.loc(i);
+
+			var other = JavaScript.parseExpression(src, i, 5);
+			if (!other.isSuccess()) return other.chainError(src.loc(i + other.n), "Expected a value after '||'");
+			return ParseRes.res(new LazyOrNode(loc, prev, (Node)other.result), other.n);
+		}
+	}
+
+	public final Node[] args;
+	public final Operation operation;
+
+	@Override public void compileFunctions(CompileResult target) {
+		for (var arg : args) arg.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		for (var arg : args) {
+			arg.compile(target, true);
+		}
+
+		target.add(Instruction.operation(operation));
+		if (!pollute) target.add(Instruction.discard());
+	}
+
+	public OperationNode(Location loc, Operation operation, Node ...args) {
+		super(loc);
+		this.operation = operation;
+		this.args = args;
+	}
+
+	private static final Map<String, OperatorFactory> factories = Arrays.asList(
+		new NormalOperatorFactory("*", 13, Operation.MULTIPLY),
+		new NormalOperatorFactory("/", 12, Operation.DIVIDE),
+		new NormalOperatorFactory("%", 12, Operation.MODULO),
+		new NormalOperatorFactory("-", 11, Operation.SUBTRACT),
+		new NormalOperatorFactory("+", 11, Operation.ADD),
+		new NormalOperatorFactory(">>", 10, Operation.SHIFT_RIGHT),
+		new NormalOperatorFactory("<<", 10, Operation.SHIFT_LEFT),
+		new NormalOperatorFactory(">>>", 10, Operation.USHIFT_RIGHT),
+		new NormalOperatorFactory(">", 9, Operation.GREATER),
+		new NormalOperatorFactory("<", 9, Operation.LESS),
+		new NormalOperatorFactory(">=", 9, Operation.GREATER_EQUALS),
+		new NormalOperatorFactory("<=", 9, Operation.LESS_EQUALS),
+		new NormalOperatorFactory("!=", 8, Operation.LOOSE_NOT_EQUALS),
+		new NormalOperatorFactory("!==", 8, Operation.NOT_EQUALS),
+		new NormalOperatorFactory("==", 8, Operation.LOOSE_EQUALS),
+		new NormalOperatorFactory("===", 8, Operation.EQUALS),
+		new NormalOperatorFactory("&", 7, Operation.AND),
+		new NormalOperatorFactory("^", 6, Operation.XOR),
+		new NormalOperatorFactory("|", 5, Operation.OR),
+
+		new AssignmentOperatorFactory("=", 2, null),
+		new AssignmentOperatorFactory("*=", 2, Operation.MULTIPLY),
+		new AssignmentOperatorFactory("/=", 2, Operation.DIVIDE),
+		new AssignmentOperatorFactory("%=", 2, Operation.MODULO),
+		new AssignmentOperatorFactory("-=", 2, Operation.SUBTRACT),
+		new AssignmentOperatorFactory("+=", 2, Operation.ADD),
+		new AssignmentOperatorFactory(">>=", 2, Operation.SHIFT_RIGHT),
+		new AssignmentOperatorFactory("<<=", 2, Operation.SHIFT_LEFT),
+		new AssignmentOperatorFactory(">>>=", 2, Operation.USHIFT_RIGHT),
+		new AssignmentOperatorFactory("&=", 2, Operation.AND),
+		new AssignmentOperatorFactory("^=", 2, Operation.XOR),
+		new AssignmentOperatorFactory("|=", 2, Operation.OR),
+
+		new LazyAndFactory(),
+		new LazyOrFactory()
+	).stream().collect(Collectors.toMap(v -> v.token(), v -> v));
+
+	private static final List<String> operatorsByLength = factories.keySet().stream().sorted((a, b) -> -a.compareTo(b)).collect(Collectors.toList());
+
+	public static ParseRes<OperationNode> parsePrefix(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		Operation operation = null;
+		String op;
+
+		if (src.is(i + n, op = "+")) operation = Operation.POS;
+		else if (src.is(i + n, op = "-")) operation = Operation.NEG;
+		else if (src.is(i + n, op = "~")) operation = Operation.INVERSE;
+		else if (src.is(i + n, op = "!")) operation = Operation.NOT;
+		else return ParseRes.failed();
+
+		n++;
+
+		var res = JavaScript.parseExpression(src, i + n, 14);
+
+		if (res.isSuccess()) return ParseRes.res(new OperationNode(loc, operation, res.result), n + res.n);
+		else return res.chainError(src.loc(i + n), String.format("Expected a value after the unary operator '%s'.", op));
+	}
+	public static ParseRes<OperationNode> parseInstanceof(Source src, int i, Node prev, int precedence) {
+		if (precedence > 9) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var kw = Parsing.parseIdentifier(src, i + n, "instanceof");
+		if (!kw.isSuccess()) return kw.chainError();
+		n += kw.n;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 10);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after 'instanceof'.");
+		n += valRes.n;
+
+		return ParseRes.res(new OperationNode(loc, Operation.INSTANCEOF, prev, valRes.result), n);
+	}
+	public static ParseRes<OperationNode> parseIn(Source src, int i, Node prev, int precedence) {
+		if (precedence > 9) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		var kw = Parsing.parseIdentifier(src, i + n, "in");
+		if (!kw.isSuccess()) return kw.chainError();
+		n += kw.n;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 10);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after 'in'.");
+		n += valRes.n;
+
+		return ParseRes.res(new OperationNode(loc, Operation.IN, valRes.result, prev), n);
+	}
+	public static ParseRes<? extends Node> parseOperator(Source src, int i, Node prev, int precedence) {
+		var n = Parsing.skipEmpty(src, i);
+
+		for (var token : operatorsByLength) {
+			var factory = factories.get(token);
+
+			if (!src.is(i + n, token)) continue;
+			if (factory.precedence() < precedence) return ParseRes.failed();
+
+			n += token.length();
+			n += Parsing.skipEmpty(src, i + n);
+
+			var res = factory.construct(src, i + n, prev);
+			return res.addN(n);
+		}
+
+		return ParseRes.failed();
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/PostfixNode.java

@@ -0,0 +1,56 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.patterns.ChangeTarget;
+import me.topchetoeu.j2s.compilation.values.constants.NumberNode;
+
+public class PostfixNode extends ChangeNode {
+	@Override public void compileFunctions(CompileResult target) {
+		((Node)changable).compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		super.compile(target, pollute);
+
+		if (pollute) {
+			value.compile(target, true);
+			target.add(Instruction.operation(Operation.ADD));
+		}
+	}
+
+	public PostfixNode(Location loc, ChangeTarget value, double addAmount) {
+		super(loc, value, new NumberNode(loc, -addAmount), Operation.SUBTRACT);
+	}
+
+	public static ParseRes<ChangeNode> parsePostfixIncrease(Source src, int i, Node prev, int precedence) {
+		if (precedence > 15) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "++")) return ParseRes.failed();
+		if (!(prev instanceof ChangeTarget)) return ParseRes.error(src.loc(i + n), "Expected assignable value before suffix operator.");
+		n += 2;
+
+		return ParseRes.res(new PostfixNode(loc, (ChangeTarget)prev, 1), n);
+	}
+	public static ParseRes<ChangeNode> parsePostfixDecrease(Source src, int i, Node prev, int precedence) {
+		if (precedence > 15) return ParseRes.failed();
+
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!src.is(i + n, "--")) return ParseRes.failed();
+		if (!(prev instanceof ChangeTarget)) return ParseRes.error(src.loc(i + n), "Expected assignable value before suffix operator.");
+		n += 2;
+
+		return ParseRes.res(new PostfixNode(loc, (ChangeTarget)prev, -1), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/TypeofNode.java

@@ -0,0 +1,52 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.JavaScript;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+import me.topchetoeu.j2s.compilation.parsing.Parsing;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public class TypeofNode extends Node {
+	public final Node value;
+
+	@Override public void compileFunctions(CompileResult target) {
+		value.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (value instanceof VariableNode varNode) {
+			target.add(VariableNode.toGet(target, varNode.loc(), varNode.name, true, true));
+			if (pollute) target.add(Instruction.operation(Operation.TYPEOF));
+			else target.add(Instruction.discard());
+
+			return;
+		}
+
+		value.compile(target, pollute);
+		if (pollute) target.add(Instruction.operation(Operation.TYPEOF));
+	}
+
+	public TypeofNode(Location loc, Node value) {
+		super(loc);
+		this.value = value;
+	}
+
+	public static ParseRes<TypeofNode> parse(Source src, int i) {
+		var n = Parsing.skipEmpty(src, i);
+		var loc = src.loc(i + n);
+
+		if (!Parsing.isIdentifier(src, i + n, "typeof")) return ParseRes.failed();
+		n += 6;
+
+		var valRes = JavaScript.parseExpression(src, i + n, 15);
+		if (!valRes.isSuccess()) return valRes.chainError(src.loc(i + n), "Expected a value after 'typeof' keyword.");
+		n += valRes.n;
+	
+		return ParseRes.res(new TypeofNode(loc, valRes.result), n);
+	}
+}

compilation/src/main/java/me/topchetoeu/j2s/compilation/values/operations/VariableAssignNode.java

@@ -0,0 +1,39 @@
+package me.topchetoeu.j2s.compilation.values.operations;
+
+import me.topchetoeu.j2s.common.Instruction;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.common.Operation;
+import me.topchetoeu.j2s.compilation.CompileResult;
+import me.topchetoeu.j2s.compilation.FunctionNode;
+import me.topchetoeu.j2s.compilation.Node;
+import me.topchetoeu.j2s.compilation.values.VariableNode;
+
+public class VariableAssignNode extends Node {
+	public final String name;
+	public final Node value;
+	public final Operation operation;
+
+	@Override public void compileFunctions(CompileResult target) {
+		value.compileFunctions(target);
+	}
+
+	@Override public void compile(CompileResult target, boolean pollute) {
+		if (operation != null) {
+			target.add(VariableNode.toGet(target, loc(), name));
+			FunctionNode.compileWithName(value, target, true, name);
+			target.add(Instruction.operation(operation));
+			target.add(VariableNode.toSet(target, loc(), name, pollute, false)).setLocation(loc());
+		}
+		else {
+			FunctionNode.compileWithName(value, target, true, name);
+			target.add(VariableNode.toSet(target, loc(), name, pollute, false)).setLocation(loc());
+		}
+	}
+
+	public VariableAssignNode(Location loc, String name, Node val, Operation operation) {
+		super(loc);
+		this.name = name;
+		this.value = val;
+		this.operation = operation;
+	}
+}

compilation/src/test/java/me/topchetoeu/j2s/compilation/TestParseRes.java

@@ -0,0 +1,98 @@
+package me.topchetoeu.j2s.compilation;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+import static org.junit.jupiter.api.Assertions.assertThrows;
+
+import org.junit.jupiter.api.Test;
+
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.parsing.ParseRes;
+
+public class TestParseRes {
+	@Test public void testCreateFailed() {
+		var res = ParseRes.failed();
+		assertEquals(false, res.isSuccess());
+		assertEquals(true, res.isFailed());
+		assertEquals(false, res.isError());
+		assertEquals(0, res.n);
+		assertEquals(null, res.result);
+		assertEquals(null, res.errorLocation);
+		assertEquals(null, res.error);
+	}
+	@Test public void testCreateError() {
+		var res = ParseRes.error(Location.of("test:10:5"), "test");
+		assertEquals(false, res.isSuccess());
+		assertEquals(false, res.isFailed());
+		assertEquals(true, res.isError());
+		assertEquals(0, res.n);
+		assertEquals(null, res.result);
+		assertEquals(Location.of("test:10:5"), res.errorLocation);
+		assertEquals("test", res.error);
+	}
+	@Test public void testCreateResult() {
+		var res = ParseRes.res("test", 10);
+		assertEquals(true, res.isSuccess());
+		assertEquals(false, res.isFailed());
+		assertEquals(false, res.isError());
+		assertEquals(10, res.n);
+		assertEquals("test", res.result);
+		assertEquals(null, res.errorLocation);
+		assertEquals(null, res.error);
+	}
+
+	@Test public void testChainFailed() {
+		var a = ParseRes.<Integer>failed();
+
+		var b1 = a.<String>chainError();
+		assertEquals(a, b1);
+
+		var b2 = a.<String>chainError(Location.of("test:1:2"), "test");
+		assertEquals(true, b2.isError());
+		assertEquals("test", b2.error);
+	}
+	@Test public void testChainError() {
+		var a = ParseRes.<Integer>error(Location.of("test:1:2"), "test");
+
+		var b1 = a.<String>chainError();
+		assertEquals(a, b1);
+
+		var b2 = a.<String>chainError(Location.of("test:1:2"), "test");
+		assertEquals(a, b2);
+	}
+	@Test public void testChainResult() {
+		var a = ParseRes.<Integer>res(10, 6);
+
+		assertThrows(RuntimeException.class, () -> a.<String>chainError());
+
+		var b1 = a.<String>chainError(Location.of("test:1:2"), "test");
+		assertEquals(true, b1.isError());
+		assertEquals("test", b1.error);
+	}
+
+
+	@Test public void testShouldAdd5() {
+		var a = ParseRes.res("test", 6);
+		var b = a.addN(5);
+
+		assertEquals(11, b.n);
+	}
+	@Test public void testShouldSet5() {
+		var a = ParseRes.res("test", 6);
+		var b = a.setN(5);
+
+		assertEquals(5, b.n);
+	}
+
+	@Test public void testShouldNotAdd() {
+		var a = ParseRes.failed();
+		var b = a.addN(5);
+
+		assertEquals(0, b.n);
+	}
+	@Test public void testShouldNotSet() {
+		var a = ParseRes.failed();
+		var b = a.setN(5);
+
+		assertEquals(0, b.n);
+	}
+}

compilation/src/test/java/me/topchetoeu/j2s/compilation/TestSource.java

@@ -0,0 +1,65 @@
+package me.topchetoeu.j2s.compilation;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+import static org.junit.jupiter.api.Assertions.assertThrows;
+
+import org.junit.jupiter.api.Test;
+
+import me.topchetoeu.j2s.common.Environment;
+import me.topchetoeu.j2s.common.Filename;
+import me.topchetoeu.j2s.common.Location;
+import me.topchetoeu.j2s.compilation.parsing.Source;
+
+public class TestSource {
+	private Source mkSource(String src) {
+		return new Source(new Environment(), Filename.parse("test"), src);
+	}
+
+	@Test public void testShouldCreate() {
+		new Source(new Environment(), Filename.parse("test"), "my little source :)");
+		new Source(null, Filename.parse("test"), "my little source :)");
+		new Source("my little source :)");
+	}
+
+	@Test public void testShouldGet() {
+		var src = mkSource("1234567890");
+		assertEquals('1', src.at(0));
+		assertEquals('6', src.at(5));
+	}
+	@Test public void testShouldThrowOutOfRange() {
+		var src = mkSource("1234567890");
+		assertThrows(IndexOutOfBoundsException.class, () -> src.at(-1));
+		assertThrows(IndexOutOfBoundsException.class, () -> src.at(10));
+	}
+	@Test public void testImmutableSrcLoc() {
+		var src = mkSource("1234567890");
+		var loc = src.loc(5);
+		// kinda stupid
+		for (var i = 0; i < 1000; i++) {
+			assertEquals(5, loc.start());
+			assertEquals(0, loc.line());
+			assertEquals(Filename.parse("test"), loc.filename());
+		}
+	}
+	@Test public void testSingleLineSourceLocation() {
+		var src = mkSource("1234567890");
+		assertEquals(Location.of("test:1:1"), src.loc(-5));
+		assertEquals(Location.of("test:1:1"), src.loc(0));
+		assertEquals(Location.of("test:1:10"), src.loc(9));
+		assertEquals(Location.of("test:1:11"), src.loc(14));
+	}
+	@Test public void testMultilineSourceLocation() {
+		var src = mkSource("123\n456\n\n789\n\n\n\n\n\n\n\n\n\n\n\n\n\n\n");
+		assertEquals(Location.of("test:1:1"), src.loc(-5));
+		assertEquals(Location.of("test:1:1"), src.loc(0));
+		assertEquals(Location.of("test:1:4"), src.loc(3));
+		assertEquals(Location.of("test:2:1"), src.loc(4));
+		assertEquals(Location.of("test:2:4"), src.loc(7));
+		assertEquals(Location.of("test:3:1"), src.loc(8));
+		assertEquals(Location.of("test:4:1"), src.loc(9));
+		assertEquals(Location.of("test:4:2"), src.loc(10));
+		assertEquals(Location.of("test:4:4"), src.loc(12));
+		assertEquals(Location.of("test:5:1"), src.loc(13));
+		assertEquals(Location.of("test:19:1"), src.loc(50));
+	}
+}

compilation/src/test/java/me/topchetoeu/j2s/compilation/parsing/TestParseString.java

@@ -0,0 +1,65 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+
+import org.junit.jupiter.api.Test;
+
+public class TestParseString {
+	@Test public void notAString() {
+		var res = Parsing.parseString(new Source("var a = 10"), 0);
+		assertEquals(true, res.isFailed());
+	}
+	@Test public void simple() {
+		var src = new Source("\"this is a test\"");
+		var res = Parsing.parseString(src, 0);
+		assertEquals(true, res.isSuccess());
+		assertEquals("this is a test", res.result);
+		assertEquals(16, res.n);
+	}
+	@Test public void simpleEscaped() {
+		var src = new Source("\'this\\\\ is \\n some \\'\\\"\\\n escapes for you :\\)\'");
+		var res = Parsing.parseString(src, 0);
+		assertEquals(true, res.isSuccess());
+		assertEquals("this\\ is \n some '\" escapes for you :)", res.result);
+		assertEquals(46, res.n);
+	}
+	@Test public void allEscaped() {
+		var src = new Source("'\\b\\t\\n\\f\\r\\0\\'\\x01\\u0123'");
+		var res = Parsing.parseString(src, 0);
+		assertEquals(true, res.isSuccess());
+		assertEquals("\b\t\n\f\r\0'\u0001\u0123", res.result);
+		assertEquals(26, res.n);
+	}
+	@Test public void shouldFailOctal() {
+		var res1 = Parsing.parseString(new Source("'\\012'"), 0);
+		assertEquals(true, res1.isError());
+
+		var res2 = Parsing.parseString(new Source("'\\123'"), 0);
+		assertEquals(true, res2.isError());
+	}
+	@Test public void shouldFailIncompleteHex() {
+		var res1 = Parsing.parseString(new Source("'\\x"), 0);
+		assertEquals(true, res1.isError());
+
+		var res2 = Parsing.parseString(new Source("'\\x1turd"), 0);
+		assertEquals(true, res2.isError());
+
+		var res3 = Parsing.parseString(new Source("'\\xturd"), 0);
+		assertEquals(true, res3.isError());
+	}
+	@Test public void shouldFailIncompleteUnicode() {
+		var res1 = Parsing.parseString(new Source("'\\u"), 0);
+		assertEquals(true, res1.isError());
+
+		var res2 = Parsing.parseString(new Source("'\\u123turd"), 0);
+		assertEquals(true, res2.isError());
+
+		var res3 = Parsing.parseString(new Source("'\\uturd"), 0);
+		assertEquals(true, res3.isError());
+	}
+	@Test public void unterminated() {
+		var src = new Source("\"this is a test");
+		var res = Parsing.parseString(src, 0);
+		assertEquals(true, res.isError());
+	}
+}

compilation/src/test/java/me/topchetoeu/j2s/compilation/parsing/TestSkipWhite.java

@@ -0,0 +1,48 @@
+package me.topchetoeu.j2s.compilation.parsing;
+
+import static org.junit.jupiter.api.Assertions.assertEquals;
+
+import org.junit.jupiter.api.Test;
+
+public class TestSkipWhite {
+	@Test public void shBang() {
+		var res1 = Parsing.skipEmpty(new Source("#!my-shbang\n10"), 0);
+		assertEquals(12, res1);
+
+		var res2 = Parsing.skipEmpty(new Source("#!fin"), 0);
+		assertEquals(5, res2);
+	}
+	@Test public void simple() {
+		var res1 = Parsing.skipEmpty(new Source("2134   45324"), 4);
+		assertEquals(3, res1);
+
+		var res2 = Parsing.skipEmpty(new Source("2134   "), 4);
+		assertEquals(3, res2);
+	}
+
+	@Test public void nothing() {
+		var res1 = Parsing.skipEmpty(new Source("12345678"), 4);
+		assertEquals(0, res1);
+
+		var res2 = Parsing.skipEmpty(new Source("1234"), 4);
+		assertEquals(0, res2);
+	}
+
+	@Test public void singleLineComment() {
+		var res1 = Parsing.skipEmpty(new Source("123// test\n54314214"), 3);
+		assertEquals(8, res1);
+
+		var res2 = Parsing.skipEmpty(new Source("123// test"), 3);
+		assertEquals(7, res2);
+	}
+	@Test public void multilineComment() {
+		var res1 = Parsing.skipEmpty(new Source("123/*test*/54314214"), 3);
+		assertEquals(8, res1);
+
+		var res2 = Parsing.skipEmpty(new Source("123/*test*/"), 3);
+		assertEquals(8, res2);
+
+		var res3 = Parsing.skipEmpty(new Source("123/*test"), 3);
+		assertEquals(6, res3);
+	}
+}

doc/text/.gitignore

@@ -0,0 +1,9 @@
+/*
+!/img
+!/src
+!/.gitignore
+!/build
+!/document.md
+!/README.md
+!/requirements.md
+!/template.html

doc/text/README.md

@@ -0,0 +1 @@
+This is the main body of my thesis. **BE WARNED!** It is quite lengthy and written in Bulgarian.

doc/text/build

@@ -0,0 +1,42 @@
+#!/bin/luajit -lsrc.build
+
+local config = require "config";
+
+function profession(val)
+	if val == "sys" then
+		return {
+			profession = "481020 „Системен програмист“",
+			specialty = "4810201 „Системно програмиране“",
+		};
+	elseif val == "net" then
+		return combine {
+			profession = "523050 „Техник на компютърни системи“",
+			specialty = "5230502 „Компютърни мрежи“",
+		};
+	end
+end
+
+emit {
+	target = "res.html",
+	template {
+		template = "template.html",
+		year = os.date "%Y",
+		prev_year = os.date "%Y" - 1,
+		config,
+		profession(config.profession),
+
+		build {
+			"requirements.md",
+			content = "requirements",
+		},
+		build {
+			"document.md",
+			content = "content",
+			toc = "toc",
+			ctx = {
+				chapter_format = "Глава %s<br/>",
+				chapter_format_plain = "Глава %s: ",
+			},
+		},
+	},
+}